Tải bản đầy đủ

3 de HSG hoa 12 ha noi

SỞ GD&ĐT HÀ NỘI

KỲ THI CHỌN HSG THÀNH PHỐ
LỚP 12 THPT NĂM HỌC 2015 – 2016
Môn thi: Hóa học - Ngày thi: 02/10/2017
Thời gian làm bài: 180 phút

ĐỀ CHÍNH THỨC
(Đề thi có 02 trang)

Câu I (3,0 điểm):
1. Hai nguyên tố X, Y đều thuộc các nhóm A. Nguyên tử của X có phân lớp e lớp ngoài cùng là 3p, nguyên tử
của Y có phân lớp ngoài cùng là 4s. Biết X, Y đều không là khí hiếm; tổng các e ở các phân lớp ngoài cùng của
X và Y là 7
a) Tìm X, Y. Viết cấu hình e, cho biết tính chất kim loại, phi kim, vị trí của X, Y trong bảng tuần hoàn.
b) Hoàn thành sơ đồ sau:
(1)
(2)
(3)
(4)
(5)

(6)
(7)
(8)
Y 
→ Y(OH) 2 
→ YOX 2 
→ YCO3 
→ YX 2 
→ Y(OH) 2 
→ Y(XO3 ) 2 
→ X 2 
→ HBrO3
2. Người nông dân thường dùng vôi bột để cải tạo loại đất nào? Tại sao không nên trộn vôi bột với phân ure để
bón ruộng?
3. Dung dịch axit propionic 0,01M (dung dịch A). Biết Ka = 10-4,89; Kw = 10-14.
a) Tính độ điện li của axit trong A.
b) Tính độ điện li của axit propionic trong hai trường hợp sau:
- TH1: Thêm 40 ml dd axit propionic 0,0475M vào 10 ml dung dịch A.
- TH2: Thêm 40 ml dd axit propionic 6,25.10-3M vào 10 ml dung dịch A.
Câu II (3,0 điểm):
1. Hòa tan hết 0,775 gam đơn chất X màu trắng bằng dd HNO3 thu được 0,125 mol khí NO2 (sp khử duy nhất
của N+5) và dung dịch chứa hai axit. Viết phản ứng theo sơ đồ sau:
+ dd Ba(OH)2
(1)

A

+ H2SO4
(2)

B

+CuSO4
(3)

D

+ 2NaOH
(4)


R

6000C
(5)

G

X
+ Ca
(6)

L

+ H2O
(7)

E

+AgNO3
(8)

Q

2000C
(9)

D

2500C
(10)

M

Biết các chất A, B, D, E, M, G, L, Q, R đều là hợp chất của X và có phân tử khối thỏa mãn:
MA + ML = 449; MB + ME = 100; MG + MM = 444; MD + MQ = 180.
2. Cho 4,68 gam hỗn hợp X gồm Cu và Fe 3O4 vào bình chứa 400 ml dung dịch HCl 0,1M vừa đủ, phản ứng xong
thu được dung dịch Y và còn một phần chất rắn không tan. Thêm tiếp AgNO 3 dư vào bình phản ứng, sau khi các
phản ứng xảy ra hoàn toàn thu được kết tủa Z. Tính khối lượng kết tủa Z.
Câu III (4,0 điểm):
1. a) Clorofom tiếp xúc với không khí ngoài ánh sáng sẽ bị oxi hóa thành photgen (cacbonyl điclorua) rất độc.
Để ngừa độc người ta bảo quản clorofom bằng cách cho thêm một lượng nhỏ ancol etylic để chuyển photgen
thành đietyl cacbonat không độc. Viết pư xảy ra.
b) Đun nóng vài giọt clorofom với lượng dư dung dịch NaOH sau đó nhỏ thêm vài giọt dung dịch KMnO 4 thấy
hỗn hợp xuất hiện màu xanh. Viết phản ứng và giải thích sự xuất hiện màu xanh.
2. a) Tính tỉ lệ các sản phẩm monoclo hóa tại 1000C và monobrom hóa tạo 1270C isobutan. Biết tỉ lệ khả năng
phản ứng tương đối của nguyên tử H trên cacbon bậc nhất, bậc hai và bậc ba trong phản ứng clo hóa lần lượt là
1,0 : 4,3 : 7,0 và trong phản ứng brom hóa là 1 : 82 : 1600.
b) Dựa vào kết quả tính được ở câu (a), cho nhận xét về các yếu tố ảnh hưởng đến hàm lượng các sản phẩm của
phản ứng halogen hóa ankan.
3. Hiđrocacbon A không làm mất màu dung dịch brom. Đốt cháy hoàn toàn 0,02 mol chất A rồi hấp thụ hết sản
phẩm cháy vào dung dịch chứa 0,15 mol Ca(OH)2 thu được chất kết tủa và khối lượng dung dịch trong bình tăng
lên 1,32 gam. Thêm tiếp dung dịch Ca(OH) 2 dư vào dung dịch thu được thấy lượng kết tủa tăng lên, tổng khối
lượng hai lần kết tủa là 20 gam. Chất A không phản ứng với dung dịch KMnO 4/H2SO4 đun nóng, còn khi
monoclo hóa trong điều kiện chiếu sáng thì chỉ tạo một sản phẩm hữu cơ duy nhất. Tìm CTPT, CTCT và tên gọi
của A.
Câu IV (3,0 điểm): 1. Trình bày cách điều chế etyl axetat trong phòng thí nghiệm từ các hóa chất tương ứng.
Nêu hiện trượng của thí nghiệm đã làm.
2. Hoàn thành sơ đồ sau:
+ H 2 O/H +
t0
+ HCN
C2 H5OH 
→ A1 
→(CH 3COO) 2 Ca 
→ A 2 
→ A 3 
→ A 4 
→ A 5 
→ A 6 
→ PMMA
(1)
(2)
(3)
(4)
(5)
(6)
(7)
(8)


