Tải bản đầy đủ

ON TONG HOP HSG QG 2 MON HOA HOC

BI TP TNG HP PHN HểA HU C

Câu 1:

1. Hợp chất A có công thức phân tử CHNO, ở thể khí, độ dài liên kết CN
bằng 121 pm (1 pm = 10-12m), độ dài liên kết CO bằng 117 pm. A tan
trong nớc tạo thành dung dịch axit với K a = 1,2 . 10-4. ở 00C, A tự biến đổi
thành chất rắn X không tan trong các dung môi thông thờng, độ dài liên
kết CN bằng 140 pm. Trong dung dịch đặc, A tự biến đổi thành chất rắn
Y có vòng 6 cạnh với độ dài liên kết CN bằng 135 pm. Biết độ dài liên kết
trung bình ở các hợp chất nh sau:
Liên kết

CC

Độ dài,

CN

154


CO

147

C=N

143

130

C=O
123

C N

cacbon

116

oxit
112

pm
a. Hãy viết công thức cấu tạo các đồng phân ứng với công thức phân tử
CHNO. Công thức nào phù hợp với A ở thể khí, vì sao ?
b. Viết công thức cấu tạo và phơng trình phản ứng điện li của A trong
dung dịch.
c. Hãy đề nghị phơng trình phản ứng tạo thành X, Y và công thức cấu tạo
của chúng.
2. Viết công thức các sản phẩm có thể tạo thành khi thực hiện quá trình
đồng phân hoá B (có công thức cấu tạo cho dới) trong môi trờng axit. Gọi
tên cấu hình (nếu có) của các chất và cho biết đồng phân nào có tính
quang hoạt.
CH3

B

Đáp án
1.
a. Các đồng phân


O

HN=C=O
(I)

HO C N
(II)

HO N

(III)

C

H C N O
(IV)

H

C

N

(V)

ở A, dCN = 121 pm, trung gian giữa liên kết C = N (130 pm) và C N (116
pm);
dCO = 117 pm, trung gian giữa liên kết C=O (123 pm) và C O (112 pm).
Vậy công thức (I) là phù hợp hơn cả (cacbon ở trạng thái lai hoá sp), công thức
(IV) và (V) không phù hợp với giá trị pKa.
b. Giá trị Ka = 1,2. 10-4, lớn hơn cả axit axetic, chứng tỏ phân li theo kiểu
axit oxi (-O-H) chứ không chỉ kiểu axit nitơ (-N -H) do có cân bằng hỗ biến
và cộng hởng cấu tạo


H

N

H+

C

O

N C

O

N

N

C

O H

C

O

H+

c.
HN

* n HN=C=O

C
O

tan.

n

(X): đó là polime kiểu poliamit nên khó

Độ dài liên kết CN (140 pm) là trung gian giữa liên kết đôi (130 pm) và liên
kết đơn (147 pm).
O
3H N

C

O

C
HN

NH
C
O

C=O

HO

C
N

NH
(Y ,)

N
C

OH

C

3N

N

C

OH

(Y)

OH

tạo ra từ dung dịch đặc nên kết tủa thành chất rắn Y. Độ dài liên kết CN
(135 pm) lớn hơn CN cô lập (không thơm, 130 pm) nh vậy Y phù hợp hơn Y`.
2. Có 4 đồng phân

R, S

cis, trans

Quang hoạt
Câu 2.
Axit lysergic đợc tìm thấy trong một số loài nấm. Ngời ta có thể tổng
hợp toàn phần axit ( ) lysergic theo ba giai đoạn lớn sau đây:
Giai đoạn 1:
Hexandial

2

cacbetoxixiclopentanon

( A)

COOC2H5
O

C6H5N=N

(B)

COOH
NH ( D )

(C)

Hãy viết sơ đồ phản ứng thực hiện các chuyển hoá A B và B C.
Giai đoạn 2

D

H2/Ni
1 :1

E

-

C6H5COCl/OH

F

SOCl2

G

AlCl3

H

Br2/CH3COOH

a. Hãy viết công thức cấu tạo của E, F, G, H và J.
b. Trình bày cơ chế của phản ứng G H.
Giai đoạn 3
(CH3)2CO

Br2/CH3COOH
1:1

K

HOCH2CH2OH
H+

L

CH3NH2

M

J


H

HOOC

N

M

J

H2O/

N

H

H+

HO-

P

natri arsenat
W Ni / _
H2

Q

H

CH3

N

axit () lysergic
a. Hãy viết công thức cấu tạo của K, L, M, N, P và Q.
b. Giải thích tại sao phải chuyển K thành L và nêu bản chất của phản ứng P
Q.
c. Viết công thức cấu tạo của W và nêu cách tổng hợp W từ Q.
Đáp án
1. A B
CHO
COOH
oxi hoá

anđol hoá

A

este hoá

OH

B

O

B C
C6H5NH2

+

NaNO2

+

O 0C

HCl

+

C6H5N2 Cl

COOC2H5
C6H5N2+Cl -

B

C

OH

2.
a.
COOH
E

COOH

F

NH

N
O

COCl
G

COC6H5

Br
J

H

N
COC6H5

O

C6H5CO

C6H5CO

N

N

b. Cơ chế phản ứng G H là SE 2Ar
+

CO

N

O

O
Cl

_ Cl _

COC6H5

H
_

+

H+
N

N
OC

COC6H5

C6H5

3.
a.
K

CH3COCH2Br

L

CH3 C CH2Br
O
O

M

CH3 C CH2NHCH3
O
O


O

O

CH3

N CH2 C CH3

N CH2 C CH3
O
O

N

O

CH3
O

P

N

Q

CH3

N

N

OC C6H5

OC C6H5

HN

b. Chuyển K thành L để bảo vệ nhóm chức C=O
Bản chất của phản ứng P Q là ngng tụ croton nội phân tử (đóng vòng) và
thuỷ phân amit.
c.
COOH

