Tải bản đầy đủ

Giao anDS11 41 42

Ngày soạn:10/12/2017

Tiết: 41  42
CẤP SỐ CỘNG
I. MỤC TIÊU
1. Kiến thức:
- Biết khái niệm cấp số cộng, tính chất của cấp số cộng, số hạng tổng quát, tổng n số hạng
đầu tiên của cấp số cộng.
2. Kỹ năng:
- Biết sử dụng các công thức và tính chất của cấp số cộng để giải toán.
- Tìm các yếu tố còn lại khi biết ba yếu tố trong 5 yếu tố : u1, un, n, Sn, d.
3. Thái độ:
- Cẩn thận, chính xác.
- Thấy được toán học có ứng dụng thực tiễn
4. Năng lực hướng tới
- Năng lực tự học; giải quyết vấn đề, tính toán.
II. CHUẨN BỊ CỦA GIÁO VIÊN VÀ HỌC SINH
1. Giáo viên
- Giáo án, SGK, đồ dùng dạy học
2. Học sinh
- SGK, đồ dùng học tập.

III. PHƯƠNG TIỆN, PHƯƠNG PHÁP, KỸ THUẬT DẠY HỌC
Thuyết trình, nêu và giải quyết vấn đề. Hoạt động nhóm.
IV. TIẾN TRÌNH DẠY HỌC
Tiết 1: Giới thiệu, Nội dung, luyện tập bài 1. Tiết 2: Luyện tập 2, 3, vận dụng và tìm tòi mở
rộng.
1. Giới thiệu
Cho biết số tiếp theo của dãy số 1, 4, 7, 10, 13, 16... ?
Để tìm hiểu các kiến thức của CẤP SỐ CỘNG, chúng ta đi vào bài học ngày hôm nay.
2. Nội dung
2.1. Định nghĩa.
Nếu (un) là cấp số cộng với công sai d thì ta có công thức: un1  un  d, n�N *
+ Nếu d = 0 thì CSC không đổi.
Ví dụ: 1, 4, 7, 10, 13, 16, .... là cấp số cộng với d=3.
2.2. Số hạng tổng quát
un  u1   n  1 d
Định lí 1 (SGK):
2.3. Tính chất các số hạng của cấp số cộng
Định lý 2 (SGK): uk 

uk1  uk1
v�
i k �2
2

2.4. Tổng n số hạng đầu của một cấp số cộng.
Định lí 3 (SGK): Sn 
Chú ý: Sn  nu1 

n u1  un 

n n  1
2

2
d

3. Luyện tập:
Bài 1. Trong các dãy số sau đây, dãy số nào là cấp số cộng? Tính số hạng đầu và công sai của nó:


a) un=5−2n;

n
2

b) un=  1 ;

c) un=3n

;

Hướng dẫn giải:
a) un+1 – un = - 2 với n ��*
Vậy dãy số là CSC với u1= 3, d = 2
b) Dãy số là CSC với u1 = -

1
1
,d =
2
2

c) ) un+1 – un = 2.3n với n ��*
Vậy dãy số đã không phải là CSC
Bài 2. Tìm số hạng đầu và công sai của các cấp số cộng sau, biết:
u1  u3  u5  10

,
u1  u6  17


a) �

u7  u3  8

u2 .u7  75


b) �

Hướng dẫn giải:
a) u1 = 16 và d = - 3
b) u1= 3và d=2 hoặc u1=-17 và d=2.
Bài 3. Trong các bài toán về cấp số cộng, ta thường gặp năm đại lượng u1,n,d,un,Snu1,n,d,un,Sn.
a) Hãy viết các hệ thức liên hệ giữa các đại lượng để có thể tìm được các đại lượng còn lại?
b) Lập bảng theo mẫu sau và điền vào chỗ trống thích hợp:

Hướng dẫn giải:
a) un  u1   n  1 d
Sn 

n u1  u2 

2
n n  1
Sn  nu1 
d
2

+Cần biết ít nhất ba trong năm đại lượng u1, d, n, un , Sn thì tính được hai đại lượng còn lại.
b) d  3, S20  530
u1  36, u15  20
n  28, Sn  140
u1  5, d  2
n  10, un  43

4. Vận dụng, tìm tòi mở rộng:


Cho A, B, C là 3 góc của 1 tam giác. Chứng minh rằng: Nếu: tan

A
B
C
, tan , tan lập thành 1 cấp
2
2
2

số cộng thì cosA, cosB, cosC cũng lập thành 1 cấp số cộng.
Hướng dẫn:
Từ (A/2+C/2) + B/2 = π/2 ta có
tan(A/2+C/2) = cot(B/2) <=> (tanA/2 + tanC/2)/ (1 - tanA/2.tanC/2) = 1/tan(B/2)
<=> (tanA/2 + tanC/2).tanB/2 = 1 - tanA/2.tanC/2 (*)
-----------------tanA/2 ; tanB/2 ; tnaC/2 lập thành cấp số cộng <=> tanA/2 + tanC/2 = 2tanB/2
thay vào (*) ta có:
2tan²(B/2) = 1 - tan(A/2).tan(C/2)
<=> 2sin²(B/2) / cos²(B/2) = 1 - sin(A/2).sin(C/2)/cos(A/2).cos(C/2)

<=> 4sin²(B/2) / (1+cosB) = 1 - [cos(A/2-C/2) - cos(A/2+C/2)]/[cos(A/2+C/2)+cos(A/2-C/2)...
<=> 4sin²(B/2) / (1+cosB) = 2cos(A/2+C/2) / [cos(A/2+C/2)+cos(A/2-C/2)]
<=> 4sin²(B/2) / (1+cosB) = 2sin(B/2) / [sin(B/2) + cos(A/2-C/2)]
<=> 2sin²(B/2) + 2sin(B/2).cos(A/2-C/2) = 1 + cosB
<=> 1 - cosB + 2cos(A/2+C/2).cos(A/2-C/2) = 1 + cosB
<=> cosA + cosC = 2cosB
<=> cosA ; cosB ; cosC lập thành cấp số cộng .
V.
HƯỚNG DẪN HS TỰ HỌC
Tiết 1:
- HS về nhà xem lại lý thuyết và các ví dụ.
- Xem lại các bài tập để chuẩn bị tiết sau làm bài tập.
Tiết 2:
- HS về nhà xem lại lý thuyết và các bài tập.
- Làm các bài tập còn lại trong SGK.
- Ôn lại kiến thức trong chương III chuẩn bị cho tiết sau ôn tập chương.



Tài liệu bạn tìm kiếm đã sẵn sàng tải về

Tải bản đầy đủ ngay

×

×