3. Hỗn hợp khí X gồm hiđro sunfua và ankan được trộn với nhau theo tỉ lệ thể tích tương ứng là 1 : 4. Đốt cháy
hoàn toàn X trong oxi dư rồi cho sản phẩm cháy hấp thụ hết vào dd Ba(OH) 2 dư tạo ra 17,93 gam kết tủa. Đem
lượng kết tủa trên phản ứng với dd KMnO 4 có mặt HNO3 dư thấy khối lượng kết tủa còn lại là 2,33 gam. Viết pư
và tìm CTPT của ankan.
Câu V (3,0 điểm):
1. Có 4 amin đồng phân X1, X2, X3, X4 có công thức phân tử là C3H9N. Chất X1 và X3 khi chế hóa với natri nitrit
có mặt của axit clohiđric giải phóng khí nitơ và đều cho sản phẩm có CTPT là C 3H8O. Trong cùng điều kiện đó
X4 không có hiện tượng gì. Sản phẩm của X 1 khi tác dụng với NaNO 2/HCl, khi cho tác dụng với CuO ở 300 0C
cho sản phẩm là anđehit.
a) Tìm CTCT của 4 amin trên.
b) Trình bày cách phân biệt 4 amin trên.
2. Đốt cháy hoàn toàn 3,4 gam chất hữu cơ A thuần chức, cho toàn bộ sản phẩm cháy vào bình đựng dung dịch
Ca(OH)2 dư thấy xuất hiện 16,0 gam kết tủa trắng đồng thời khối lượng dung dịch giảm 7,16 gam.
a) Tìm CTPT của A biết tỉ khối hơi của A so với amoniac là 10.
b) Đun nóng 34 gam A trong 500 ml dd NaOH 1M thấy tạo thành hợp chất hữu cơ B. Phần dung dịch còn lại
đem cô cạn thu được 41,6 gam chất rắn trong đó có 1 muối natri của axit hữu cơ đơn chức. Chất B phản ứng với
Cu(OH)2 cho dung dịch xanh lam. Tìm CTCT của A biết phản ứng hoàn toàn.
Câu VI (4,0 điểm):
1. Trong công nghiệp, brom được điều chế từ nước biển theo quy trình như sau: Cho một lượng dung dịch H 2SO4
vào một lượng nước biển, tiếp theo sục khí clo vào dung dịch mới thu được (1), sau đó dùng không khí lôi cuốn
hơi brom vào dung dịch Na2CO3 tới bão hòa brom (2). Cuối cùng cho H2SO4 vào dung dịch đã bão hòa brom (3),
thu hơi brom rồi hóa lỏng.
a) Hãy viết các phương trình hóa học chính xảy ra trong các quá trình (1), (2), (3).
b) Nhận xét về mối quan hệ giữa phản ứng xảy ra ở (2) và (3).
2. Nêu hiện tượng xảy ra và viết phản ứng trong các thí nghiệm sau:
a) Cho từ từ đến dư dung dịch AlCl3 vào dd NaOH, sau đó thêm tiếp từ từ đến dư dung dịch HCl vào bình phản
ứng.
b) Thêm từ từ đến dư dung dịch K2CO3 vào dung dịch Fe(NO3)3.
3. Chất X ở dạng tinh thể màu trắng có các tính chất hóa học sau: Đốt nóng X ở nhiệt độ cao do ngọn lửa màu
vàng. Hòa tan X vào nước được dd A. Cho khí SO 2 đi từ từ qua dung dịch A thấy xuất hiện màu nâu, khi tiếp tục
cho SO2 đi qua thì màu nâu mất đi do thu được dung dịch B. Thêm một ít dung dịch HNO 3 vào dung dịch B sau
đó thêm lượng dư AgNO3 thấy xuất hiện kết tủa màu vàng. Hòa tan X vào nước thêm vào một ít dung dịch
H2SO4 loãng và KI thấy xuất hiện màu nâu và màu nâu mất đi khi thêm dung dịch Na2S2O3 vào.
a) Viết các phương trình phản ứng xảy ra?
b) Để xác định công thức phân tử của X người ta hòa tan 0,1 gam X vào nước, thêm lượng dư KI và vài ml dung
dịch H2SO4 dung dịch có màu nâu, chuẩn độ I2 thoát ra (chất chỉ thị là hồ tinh bột) bằng dung dịch Na 2S2O3 0,1M
mất màu thì tốn hết 37,4ml dung dịch Na2S2O3. Tìm công thức phân tử X?


ĐÁP ÁN ĐỀ HSG HÀ NỘI 2015 - 2016
Câu I:
2
2
6
2
5
X : ...3px (x < 6) Theo gi¶thiÕt
x = 5 X : 1s 2s 2p 3s 3p (Cl)



x
+
y
=
7





y = 2 Y : 1s22s22p63s23p6 4s2 (Ca)
Y : ...4sy (y ≤ 2)



1. Ta có:
b) Các phản ứng xảy ra:
(1)
(2)
(3)
(4)
(5)
Ca 
→ Ca(OH)2 
→ CaCO3 
→ Ca(OH)2
+ H2O
+ Cl → CaOCl2 
+ CO2 + H2O
+ HCl → CaCl 2 
§ pmn
2

(6)

→ Ca(ClO3)2
+ Cl2, t0

(7)

(8)

+ HCl → Cl2 
+ Br + H O→ HBrO3
2

2

2. Vôi bột là Ca(OH)2 ở dạng rắn; vì Ca(OH)2 là bazơ ⇒ dùng vôi bột để cải tạo đất chua chứa axit.
+ Không nên trộn vôi bột với phân ure vì hai chất này tác dụng với nhau làm mất tác dụng của phân:
(NH2)2CO + 2H2O → (NH4)2CO3
(NH4)2CO3 + Ca(OH)2 → CaCO3↓ + 2NH3↑ + 2H2O
3. a) Vì 0,01.Ka >> KW nên bỏ qua cân bằng của nước. Khi đó ta có:

→ C2H5COO− +H+
C2H5COOH ¬



:

0,01

0

0

cb:

0,01-x
x
x
x.x
= 10−4,89
⇒ Ka = 0,01− x
⇒ x = 3,525.10-4 ⇒ Độ điện li α = 3,525%.
10.0,01+ 40.0,0475
= 0,04M
10+ 40
b)  TH1: Nồng độ dung dịch axit mới =
x.x
= 10−4,89
⇒ Ka = 0,04 − x
⇒ x = 7,11.10-4 ⇒ Độ điện li α = 1,7775%.