N

CH3

W
HN

Chuyển hoá Q W có thể làm nhiều cách, miễn sao hợp lí. Thí dụ : khử
CO ancol dẫn xuất halogen cơ magie cacbonyl hoá bằng CO2
thuỷ phân.
Câu 3: Cho 2-cabetoxixiclopentanon phản ứng với 1,3-đibrompropan khi
có mặt NaH trong DMF. Sản phẩm A nhận đợc đợc đun nóng với một đơng
lợng NaH trong hỗn hợp benzen - DMF cho phép thu đợc dẫn xuất bixiclic B,
C11H16O3.
B chịu tác dụng của etanđithiol khi có mặt BF3 và Ni Raney trong
metanol để hình thành sản phẩm C. Xà phòng hoá C bằng NaOH, sau đó
thuỷ phân rồi xử lí với thionyl clorua và cuối cùng bằng NaN 3 trong axeton.
Đun hồi lu hỗn hợp trên khi có mặt vết axit H + sẽ thu đợc D, C8H15N. Bằng tác
dụng của fomanđehit trong axit fomic ở 100 0C, D chuyển thành E. Sau khi
xử lí E bằng metyl iođua, sau đó bằng Ag 2O trong nớc, đun sản phẩm thu
đợc ở 2000C khi có mặt 1,3-điphenylisobenzofuran ngời ta sẽ nhận đợc hai
đồng phân C28H26O là (I) và (II) với hiệu suất thấp.
1. Hãy xác định công thức cấu trúc của các hợp chất trên.
2. Trình bày cơ chế của quá trình A B và D E.
3. Hãy đa ra cách tổng hợp 2-cacbetoxixiclopentanon bằng phơng pháp
ngắn nhất và khác với cách đã dùng ở câu 3.
Đáp án
1.
O

O
COOEt

(CH2)3Br

1. NaH
2. Br(CH2)3Br

O
HS

NaH

BF3

COOEt
A

SH

COOEt
B

S

S
COOEt


1. NaOH
2. H3O+
COOEt

Ni Raney
CH3OH

SOCl2

COCl

COOH

1. NaN3
2. H3O+

NH2
D

C

Ph
O
2000C

1. CH3I
.
N(CH3)2 2 Ag2O

HCHO
HCOOH

+

N(CH3)3
OHO

Ph
Ph

Ph

I

O

Ph

Ph

II

2. Cơ chế
Từ A tạo thành B
Br
O

OBr

NaH

B

COOEt

COOEt

A

Từ D tạo thành E
RNH2

HCHO

H+

RNHCH2OH H O
- 2

RN =CH2

H C O H
O

RNH CH3

+ CO2

3.
O

O

OEt

CH3ONa

OEt

-

COOEt

-O

OEt
COOEt

O
COOEt

COOEt

Câu 4:
1. Cho 8-metylnona-5,8-đienal tác dụng với xiclohexan-1,3-đion (theo tỉ lệ
mol 1 : 1) trong môi trờng kiềm đợc chất A, C16H22O2. Đun nóng A thu đợc
hỗn hợp B gồm các chất là đồng phân của nhau có công thức phân tử
C16H22O2.
a. Viết công thức cấu tạo của A và các chất trong B.
b. Chỉ rõ các trung tâm bất đối trong phân tử các chất trên
2. Từ metyl xiclopropyl xeton và hợp chất cơ magie tuỳ ý chọn, viết sơ đồ
phản ứng điều chế 2,6-đimetyl-9-bromnona-2,6-đien.
3. Thực hiện dãy chuyển hoá sau:
OH

1 . NaOH
2 . CH3COCl
AlCl3

A

+

B

(A có liên kết hiđro nội phân tử).


Cl
BF3

B

OH , HC

C

C C(CH3)2

DMF

OH

H2
Pd Lindla

D

E

200 0C

F

§¸p ¸n
1.
O
Hçn hî p B1, B2, B3, B4
A

O

O
O

*

*
*

O

O

O

O

*
*
*

O

O

O

O
*
*
O

O

O

O
*
*

O

O

2.
O
C

.
2.
CH3

.
. 3
3. CH3MgBr
1 Mg
2 H O+

3.