10.0,01+ 40.0,00625
= 0,007M
10+ 40
 TH2: Nồng độ dung dịch axit mới =
x.x
= 10−4,89
0,007

x
⇒ Ka =
⇒ x = 2,94.10-4 ⇒ Độ điện li α = 4,2%.

 Nhận xét: Dung dịch càng loãng thì độ điện li α càng lớn.
n = 5
0,775
.n = 0,125⇒ X = 6,2n ⇒ 
X = 31 (P) thỏa mãn
Câu II. 1. Bảo toàn e ⇒ X
+ Theo sơ đồ và phân tử khối ta có: A = Ba(H 2PO2)2; B = H3PO2; D = H3PO4; E = PH3; R = Na2HPO3 ; G =
Na4P2O7; L = Ca3P2; Q = H3PO3; M = H4P2O7.
→ Ba(H PO ) (A) + H ↑
(1): 2P + Ba(OH) + 2H O 
2

2

2

2 2

2


(2): Ba(H2PO2)2 + H2SO4 
BaSO4 + 2H3PO2 (B)

(3): H PO (B) + 2CuSO + 2H O 
H PO (D) + 2Cu + 2H SO
3

2

4

2

3

4

2

→ Na HPO (R) + 2H O
(4): H3PO4 (D) + 2NaOH 
2
4
2
6000 C

(5): 2Na2HPO4 (R) 
Na4P2O7 + H2O
t0
→ Ca P (L)
(6): 2P + 3Ca 
3 2

(7): Ca3P2 (L) + 3H2O




3Ca(OH)2 + 2PH3 (E)
→ H PO (Q) + 6HNO + 6Ag
(8): PH3 (E) + 6AgNO3 + 3H2O 
3
3
3
0
200 C
→ 3H PO + PH
(9): 4H PO 
3

3

3

2500 C

4

3

→ HPO +HO
(10): 2H3PO4 
4 2 7
2
2. Phản ứng xảy ra:
Fe3O4 + 8HCl → 2FeCl3 + FeCl2 + 4H2O
2FeCl3 + Cu → 2FeCl2 + CuCl2

4


+ Vì HCl vừa đủ nên chất rắn không tan chỉ có Cu.
+ Dễ dàng thấy: dd Y gồm: FeCl2 = 0,015 mol; CuCl2 = 0,005 mol; chất rắn không tan Cu = 0,05 mol. Cả 3 chất
trên đều phản ứng với dung dịch AgNO3.
 AgCl : 0,04 mol

⇒ Z gồm  Ag : 0,115 mol = 18,16 gam.
as
Câu III. 1. a) 2CHCl + O → 2COCl + 2HCl
3

COCl2 + 2C2H5OH

2

2




(C2H5O)2CO + 2HCl
→ HCOONa + 3NaCl + 2H O
b) CHCl3 + 4NaOH 
2
t0

2HCOONa + 2NaOH + 2KMnO4 
Na2CO3 + K2MnO4 + Na2MnO4 + 2H2O
2−
Màu xanh là màu của MnO 4 (manganat).
t0

2. a) Phản ứng xảy ra:
CH3
CH3

CH3
CH3

CH

CH

CH2X

(A1)

CH3

(A2)

as
CH3

+

X2

CH3

-HX
CH3

CX

9.1
.100% = 56, 25%
+ Ứng với X2 là Cl2 ⇒ %A1 = 9.1 + 7
; %A2 = 43,75%
9.1
.100% = 0,56%
+ Ứng với X2 là Br2 ⇒ %A1 = 9.1 + 1600
; %A2 = 99,44%
b) Các yếu tố ảnh hưởng gồm: Cấu tạo ankan (bậc cacbon) và bản chất halogen.
3. Tổng khối lượng CaCO3 = 20 gam ⇒ CO2 tạo ra = 0,2 mol ⇒ tính được H2O = 0,14 mol
+ Do số mol A = 0,02 mol ⇒ A là C10H14 (π + v = 4)
+ Vì A không làm mất màu nước brom nên A có vòng benzen.
+ Vì A không phản ứng với dung dịch KMnO4/H2SO4 đun nóng nên A có cacbon bậc IV
⇒ A là C6H5-C(CH3)3 = tert-butylbenzen.
Câu IV.
1. Cách điều chế:
-Hóa chất: ancol etylic (dạng cồn) , axit axetic (đặc) , axit sunfuric, dd NaCl.
- Dụng cụ: ống nghiệm, cốc thủy tinh, đèn cồn, giá đỡ, lưới amiăng….
- Cách tiến hành: Cho vài ml ancol etylic, vài ml axit axetic nguyên chất và vài giọt axit sunfuric đặc vào ống
nghiệm. Lắc đều, đồng thời đun cách thủy 5-6 phút trong nồi nước nóng 65 – 70 0C ( hoặc đun nhẹ trên ngọn lửa
đèn cồn, không được đun sôi). Làm lạnh, rồi rót thêm vào ống nghiệm vài ml dung dịch NaCl bão hòa.
H2SO4

→ CH3COOC2H5 + H 2O.
CH3COOH + CH3CH2OH ¬

t0

2. Sơ đồ phản ứng:
t0
+ HCN
C2 H5OH 
→ CH 3COO H 
→(CH 3COO) 2 Ca 
→ CH 3COCH 3 
→(CH 3 ) C(OH) − CN
(1)
(2)
(3)
(4)
+

+ H 2 O/H

→(CH 3 ) C(OH) − C OOH 
→ CH 2 = C(CH 3 ) − COOH 
→ CH 2 = C(CH 3 ) − COOCH 3 
→ PMMA
(5)
(6)
(7)
(8)