1 CH3MgBr

H2O

OH
C CH
3
CH3

OH
C

CH2CH2CH=C
CH3

+ HBr
- H2O

Br CH2CH2CH=C

CH3 HBr
CH3

CH3
CH3

Br CH2CH2CH=C CH2CH2CH=C
CH3

CH3
CH3


H- - - O

OH

C

O

OH

CH3
+

COCH3 B

A

O-

OH
HO

OH

+O

COCH3

NaOH

H

CH3
O-

Cl
Me2C C

COCH3

COCH3

- BF
3

O

CH3
OH

O C CH=CH2

CH

2000 C

COCH3
D

COCH3

COCH3

F

E

COCH3

Câu 5
Anlylmagie bromua (A) phản ứng với acrolein tạo thành chất B, sau khi
thuỷ phân B sẽ đợc sản phẩm C duy nhất. Đun nóng C nhận đợc chất D. Cho
D phản ứng
với C6H5Li thu đợc sản phẩm E. Đun nóng E khi có vết iot thì đợc F có công
thức C12H14.
1. Hoàn thành sơ đồ dãy phản ứng trên (viết công thức cấu trúc của các
chất hữu cơ từ C đến F).
2. Ghi kí hiệu cơ chế các giai đoạn của phản ứng dới các mũi tên trong sơ
đồ, trừ giai đoạn tạo thành F.
3. Cho biết cấu hình của F.
Hớng dẫn giải:

+
CH2=CH-CH2-MgBr

AN
cộng 1, 4


+
CH2 =CH-CH =O
thuỷ phâ
n

CH2=CH-CH2-CH2-CH=CH2-OMgBr

H3O+

B

CH2=CH-CH2-CH2-CH=CH-OH

tautome hoá

CH2=CH-CH2-CH2-CH2-CH=O
D

C

Hoặc
CH2=CH-CH2-MgBr
AN
H2O
+
CH2=CH-CH2-CH-CH=CH2
CH2=CH-CH2-CH-CH=CH2
cộng 1, 2
-MgBr(OH)
CH2=CH-CH=O
B OMgBr
C
OH
Hỗ biến

o

C

OH

t
Chuyển vị 3, 3

C6H5
H
OLi

OH
H2O

H

xeto-enol

D
C6H5
H
E OH

O

C6H5Li
AN

Vết iot, to
- H2O

F

C6H5

,
F có cấu hình (E) bền hơn. Tuy vậy, phản ứng cũng tạo thành một lợng nhỏ
F có cấu hình (Z).


Câu 6
Khi nhiệt phân các hợp chất (A), (B), (C), (D) ngời ta thu đợc các sản
phẩm khác nhau. Hãy viết công thức và tên sản phẩm; giải thích (dùng mũi
tên cong) vì sao có sự tạo thành các sản phẩm đó.
1. (A) CH3CH2COOCH2CH2CH2CH3
2. (B) CH3[CH2]5CH(OH)CH2CH=CH[CH2]7COOH
3. (C) (CH3)3CCH(CH3)OCSSCH3
4. (D) CH3[CH2]3C(OH)(CH3)CH2CH=CH[CH2]3COOCH(CH3)[CH2]3CH3
Hớng dẫn giải:
to
1. CH3CH2COOCH2CH2CH2CH3
C2H5COOH + CH2=CHCH2CH3
Axit propanoic

But-1-en

Cơ chế vòng trung gian 6 cạnh, tách syn H .
C2H5 C
O

O

to

CH2

H

CH

C2H5COOH +CH2=CHCH2CH3

C2H5

to

2. CH3[CH2]5CH(OH)CH2CH=CH[CH2]7COOH

CH3[CH2]5CHO

+

CH2=CH[CH2]8COOH
Heptanal

Axit

unđex-10-enoic

Cơ chế vòng trung gian 6 cạnh, tách H-OH.
CH 3 CH2 5 HC

CH2

O

H

CH

to

CH

CH3 CH2 5CH=O + CH2=CH CH2 8COOH

CH2 7COOH

to

3. (CH3)3CCH(CH3)OCSSCH3
CH3SH

(CH3)3CCH=CH2
3,3-Đimetylbut-1-en

+

OCS

+

Cacbonsunfuaoxit

Metanthiol

Cơ chế vòng trung gian 6 cạnh, tách H
H2C
(CH3)3C HC

H

S CH2

to

C=S

O

(CH3)3CCH=CH2 + OCS +CH3SH
to

4. CH3[CH2]3C(OH)(CH3)CH2CH=CH[CH2]3COOCH(CH3)[CH2]3CH3
O
CH3[CH2]3C
+

Hexan-2-on

+

CH2=CH[CH2]4COOH

Axit hept-6-enoic

+

CH3CH=CH[CH2]2CH3

Hex-2-en

CH3
+ CH2=CH[CH2]3CH3
Hex-1-en
Cơ chế 2 vòng trung gian 6 cạnh, tách H -OH và H-C3 hoặc H-C1.


CH2 CH
O
H
CH3 CH2 3 C
CH CH2 3 C
H
H3C O
O
CH CH2 2CH3
CH
o
t
CH3
CH2=CH
CH3 CH2 3C=O +
CH2 4COOH + CH=CH CH2 2CH3 + CH CH2 3CH3
CH3
CH2
CH3
khi tách H-C1

Sản phẩm hex-2-en là chính vì độ bền nhiệt động cao hơn hex-1-en
Cõu 7:
1. Sau khi x lớ hn hp lừi ngụ hoc v tru cú cha pentozan (C 5H8O4)n vi dung dch axit clohiric
12% ri tin hnh chng ct, nhn c cht lng A (C5H4O2) mu vng cú mựi thm. Cho A phn ng
vi KOH ri axit húa thỡ nhn c B (C5H4O3) v C (C5H6O2).
a. Vit phng trỡnh phn ng thu phõn pentozan to thnh A
v cụng thc ca A, B, C.
b. Vit phng trỡnh phn ng ca B tỏc dng vi C khi cú
O O NH
H2N-N
xỳc tỏc axit.
NH
S
c. Hóy trỡnh by iu kin nitro hoỏ A nhn c D
S
(C5H3NO4).
(II)
(I) O
d. Vit phng trỡnh phn ng ca D tỏc dng vi: (I) ; (II).
.
2. Geniposit
(hỡnh bờn) l mt hp cht c tỏch ra t qu dnh
COOCH3
dnh. Thu phõn geniposit sinh ra hai sn phm l genipin v
D-glucoz. Genipin tham gia phn ng to mu vi gelatin (õy l
O
HOH
C
2
c s phỏt hin du võn tay trong k thut hỡnh s).
O
HO
Hóy vit s phn ng to genipin v phn ng ca genipin vi
O
mt aminoaxit gii thớch hin tng trờn
HO
CH2OH
OH

Hng dn chm :
1. Trong lừi ngụ v v tru cú cha pentozan,khi un núng vi dung dch HCl 12% chuyn
thnh pentoz ri tỏch nc cho fufurol
(C5H8O4)n HCl 12%

CHO
- 3H2O
(CHOH)3
CH2OH

2
O A

O

CHO

KOH

O C
COOK

H3O+

O

CHO
A(C5H4O2)

CH2OH

COOK

O

COOH
B

O

b.
COOH +

O

CH2OH

O

H+

O

COOCH2

c. nitro hoỏ A cn phi bo v nhúm anehit bng (CH3CO)2O

O

CHO

(CH3CO)2O

O

CH(OCOCH3)2

O


Thực hiện phản ứng nitro hoá, sau đó thuỷ phân để phục hồi nhóm -CHO
CH(OCOCH3)2

O

HNO3

O2N

O

CH(OCOCH3)2

H3O+

O2 N

O

CHO
D

d.

Phản

ứng của D với I và II
O2N
D

O

CHO

I
O

O2N

O

O

H2N N
O

O2N

NH

O

O

NH

CHO

O2N

S

II S

CH

O

O

N N

CH

O
NH

NH

S

S

2. Phản ứng thuỷ phân geniposit thu được genipin và D-glucozơ
COOCH3
COOCH3

OH

O
HOH2C

O

O
HO

HOH2C

O

O

HO

+

OH

HO

OH

OH

CH2OH

HO
OH

Gelatin (có trong da) cấu tạo từ các polipeptit, lấy đại diện là một aminoaxit như glyxin, ta có
phương trình:
COOCH3
+

O
HOH2C

COOCH3
H2N-CH2-COOH

N-CH2-COOH
HOH2C

OH

OH

sản phẩm có màu để phát hiện dấu vân tay trong kỹ thuật hình sự.
Câu 8:
1. Người ta phân lập được một tetrapeptit (peptit A) từ prothrombin người. Cấu tạo của peptit A
được tiến hành xác định như sau:
a. Bằng phương pháp Edman thì nhận được trình tự aminoaxit của peptit A là Leu-Glu-Glu-Val.
b. Để tiếp tục xác định cấu tạo, người ta tiến hành điện di trên giấy ở pH 6,5 peptit A và một
peptit tổng hợp B (cũng có trình tự aminoaxit là Leu-Glu-Glu-Val) thì lại nhận được quãng
đường di chuyển không giống nhau, cụ thể như hình dưới đây:
Peptit A

2,5

Peptit B

1,7

0

1

2
o

3

đơn vị độ dài

c. Khi thuỷ phân hai peptit A và B bằng HCl 6N ở 110 C, thì cả A và B đều cho Leu(1), Glu(2), Val(1);
nhưng khi thuỷ phân bằng kiềm thì peptit B cho Leu(1), Glu(2), Val(1) còn peptit A cho Leu(1), X(2),
Val(1).
Hãy giải thích các kết quả thực nghiệm để xác định cấu tạo của X và gọi tên X theo danh
pháp IUPAC.


Hướng dẫn chấm :
1.Xác định cấu trúc của X
- Phương pháp Edman thực hiện ở pH thấp,biết được trình tự là Leu-Glu-Glu-Val.
- Điện di ở pH 6,5 cho thấy peptit A dịch chuyển nhanh hơn về phía cực dương(+), chứng tỏ A
có điện tích âm lớn hơn B,tính axit của A lớn hơn B.
- Khi thuỷ phân trong môi trường HCl 6N ở 110 oC thì cả A và B đều thu được Leu(1), Glu(2) và
Val(1). Kết hợp với phương pháp Edman ở trên cho thấy các quá trình này thực hiện ở môi
trường axit mạnh,pH thấp.Ở pH thấp phân tử X bị đecacboxyl hoá,loại CO 2 mất đi 1 nhóm –
COOH.
- Khi thuỷ phân bằng kiềm peptit A tạo ra Leu(1),X(2) và Val(1),trong môi trường kiềm không
có quá trình decacboxyl hoá nên nhận được X(2).
- Kêt hợp các kết quả trhí nghiệm cho thấy X có thêm 1 nhóm –COOH so với Glu tức là khi loại
1 nhóm –COO thì X chuyển thành Glu.
X