3. Ankan là etan [5BaSO3 + 2KMnO4 + 6HNO3 → 5BaSO4 + 2KNO3 + 2Mn(NO3)2 + 3H2O]
Câu V. 1. a) Vì X1, X3 giải phóng N2 nên chúng là amin bậc I; X4 không có hiện tượng ⇒ X4 là amin bậc III.
+ KQ: X1 là CH3-CH2-CH2-NH2; X3 là CH3-CH(NH2)-CH3; X3 là (CH3)3N còn X2 là C2H5-NH-CH3.
b) Cách phân biệt: Cho 4 chất pư với NaNO2/HCl thì
 X4 (bậc III) không hiện tượng do không có phản ứng;
 X2 (bậc II) phản ứng cho kết tủa vàng: C2H5-NH-CH3 + HNO2 → C2H5-(CH3)N-N=O↓ + H2O
 X1, X3 (bậc I) phản ứng cho khí bay ra: C3H7NH2 + HNO2 → C3H7OH + N2↑ + H2O
+ Cho 2 ancol sinh ra pư với CuO, sau đó lấy sp hữu cơ đem tráng gương ⇒ nếu tạo Ag thì đó là sp của X1, còn
sp của X3 không tạo Ag.
M =170
2. a) CO = 0,16 mol; H O = 0,1 mol ⇒ C : H : O = 0,16 : 0,2 : 0,08 → C H O .
2

2

8

10

4


 RCOONa : 0,4 mol

b) Số mol A = 0,2 mol; NaOH = 0,5 mol ⇒ 41,6 gam chất rắn có  NaOH : 0,1 mol
⇒ KQ là (C2H3COO)2C2H4.
+

H
Câu VI. 1. Các phương trình phản ứng: Cl2 + 2NaBr → 2NaCl + Br2
3Br2 + 3Na2CO3 → 5NaBr + NaBrO3 + 3CO2
(2)
5NaBr + NaBrO3 + 3H2SO4 → 3Na2SO4 + 3Br2 + 3H2O
(3)
+ Pư (2) và (3) là các phản ứng thuận và nghịch của cân bằng:

3Br2+ 6OH-

OHH+

(1)

5Br- + BrO3- + 3H2O

2. a) Đầu tiên tạo kết tủa trắng sau đó tan ngay:
AlCl3 + 3NaOH → Al(OH)3↓ + 3NaCl
Al(OH)3 + NaOH → NaAlO2 + 2H2O
+ Khi AlCl3 dư thì có kết tủa trắng tạo thành, không tan nữa:
3NaAlO2 + AlCl3 + 6H2O → 4Al(OH)3↓ + 3NaCl
+ Khi thêm HCl đến dư thì kết tủa lại tan đến hết: Al(OH)3 + 3HCl → AlCl3 + 3H2O
3. a) Phản ứng xảy ra:
 Đốt nóng ở nhiệt độ cao cho màu vàng ⇒ X là hợp chất của natri.
 Cho SO2 qua dd X → màu nâu ⇒ I2 hoặc Br2 tạo thành
 Do tạo kết tủa vàng với AgNO3 (AgI↓) ⇒ X : NaIOx
 Phản ứng xảy ra:
(2x-1)SO2 + 2NaIOx+ (2x-2) H2O → I2 + Na2SO4 +(2x-2) H2SO4
SO2 + I2 + H2O → 2HI+ H2SO4
NaIOx + (2x-1)KI + xH2SO4 → xI2 + xH2O + Na2SO4 + K2SO4
I2 + 2Na2S2O3 → 2NaI + Na2S4O6
b) Theo các phản ứng và giả thiết ta có:
1
0,0374.0,1
nI = nNa S O =
= 0,00187mol
2
2
2

2 2 3

+ Mặt khác:

nI 2 = x.nNaIOx ⇒

0,1x
= 0,00187
150+ 16x
⇒ x = 4⇒ X : NaIO4


SỞ GD&ĐT HÀ NỘI
ĐỀ CHÍNH THỨC
(Đề thi có 02 trang)

KỲ THI CHỌN HSG THÀNH PHỐ
LỚP 12 THPT NĂM HỌC 2016 – 2017
Môn thi: Hóa học - Ngày thi: 14/09/2016
Thời gian làm bài: 180 phút

Câu I(3,0 điểm): 1. Phân tử A có công thức X4YnZm (với n + m = 5). Tổng số hạt mang điện trong một phân tử A
là 84. Trong phân tử A, nguyên tố X có số hiệu nguyên tử nhỏ nhất, X là phi kim; nguyên tố Z liền sau nguyên tố
Y trong 1 chu kì.
a) Xác định X, Y, Z, A?
b) Cho biết ứng dụng của A trong thực tiễn. Viết pư điều chế A từ hai muối tương ứng?
2. Phản ứng thuận nghịch ở pha khí: 2SO2 + O2  2SO3 được thực hiện trong bình A thể tích 3,0 lít.
a) Cho vào bình A một hh gồm 0,2 mol SO3 và 0,15 mol SO2. Khi cân bằng được thiết lập ở 250C và áp suất
chung của hệ là 3,2 atm. Tính %V của oxi trong hh ở trạng thái cân bằng.
b) Cũng ở 250C, nếu chỉ cho vào bình A một lượng khí SO 3. Ở trạng thái cần bằng thấy có 0,105 mol oxi. Tính
hàm lượng SO3 bị phân hủy, xác định %V mỗi khí ở trạng thái cân bằng và tính áp suất chung của hệ.
3. Khi cắm hoa tươi, để hoa được tươi lâu người ta thêm một sợi dây đồng đã cạo sạch vào trong nước của bình
cắm hoa. Hãy giải thích cách làm trên?
Câu II(3,0 điểm): 1. Đốt cháy 3,36 gam hh gồm 6 hiđrocacbon A, B, D, E, F, G có cùng CTPT (đều là chất khí ở
đkt). Đem toàn bộ sp cháy hấp thụ hết vào bình đựng dd Ba(OH) 2 thu được 39,4 gam kết tủa và thấy khối lượng
dd giảm 24,52 gam. Khi cho từng chất vào dung dịch brom trong CCl 4 thì thấy A, B, D, E tác dụng rất nhanh, F
tác dụng chậm hơn, G hầu như không tác dụng. B và D là những đồng phân hình học. Khi cho A, B hoặc D tác
dụng với H2 (Ni, t0) đều cho cùng một sản phẩm. Biết nhiệt độ sôi của B cao hơn D. Tìm A, B, D, E, F, G.
2. Khi điều chế khí etilen bằng cách đun nóng ở 1700C hỗn hợp etanol và H2SO4 đặc ta được khí X. Cho sản
phẩm khí đi qua dung dịch KMnO 4 thì không thấy có kết tủa MnO 2. Nếu cho etilen nguyên chất vào dung dịch
KMnO4 thì có kết tủa nâu đen của MnO2.
a) Giải thích hiện tượng trên?
b) Để loại bỏ tạp chất trong X ta phải cho X qua dung dịch nào sau đây: KMnO 4; KOH; Br2; Na2CO3; BaCl2.
Giải thích.
Câu III(4,0 điểm):
1. Hoàn thành phản ứng sau và cân bằng theo phương pháp thăng bằng electron:
a) Cu2FeS3 + HNO3 → CuSO4 + Cu(NO3)2 + Fe2(SO4)3 + N2O + …
b) FeCl2 + PbO2 + H2SO4 → ………………
c) MnO(OH)2 + H2O2 + H2SO4 → MnSO4 + ….
d) KMnO4 + Na2SO3 + KOH → …..
e) CuO + …..→ N2 + …..+ …..
2. Hòa tan hoàn toàn hỗn hợp X gồm Mg, Fe, FeCO 3, Cu(NO3)2 vào dd chứa H2SO4 loãng và 0,045 mol NaNO 3,
thu được dd Y chỉ chứa 62,605 gam hỗn hợp muối trung hòa (không chứa Fe 3+) và 6,08 gam hh khí Z (gồm N2,
NO, CO2 và 0,02 mol H2). Cho dung dịch Y pư vừa đủ với 865 ml dung dịch NaOH 1M thu được 31,72 gam kết
tủa. Mặt khác cho BaCl2 vừa đủ vào Y rồi thêm tiếp AgNO 3 dư vào thì tổng kết tủa thu được là 256,04 gam. Tính
%KL các chất trong X?
Câu IV(4,0 điểm):
1. Oxi hóa một ancol X đơn chức bậc I bằng CuO ở nhiệt độ cao thu được hh khí Y gồm anđehit, hơi nước và
ancol dư. Chia Y thành ba phần bằng nhau:
+ Phần 1 cho pư với Na dư được 0,25 mol hiđro.
+ Phần 2 phản ứng với [Ag(NH3)2]OH dư được 64,8 gam Ag
+ Đốt cháy phần 3 thu được 1,5 mol CO2 và 1,5 mol H2O.
Tìm X và hiệu suất oxi hóa ancol X?
2. Hỗn hợp A gồm 3 este đơn chức đều mạch hở tạo thành từ cùng một ancol B với ba axit hữu cơ, trong đó có
hai axit no là đồng đẳng liên tiếp và một axit không no, mạch nhánh và chứa một liên kết đôi. Xà phòng hóa
hoàn toàn m gam A bằng dd NaOH thu được hh muối và p gam ancol B. Cho p gam B vào bình đựng Na dư thu
được 0,1 mol hiđro và khối lượng bình đựng natri tăng 6,2 gam. Mặt khác đốt cháy m gam A thu được 0,6 mol
CO2 và 0,55 mol H2O. Tìm m và CTCT mỗi este.
Câu V(3,0 điểm):
1. Hòa tan hết 28,4 gam hh X gồm K, K 2O, Ba, BaO vào nước thu được 500 ml dd Y chứa 0,15 mol Ba(OH) 2 và
0,1 mol hiđro. Dẫn 0,35 mol CO 2 vào Y thu được m gam kết tủa và dd Z. Tính m và nồng độ mol/l của chất tan
trong Z biết thể tích dd không đổi.


2. Đốt cháy 4,96 gam đơn chức X (là chất rắn màu đỏ) trong clo thu được 29,1 gam hh Y gồm hai chất rắn. Hòa
tan hoàn thoàn Y vào nước thu được dung dịch Y chứa 3 chất tan. Lấy ½ Z pư với 600 ml dd NaOH 1M rồi cô
cạn dd sau pư thu được m gam chất rắn khan. Viết pư và tính m?
Câu VI(3,0 điểm):
1. X và Y là hai axit hữu cơ đơn chức liên tiếp (M X < MY). Trộn X và Y theo tỉ lệ mol 1 : 1 thu được hh A. Ancol
Z no, mạch hở và có số nguyên tử cacbon bằng số cacbon trong Z. Trộn Z vào hh A được hhB. Đốt cháy 0,34
mol B cần vừa đủ 1,42 mol oxi tạo thành 53,312 lít (2730C và 2atm) hh gồm CO2 và hơi nước có tổng khối lượng
là 72,48 gam.
a) Tìm CTCT của X, Y, Z.
b) Tính khối lượng este tạo thành khi đun 0,34 mol hh B với xt H 2SO4 đặc biết hiệu suất pư este hóa là 75%, các
este tạo thành đều thuần chức và có số mol bằng nhau.
2. Tiến hành pư nhiệt nhôm hoàn toàn hh X gồm Al và Fe xOy trong điều kiện không có oxi thu được hh rắn B.
Cho B pư với dd NaOH dư được dd C, phần không tan D và 0,03 mol hiđro. Cho D pư với H 2SO4 đặc nóng thu
được dd E chỉ chứa một muối sắt duy nhất và 2,688 lít SO 2 ở đktc là sản phẩm duy nhất. Cho từ từ HCl vào C
đến khi thu được kết tủa lớn nhất rồi lọc đem nung đến khối lượng không đổi được 5,1 gam chất rắn. Tìm Fe xOy?
ĐÁP ÁN HSG HÀ NỘI 2016 – 2017
42
42
=
= 4,67
Câu I. 1. + Số propton trong A = 84 : 2 = 42 ⇒ số proton trung bình = 4 + n + m 9