HOOC CH2 CH2 CH COOH
NH2
HOOC CH CH2 CH COOH
NH2
COOH

CO2

VËy X :

Gọi tên:

Axit 3-aminopropan-1,1,3-tricacboxylic

Câu 9:
1.a. Hoàn thành dãy phản ứng sau:
HO

OH
CH3COOH
ZnCl2 khan

A

Me2SO4 (1:1)
Na2CO3 - axeton

B

PhCHO
Piperidin

C

t

o

D

O

E (C16H12O4)

b. Viết

sơ đồ điều chế 4,4-đimetylxiclopentan-1,2-điol từ axeton và đietyl malonat.
2. Hợp chất A1 là dẫn xuất của eugenol có khả năng kích thích sinh trưởng thực vật. Từ eugenol
có thể tổng hợp A1 theo hai cách sau:
OH
OCH3

a.

NaOH/EtOH
140OC - 180OC

A

1. ClCH2COONa, 90OC
2. HCl

A1

CH2-CH=CH2
OH

b.

OCH3

1. NaOH
2. ClCH2COONa,

90OC

O
B 1. NaOH/EtOH, 100 C

2. HCl

A1

CH2-CH=CH2

Hãy giải thích và so sánh khả năng phản ứng của hai cách tổng hợp trên.
3. Các dẫn xuất chứa nitơ của A1 có hoạt tính kháng khuẩn và kháng nấm rất tốt. Xử lí A1 với
CH3OH/H2SO4 thu được A2, cho A2 phản ứng với hiđrazin hiđrat thì được A3. Sản phẩm A4 là
do A3 phản ứng với benzanđehit khi có mặt piperiđin. Hãy viết sơ đồ phản ứng, công thức cấu
tạo của A2, A3, A4 và gọi tên A1.
Hướng dẫn giải:


1.a.

OH

OH

OH
COCH3

CH3COOH
ZnCl2 khan

HO

COCH3

Me2SO4 (1:1)
Na2CO3 - axeton

HO

CH3O

A
OH

CH3O

COCH=CHPh
t

B

CH3O

Ph

O

O

Ph

O

o

OH

CH3O
C

O

O

D

E

b.
O

PhCHO
Piperidin

CH2(COOEt)2

COOEt

R2NH, H+

COOEt

CH2(COOEt)2

COOEt 1.
H3O+

EtOOC

RO-

EtOOC

2. -CO2
+
3. H / EtOH

COOEt

NaBH4

Na
Xilen

EtOOC

COOEt

O

OH

HO

OH

2.
ONa

OH
OCH3

a.

OCH3

NaOH/EtOH
140OC -

180OC

OCH3

1. ClCH2COONa , 90OC
2. HCl

A CH=CH-CH3

CH2- CH=CH2

A1 CH=CH-CH3
OCH2COOH

OCH2COONa

OH

b.

OCH2COOH

OCH3

OCH3

1. NaOH
2. ClCH2COONa, 90OC

CH2- CH=CH2

OCH3

1. NaOH/EtOH, 100O C
2. HCl

B CH2- CH=CH2

A1 CH=CH-CH3

Phản ứng tạo thành A là phản ứng đồng phân hoá eugenol thành isoeugenol trong môi trường kiềm rượu
theo cơ chế tạo cacbanion. Ở đây ArOH chuyển thành ArO - , sự liên hợp của O - với nhân thơm làm
giảm độ bền của cacbanion.
Trong quá trình b. O- của ion ArOCH2COO- không liên hợp với nhân thơm nên cacbanion bền hơn làm
cho phản ứng đồng phân hoá dễ dàng hơn. Do đó việc thực hiện theo quá trình b. thuận lợi hơn, ở mhiệt
độ thấp hơn và cho hiệu suất cao hơn.

3.
OCH2COOH
OCH3 CH OH/H SO
3
2
4

OCH2COOCH3
OCH3

N2H4.H2O

OCH2CONHNH2
OCH3 PhCHO

OCH2CONHN=CHPh
OCH3

piperidin

CH=CH-CH3

CH=CH-CH3
A2

CH=CH-CH3
A3

CH=CH-CH3
A4

A1: Axit isoeugenoxiaxetic
Câu 10: Xitral (C10H16O) là một monotecpen-anđehit có trong tinh dầu chanh. Oxi hóa xitral bằng
KMnO4 thu được axit oxalic, axeton và axit levulinic (hay axit 4-oxopentanoic). Từ xitral người ta
điều chế β-ionon để điều chế vitamin A.
a. Xác định cấu tạo và viết tên hệ thống của xitral.


b. Viết sơ đồ các phản ứng chuyển hóa xitral thành β-ionon.
c. β-Ionon sinh ra có lẫn một lượng đáng kể chất đồng phân cấu tạo là α-ionon, không thể tách
ra bằng cách chưng cất.
Trình bầy cơ chế tạo thành α-ionon cùng với β-ionon. Nêu phương pháp tách riêng hai
đồng phân đó.
d. Từ β-ionon, axetilen,O
OCOCH3 và các hoá chất cần thiết, hãy điều chế vitamin A.
O

OH

Vitamin A

β-Ionon

Hướng dẫn giải:
1.
PhCHO

CN-

PhCHO

Ph

Ph

O

OH

Ph

Ph

O

HBr

PhCH2OH

Ph

PCC

O

1.Mg, ete
2.HCOOEt

PhCH2Br

PCC

2.

Ph

Ph
O

Ph

Ph

1. Baz¬

O

Ph

OH

Ph

Ph
OH

Ph

O

Ph

Ph

O

Ph

2
a. Lập luận tìm công thức cấu tạo của xitral
O

3,7-Đimetylocta-2,6-đienal
b.
O

O

CH3COCH3/Ba(OH)2
ng ng tô

O

H2SO4
®ãng vßng

Xitral

β-Ionon

c.
+

O

O

O

H+

+

O

β-Ionon

+

-H+
O

α-Iionon

Để tách riêng 2 đồng phân cấu tạo là β-ionon và α-ionon, nguyên tắc là chuyển chúng thành hỗn
hợp các dẫn xuất ở nhóm C=O rồi kết tinh lại trong dung môi thích hợp, khi ấy 2 dẫn xuất có độ
tan khác nhau sẽ được tách riêng ra. Sau cùng, chuyển 2 dẫn xuất trở lại 2 xeton ban đầu, ví dụ


β -Ionon
α -Ionon

β -Ionon thiosemicacbazon
α -Ionon thiosemicacbazon

H2NNHCSNH2

β -Ionon thiosemicacbazon

H+
thuû ph©
n

β-Ionon

α -Ionon thiosemicacbazon

H+
thuû ph©
n

α -Ionon

d.

β -Ionon thiosemicacbazon
α-Ionon thiosemicacbazon

KÕt tinh l¹i
trong etanol

OH

O

PPh3

1. Li/NH3 (khö C C)
+
2. H (chuyÓn vÞOH)

C C
H

NaC CH

O

Br

1. Ph3P
2. C4H9Li

3. PBr3 (thÕOH)

OCOCH3

OCOCH3

Wittig

NaOH
thuû ph©
n

Vitamin A

Câu 11: Từ tinh dầu bạc hà người ta tách được (-)-menton (trans-2-isopropyl-5-metylxiclohexanon).
Khi chế hóa (-)-menton với axit hoặc kiềm, nó chuyển một phần thành xeton đồng phân (+)-isomenton.
Khi chế hóa (-)-menton với anhiđrit axetic trong dung dịch natri axetat thì thu được hai đồng phân A và
B có công thức phân tử C12H20O2.
a. Vẽ các cấu trúc đồng phân lập thể của (-)-menton.
b. Dùng công thức cấu trúc, hãy giải thích sự tạo thành (+)-isomenton, A và B từ (-)-menton.
3. a.

O

O
I

O

II

O
III

IV

b. (-)-Menton bị enol hóa, C2 có lai hóa sp 3 trở thành lai hóa sp2, khi trở lại xeton C2 có lai hóa sp 3 với
cấu hình S (ở I) hoặc R (ở III):
+

+

-

-

H (OH )

H (OH )

O

O

OH

I

III
I có 2 dạng enol, phản ứng không thuận nghịch với Ac2O tạo ra 2 este đồng phân A và B .
NaAcO

Ac2O

NaAcO

Ac2O

-NaAc

OAc

A

O

O

I

-NaAc

OAc

O

B


Câu 12
Ancol X (C15H26O) có trong tinh dầu patchoulis, có thể được tổng hợp như sau:
1. Hợp chất đimetylxiclohexađien tác dụng với metyl vinyl xeton sinh ra hợp
chất A là sản phẩm chính. Viết tên đầy đủ của đimetylxiclohexađien đã dùng và
sơ đồ phản ứng tạo thành A.
Viết công thức cấu trúc của 3 sản phẩm phụ là đồng phân của A.

A

O

2. Cho A tác dụng với hợp chất cơ kẽm (sinh ra từ etyl bromoetanoat và kẽm trong ete), sau đó thủy
phân sản phẩm trong dung dịch axit loãng thì thu được monoeste B (C 16H26O3). B tác dụng với
(CH3CO)2O sinh ra đieste C. Chất C bị tách CH 3COOH tạo thành monoeste không no liên hợp D
(C16H24O2). Viết công thức cấu trúc của B, C, D và các sản phẩm đồng phân của D có thể sinh ra cùng
với D.
3. Hiđro hóa chọn lọc nối đôi ngoại vòng của D, thu được este E (C 16H26O2). Khử E bằng LiAlH4 cho
ancol F. Cho F tác dụng với (C 6H5)3CCl trong piriđin, tạo thành G (C 33H38O). Hiđro-bo hóa G (dùng
B2H6 tiếp đến H2O2/NaOH), sau đó oxi hóa (CrO 3/piriđin), sinh ra xeton P. Cho P tác dụng với NaH (để
sinh ra cacbanion) sau đó với CH3I thì được sản phẩm Q (C34H40O2). Viết công thức cấu trúc của E, F, G,
P và Q cùng với sơ đồ các phản ứng.
4. Trong môi trường axit, Q chuyển thành R đồng thời giải phóng (C 6H5)3COH. R tác dụng với TsCl
sinh ra sản phẩm S. Chất S phản ứng với KI/axeton tạo thành T (C 15H25IO). T tham gia phản ứng đóng
vòng (nhờ Na/THF) cho ancol X.
Dùng công thức cấu trúc, viết sơ đồ các phản ứng và cho biết X chứa bao nhiêu nguyên tử
cacbon bất đối.
Hướng dẫn giải:
Ancol X (C15H26O) có trong tinh dầu patchoulis, có thể được tổng hợp như sau:
1.