X lµ phi kim
→ X là hiđro (H) ⇒ A có dạng: H Y Z
⇒ PX < 4,67 
4 n m
n + m = 5

4 + n.PY + m(PY + 1) = 42
+ Vì Z liền sau Y trong 1 chu kì nên: 
⇒ ta có bảng
Giá trị của n
1
2
3
4
Giá trị của m
4
3
2
1
Giá trị của PY
6,8
7
7,2
7,4
⇒ nghiệm phù hợp là: n = 2; m = 3; PY = 7; PZ = 8 ⇒ A là H4N2O3 hay NH4NO3.
b) Ứng dụng của A: làm phân bón; điều chế khí cười. Điều chế A: AgNO3 + NH4Cl → AgCl↓ + NH4NO3.
3,2.3
= 0,393 mol
2. a) Số mol ban đầu = 0,35 mol; số mol sau phản ứng = 0,082.298

+ Ta thấy số mol khí tăng nên cân bằng chuyển dịch sang chiều thuận.
+ Phản ứng:
2SO2 + O2 
→ 2SO3
b®: 0,15
p : 2x
cb: 0,15+2x

0
x
x

0,2
-2x
0,2-2x

0,043
.100%
⇒ 0,15 + 2x + x + 0,2 – 2x = 0,393 ⇒ x = 0,043 mol ⇒ %VOXI = 0,393
= 10,94%.
2

 0,15+ 2x  x

÷ .3
3


= 0,0614
2
 0,2 − 2x 

3 ÷

+ Tính KC: KC = 
b) Ta có:
2SO2 + O2 
→ 2SO3
b®:

0

p : 0,21
cb: 0,21

0
0,105
0,105

2a
-0,21
2a-0,21


2

 0,21 0,105
 3 ÷. 3


= 0,0614
2
 2a − 0,21

÷
3

⇒ KC = 
⇒ a = 0,184 ⇒ %SO3 bị phân hủy = 57%.
+ Phần trăm mỗi khí: SO2 = 44,4%; O2 = 22,2%; SO3 = 33,4%. Áp suất chung = 3,85 atm.
3. Ion Cu2+ có tác dụng diệt khuẩn, đặc biệt là vi khuẩn gây thối rữa. Khi cho dây đồng vào bình nước cắm hoa
thì sẽ có 1 lượng nhỏ ion Cu 2+ phân tán vào nước làm cho các cuống hoa đỡ bị thối do đó đỡ làm tắc các mao
quản dẫn nước lên ⇒ hoa sẽ tươi lâu hơn.
Câu II. 1. Ta có tổng khối lượng (CO2 + H2O) = 39,4 – 24,52 = 14,88 gam.
CO2 = x mol 44x + 18y = 14,88 x = 0,24 mol
⇒
⇒

H2O = y mol 12x + 2y = 3,36
y =0,24 mol ⇒ tỉ lệ C : H = 0,24 : 0,48 = 1 : 2

+ Đặt
⇒ 6 chất đều có CTPT là (CH2)n.
n =2, 3, 4
+ Do là chất khí nên n ≤ 4 → Do có 6 đồng phân ⇒ chỉ có n = 4 thỏa mãn.
+ Vậy A = but-1-en; B = cis-but-2-en; D = trans-but-2-en; D = isobutilen; F = metyl xiclopropan; G = xiclobutan.
+ Chú ý: qui luật chung
Nhiệt độ sôi
Nhiệt độ nóng chảy
Đồng phân cis
Cao
Thấp
Đồng phân trans
Thấp
Cao
0
2. a) Khi đun nóng ở 170 C hỗn hợp etanol và H2SO4 đặc ta có các phản ứng:
H 2SO4


 Phản ứng chính: C2H5OH 1700 C CH2=CH2 + H2O
 Phản ứng phụ:
t0


C H OH + 2H SO
2C + 2SO + 5H O
2

5

2

4

2

2

t0


C2H5OH + 6H2SO4 
2CO2 + 6SO2 + 9H2O
⇒ Hỗn hợp khí X gồm: C2H4, SO2, CO2.
+ Khi cho X vào dd KMnO4 thì đầu tiên xảy ra pư:
2KMnO4 + 5SO2 + 2H2O → K2SO4 + 2MnSO4 + 2H2SO4
⇒ dung dịch sau phản ứng trên sẽ có môi trường axit ⇒ không tạo ra MnO2.
b) Để loại bỏ CO2, SO2 ta phải cho X đi qua chất hấp thụ được CO 2 và SO2 mà không phản ứng với C2H4 ⇒ ta
phải chọn: KOH ⇒ các phản ứng
+ Ta không chọn KMnO4, Br2, Na2CO3 và BaCl2 vì:
 KMnO4, Br2 hấp thụ cả SO2 và C2H4. Phản ứng:………..
 Na2CO3 có phản ứng:
Câu III. 1. a) 8Cu2FeS3 + 58HNO3 → 12CuSO4 + 4Cu(NO3)2 + 4Fe2(SO4)3 + 25N2O + 29H2O
8 x Cu FeS + 2e → 2Cu +2 + Fe +3 + 3S+6 + 25e
2
3

2N +5 + 8e → 2N +1
b) 2FeCl2 + 3PbO2 + 6H2SO4 → 1Fe2(SO4)3 + 3Cl2 + 3PbSO4 + 6H2O
3x Pb +4 + 2e → Pb +2
25x

FeCl2 → Fe +3 + Cl 2 + 3e
c) 1MnO(OH)2 + 1H2O2 + 1H2SO4 → 1MnSO4 + 3H2O + 1O2
1x Mn +4 + 2e → Mn +2
2x

2O−1 → O02 + 2e
d) 2KMnO4 + 1Na2SO3 + 2KOH → 2K2MnO4 + 1Na2SO4 + H2O
2 x Mn +7 + 1e → Mn +6
1x