+

1,3-§ imetylxiclohexa-1,3-®ien

O
Metyl vinyl xeton

O

A

Công thức cấu trúc của 3 trong số các sản phẩm phụ là đồng phân của A:

O
O
O
2.
Zn

BrCH2COOEt

A

Ete

BrZnCH2COOEt
Ac2O

1. BrZnCH2COOEt
+

2.H3O

OAc
OH
B

COOEt

-AcOH

(E)

COOEt
C

Các sản phẩm đồng phân của D có thể sinh ra cùng với D là:

D

OEt
O


O

(Z)

(E)

(Z)

O

OEt

EtO

O

OEt
O

OEt

3.

OEt

H2/Pd

D

LiAlH4

Ph3CCl
Piridin

O

E

OH

F

HO
G

O

1. B2H6

CrO3/piridin

2. H2O2/HO-

OCPh3

OCPh3

P
O

O

NaH

P

OCPh3

G

CH3I

OCPh3

Q

OCPh3

4.
Q

H

+

O

TsCl

O

KI/axeton

O

Na/THF

HO

- Ph3COH
OTs

OH

R

I

S

T

Ancol X

Ancol X chứa 5 C*
Câu 13.
1. Phản ứng sau là một thí dụ của quá trình axyl hóa enamin:
PhCO

2

N

COCl

CHCl3

Cl+N

N

Hãy viết cơ chế của phản ứng trên và so sánh với cơ chế phản ứng axyl hóa amoniac (sự giống
nhau và khác nhau giữa hai cơ chế phản ứng).
2. Hãy trình bày cơ chế phản ứng của các chuyển hóa sau:
b)
a)
2
O

O

1. NaNH2
2. H3O

+

O

COOCH3

CH2COOCH3

1.CH3ONa

COOCH3

2. H3O

+

O

LG
1. Cơ chế phản ứng axyl hóa enamin là cộng enamin vào nguyên tử C của nhóm cacbonyl và tách ion clo:


O

N
Cl

N+ Cl
C

Ph

O-

N+

Cl-

O
Ph

Ph

Tiếp theo là chuyển proton đến phân tử enamin khác:
N

N+

N

O

N+
COPh

Ph

Cl-

H

Cơ chế axyl hóa amoniac cũng tuân theo qui luật cộng – tách:
O

O

O-

Cl

Ph

C

Ph
NH3+

Cl

NH3

Ph

H3N+
Cl-

Chuyển proton đến phân tử NH3 thứ hai:
O
Cl-

O
Ph

H2N+
H

H2N

NH3

Ph

+ NH4Cl

Cả hai phản ứng đều thực hiện theo cơ chế cộng tách. Sự khác nhau chủ yếu là liên kết C-C được hình
thành khi axyl hóa enamin, còn liên kết C-N được hình thành khi axyl hóa amoniac.
3. Cơ chế phản ứng của các chuyển hóa:
a) H

O

OH

O

O

O

H

O

CH3ONa

O

-OCH
3

H

CHCOOCH3

COOCH3

C-OCH3

OCH3

O

O-

O

H

COOCH3

COOCH3
H+

COOCH3
O-

O

O-

Câu 14
Để tổng hợp hormon progesteron cần có tiền chất A. Tiền
chất A này được tổng hợp từ hợp chất B. Hợp chất B có thể được
điều chế từ C (etyl 1-metyl-3-oxoxiclohex-1-en-6-cacboxylat)
theo sơ đồ sau:

O

COCH3
HO
(A)

C
L

HOCH2CH2OH

D

TsOH
thñy ph©
n

M

(raxemic)

LiAlH4

O
E

LiAlH4

(B)

O

O
H+

O

+

H3O

O

b)

O

NaNH2

NaNH2

COOC2H5

P (C12H20OS2)

TsCl
piri®
in

Q

F

HCl 10%
THF

NaI
axeton

R

G (C8H10O)

COOCH3

(g)

HSCH2CH2SH
BF3.Et2O

K
P(C6H5)3

S

C6H5Li

T

(t)

U

(u)

B

H3O+

A

Cho: (g) là đimetyl malonat và các hóa chất cần thiết; (t) là (E)-4-metylđec-4-en-8-inal.
1. Viết công thức cấu tạo của các chất từ C đến U và xác định tác nhân và điều kiện chuyển hóa (u).
2. Viết sơ đồ chuyển hóa U thành B và đề xuất cơ chế phản ứng cuối cùng (B thành A, hiệu suất cao).
Trong sơ đồ trên có tạo ra M raxemic. Để chuyển hóa M thành P, người ta sử dụng M có cấu hình R.
Hãy nêu phương pháp (dạng sơ đồ) thu nhận M có cấu hình R từ M raxemic.