1x

S+4 → S+6 + 2e
0

e) 3CuO + 2NH3

t



N2 + 2Cu + 3H2O


3x

Cu +2 + 2e → Cu

2x

N −3 → N 0 + 3e
0,02 mol

67 8
N , NO, CO , H
1 24 4 44 2 42 4 4 423
6,08 gam

 Na : 0,045
 2+
Mg
Fe 2+

 2+
Cu
 NH +
4

2−
SO4
1 44 2 4 43
+

 Mg
 Fe
H SO

+  2 4



FeCO
NaNO
:
0,045
3
3


Cu(NO3 ) 2

62,605 gam
2. Sơ đồ:
+ Số mol SO42- = (0,865 + 0,045):2 = 0,455 mol ⇒ Số mol BaCl2 = 0,455 mol
BaSO4 : 0,455 mol

AgCl : 0,91 mol ⇒ nAg = 0,18 mol
Ag: ? mol
1 4 4 4 2 4 4 43
256,04 gam
⇒ tổng kết tủa =
⇒ số mol Fe2+ = 0,18 mol.
+ Đặt số mol Mg2+ = a mol; Cu2+ = b mol; NH4+ = c mol ta có:
Mg:0,2 mol
 Fe
2a+ 2b + c = 0,505 (BT dien tich) a = 0,2 mol




⇒ b = 0,04 mol
24a+ 64b + 18c = 7,81
 FeCO3
58a+ 90.0,18+ 98b = 31,72
c = 0,025 mol
Cu(NO3)2 : 0,04 mol


⇒ ban đầu có: 
+ Đặt số mol N2 = x mol; NO = y mol và CO2 = z mol ⇒ FeCO3 = z mol ⇒ Fe = (0,18-z) mol
+ Bảo toàn nitơ ⇒ 2x + y = 0,1 (I)
+ Dựa vào khối lượng khí ⇒ 28x + 30y + 44z = 6,04 (II)
+ Bảo toàn e ta có: 2.0,2 + 2(0,18-z) = 10x + 3y + 0,02.2 + 0,025.8 (III)
+ Từ (I, II, III) ⇒ x = 0,015 mol; y = 0,07 mol; z = 0,08 mol.
+ Vậy %KL của Mg = 17,65%; Fe = 20,59%; FeCO3 = 34,12%; Cu(NO3)2 = 27,65%.
Câu IV. 1. Đốt cháy X và Y là như nhau đều tạo ra số mol CO2 = H2O = 1,5 mol ⇒ X có dạng CnH2nO
+ Dựa vào phần 2: Ag = 0,6 mol ⇒ Anđehit = H2O = 0,3 mol.
+ Dựa vào phần 1 ⇒ Ancol trong phần 1 = 0,2 mol ⇒ 1/3 ancol ban đầu = 0,3 + 0,2 = 0,5 mol.
n CO2 1,5
=
=3
0,5
⇒ số cacbon của X = n X
⇒ X là CH =CH-CH -OH (H = 60%)
2

2

2. Dựa vào phản ứng với Na ⇒ ancol B là CH3OH (0,2 mol). Dùng đồng đẳng hóa ta có:
HCOOCH 3 : a mol
a + b = 0, 2
a = 0,15 mol



C3H 5COOCH 3 : b mol ⇒ 2a + 5b + c = 0, 6 ⇒ b = 0, 05 mol
CH : c mol
2a + 4b + c = 0, 55 c = 0, 05 mol


 2
+ Ghép kết quả trên ta có:
HCOOCH3 : 0,15 mol
HCOOCH 3 : 0,10 mol


C3H 5COOCH 3 : 0,05 mol ⇒ CH 3COOCH 3 : 0,05 mol
CH : 0,05 mol
C H COOCH : 0,05 mol
3
 2
 3 5
⇒ m = 14,7 gam.


Câu V. 1. Ta có

K : x mol
39x + 137y + 16z = 28, 4  x = 0,15 mol



⇒  y = 0,15 mol
Ba : y mol ⇒ Ba = y = 0,15
O : z mol
 BT e: x + 2y - 2z = 0, 2
z = 0,125 mol




 K + : 0,15 mol
BaCO 3 : 0,1 mol
 2+
+ CO2
 Ba : 0,15 mol 
0,35 mol → Ba(HCO 3 ) 2 : 0,05 mol

OH − : 0,45 mol
KHCO3 : 0,15 mol

⇒ Dung dịch Y gồm:
⇒ ĐS: m = 19,7 gam; [Ba(HCO3)2] = 0,1M và [KHCO3] = 0,3M.
HCl : 0,68 mol
 PCl3 : 0,06 mol + H2O 
P : 0,16 mol + Cl 2 
→
→ H3 PO3 : 0,06 mol
 PCl5 : 0,10 mol
H PO : 0,10 mol
 3 4
2. Sơ đồ:
+ Khi cho ½ Z pư với 0,3 mol NaOH ta có:
 NaCl : 0,34 mol
HCl : 0,34 mol
 Na HPO : 0,03 mol

 2
3
→
H3 PO3 : 0,03 mol + NaOH: 0,6 mol 
H PO : 0,05 mol
 Na 3PO 4 : 0,05 mol
 3 4
 NaOH: 0,05 mol
⇒ m = 33,87 gam.
Câu VI. 1. Ta có: (CO2 + H2O) = 2,38 mol ⇒ CO2 = 1,14 mol; H2O = 1,24 mol. Vì H2O > CO2.
+ Bảo toàn oxi ⇒ số mol oxi trong B = 2 ⇒ ancol Z có 2 nhóm –OH
X : C3 H x O 2 = a mol
2a + b = 0,34
a = 0,12 mol

⇒
Y : C 4 H x + 2O 2 = a mol ⇒ 
7a + 3b = 1,14 b = 0,1 mol
 Z : C H O = b mol
3 8 2

+ Số cacbon trung bình trong B = 3,35 ⇒
+ Bảo toàn hiđro ta có: 0,12(x + x + 2) + 0,1.8 = 1,24.2 ⇒ x = 6.
X : C3H 6O 2 = 0,12 mol