LG
1. Công thức cấu tạo của các chất từ C đến U và điều kiện chuyển hóa (u):
HO

O

TsOH

C

O

O

OH

O

O

COOC2H5

O

O

O
COOC2H5

COOC2H5

D

O

O

F

E

CH2OH

G (C8H10O)

COOCH3

(g) H2C(COOCH3)2, CH3

BF3.Et2O

K

L

M

LiAlH4

R

Q

P (C12H20OS2)

H

O

U

S

(raxemic)


a. Điều chế A:
CHO
HO
HO

hoÆ
c:

OH
OH
CH2OH

NaBH4

HOCH2
HO
HO
OH
OH
CH2OH

2 (CH3)2CO
+

H

HO
OH

NaBH4

OH 2 (CH3)2CO

HO

OH
CH2OH

+

H

OH
CH2OH

O

HIO4

O
H
CHO
A

O CH2
O
OH
HO
O
H2C O

HOCH2
HO

CHO

HO

O CH2
O
HO
OH
O
H2C O

O

HIO4

O
H
CHO

Điều chế B
CHO
HO
HO

OH
OH
CH2OH

OH O
MeOH
HCl

C6H5CHO

OH

β-anomer + HO

OMe

HO
Ac2O

H

O

O

OH

OMe

HO

O

O

C6H5

AcONa

+

O

O

C6H5

OAc

OMe

AcO

b. Công thức Fisơ của các hợp chất C và D:
CHO
HO
H
HO
H
OH
H
H
OH
CH2OH

COOH
HO
H
HO
H
HNO3
OH
H
o
t
H
OH
COOH

HO

H
O
HO

HO

H
H

OH
H

OH
OH Ba(OH)2
O

- 2H2O

HO

H

O

O

O

H
H

®ãng vßng lacton

D

C

®ãng vßng lacton

OH

H

O

3. a. So sánh nhiệt độ sôi: Nhiệt độ sôi phụ thuộc vào liên kết hiđro giữa các phân tử.
N-H .......N
H

N

H

Vòng no, liên kết hiđro giữa
nhóm –NH
vòng
no giữa
Vòng
thơm,của
liêndịkết
hiđro
nên rất –NH
yếu. với dị vòng thơm
nhóm
chứa một nguyên tử nitơ yếu hơn
so vớithơm,
Vòng
dị vòng
liên kết
thơm C có 2
nguyên
hiđro bền.
tử N.

H .......N
N
H

A
b. So sánh tính bazơ:
A: Tính bazơ mạnh
nhất vì electron n Nsp3.

N

N-H ..........
N

<

B

B: Tính bazơ không còn vì
electron n đã tham gia liên
hợp vòng thơm.
A > C > B

<

C
C: Tính bazơ trung bình
vì electron n Nsp2


Câu 1:
1. Polipeptit A gồm các aminoaxit theo tỷ lệ Gly, Ala, Val 2, Leu2, Ile, Cys4,
Asp2, Glu4, Ser2, Tyr2. A chứa một cầu đisunfua tạo vòng đođeca. A tác
dụng với pheninyliso thioxianat tạo thành dẫn xuất hiđanton của Glyxin.
Thuỷ phân A dới tác dụng của enzin cacboxi peptiđaza thu đợc axit aspatic
và một polipeptit thuỷ phân không hoàn toàn A thu đợc các oligopeptit
sau:
Cys-Asp; Glu-Cys-Cys; Cys-Cys-Ala; Glu-Leu-Glu; Tyr-Cys; Glu-Glu-Cys;
Glu-Asp-Tyr; Leu-Tyr-Glu; Ser-Leu-Tyr; Ser-Val-Cys; Gly-Ile-Val-Glu-Glu.
Hãy cho biết trình tự các aminoaxit trong A
2. Đối với Ser, Cys, Val ngời ta cho các giá trị pKa nh sau:
HOCH2CH(NH2)COO
H;

pKa
:

HSCH2CH(NH2)COO
H;

Me2CHCH(NH2)COO
H

(Ser)

(Cys)

(Val)

2,21; 9,15

1,96; 8,18; 10,28

2,32; 9,62

a. Dùng công thức cấu tạo viết phơng trình phân ly để giải thích vì sao
pKa(1) và pKa(2) của Ser nhỏ hơn của Val nhng lớn hơn của Cys ?
b. Tính pHI của Cys
c. Hãy dự đoán giá trị pKa (3) của Ser. Vì sao ngời ta không đa giá trị đó
vào bảng số liệu pKa của nó .
3. Từ các hợp chất chứa không quá 2 nguyên tử cacbon, hãy đề nghị sơ đồ
phản ứng tổng hợp: HOCH2CH(NH2)COOH và HSCH2CH(NH2)COOH



Tài liệu bạn tìm kiếm đã sẵn sàng tải về

Tải bản đầy đủ ngay

×