Y : C 4 H 8O 2 = 0,12 mol
 Z : C H O = 0,1 mol
3 8 2
+ Vậy B gồm: 
X : C3 H 6O 2 = 0,12 mol
(C 2 H 5COO) 2 C3H 6 : d mol


H2SO4
→ (C3H 7COO) 2 C3H 6 : d mol
Y : C 4 H 8O 2 = 0,12 mol 
75%
 Z : C H O = 0,1 mol
C H COO − C H − OOCC H : d mol
3 8 2
3 6
3 7

 2 5
2. Ta có:
+ Ta thấy phải tính este theo ancol ⇒ số mol este = 0,75.0,1 = 0,075 mol ⇒ 3d = 0,075 ⇒ d = 0,025 mol.
+ Vậy KL mỗi 3 este tương ứng = 14,1 gam; 16,2 gam và 15,15 gam.
2. Vì B pư với dd NaOH tạo ra H2 nên trong B có Al dư.
+ Mặt khác: Al2O3 = 5,1 : 102 = 0,05 mol ⇒ Al ban đầu = 0,1 mol.
+ SO2 = 0,12 mol
 Al : 0,1 mol

+ dd NaOH
 Fe : 0, 08 mol → H 2 : 0,03 mol
O: a mol
 TH1: E chứa Fe2(SO4)3 ⇒ Fe = 0,08 mol ⇒ Sơ đồ: 
BT electron

→ 0,1.3 – 2a = 0,03.2 ⇒ a = 0,12 mol ⇒ oxit sắt là Fe O .
2

3

Al : 0,1 mol

+ dd NaOH
Fe : 0,12 mol → H 2 : 0,03 mol
O: a mol


 TH2: E chứa FeSO4 ⇒ Fe = 0,12 mol ⇒ Sơ đồ:
BT electron

→ 0,1.3 – 2a = 0,03.2 ⇒ a = 0,12 mol ⇒ oxit sắt là FeO.
+ Vậy FexOy là FeO hoặc Fe2O3.



SỞ GD&ĐT HÀ NỘI

KỲ THI CHỌN HSG THÀNH PHỐ
LỚP 12 THPT NĂM HỌC 2017 – 2018
Môn thi: Hóa học - Ngày thi: 15/9/2017
Thời gian làm bài: 180 phút

ĐỀ CHÍNH THỨC
(Đề thi có 02 trang)

Câu I(4,0 điểm ):
1. Ở trạng thái cơ bản, nguyên tử nguyên tố X có lớp electron ngoài cùng là lớp L chứa 2e độc thân và không còn
obitan trống. Trong nguyên tử của nguyên tố Y có tổng số electron thuộc các phân lớp p là 11.
a) Viết cấu hình e và xác định vị trí của X, Y trong BTH.
b) Viết công thức hóa học của tất cả các hợp chất tạo bởi ba nguyên tố X, Y và hiđro. So sánh tính axit của hợp
chất này. Giải thích tại sao?
2. a) So sánh khả năng hoạt động của photpho đỏ và photpho trắng. Nêu thí nghiệm chứng minh khả năng bốc
cháy khác nhau trong không khí của photpho đỏ và photpho trắng: mô tả thí nghiệm và giải thích hiện tượng xảy
ra và viết phản ứng?
b) Nguyên tố M phổ biến thức hai trong oxi, chiếm gần 29,5% khối lượng vỏ Trái Đất. Trong tự nhiên, chỉ gặp
M dưới dạng hợp chất. Nguyên tố M còn có trong cơ thể động vật, thực vật với lượng nhỏ và có vai trò đáng kể
trong hoạt động sống của thế giới hữu sinh. M siêu tinh khiết được dùng trong kĩ thuật vô tuyến và điện tử. Cho
biết tên nguyên tố M và viết phản ứng điều chế đơn chất M trong phòng thí nghiệm và trong công nghiệp.
c) Trong số 20 hóa chất được sản xuất nhiều nhất thì: axit sunfuric đứng đầu, etilen đứng thứ 4, propilen đứng
thứ 9, clo xếp thứ 10… Hãy nêu lí do làm cho etilen và proppilen chiếm vị trí cao như vậy, dùng những phản
ứng chứng minh cho ý kiến của mình.
3. Các nguyên tố X, Y đều thuộc nhóm A, đều tạo ra hợp chất với hiđro có dạng RH (R là kí hiệu của X hoặc Y).
Gọi X1, Y1 lần lượt là hiđroxit tương ứng với hoát trị cao nhất của X và Y. Nguyên tố Y chiếm 35,323 khối lượng
trong Y1. Để trung hòa 50 gam dung dịch X1 nồng độ 16,8% cần 150 ml dd Y1 nồng độ 1M.
a) Tìm X, Y?
b) Biết X có cấu trúc mạng tinh thể lập phương tâm khối. Tính mật độ sắp xếp tương đối trong tinh thể X?
Câu II(3,0 điểm ):
1. Khối lượng riêng của nhôm clorua khan (trạng thái hơi, đều ở áp suất khí quyển) đo ở 2000C và 8000C lần lượt
là 6,884 g/dm3 và 1,517 g/dm3.
a) Xác định phân tử khối của nhôm clorua ở các nhiệt độ trên?
b) Viết CTCT của nhôm clorua ở mỗi nhiệt độ trên.
2. Chọn chất phù hợp, viết phản ứng theo sơ đồ sau:
+5

(4)
0

N

(1)

-3

N

+2

(2)

(3)

N

0

(5)

N

N

+4

N

+3

(7)

N

+5

(8)

N

+2

(6)

N

Câu III(4,0 điểm ):
1. Chất hữu cơ X mạch hở có công thức C5H6O4 thỏa mãn các phản ứng sau:


(1): (X) + NaOH 
(A) + (B) + (C);
(2): (A) + H SO 
(A ) + Na SO ;
2

→ Ag + ….;
(3): (A1) + [Ag(NH3)2]OH 
CaO, t 0
(5): (A) + NaOH → (A ) + (A );
2

4

1

2

4

→ C + Ag + ….;
(4): (C) + [Ag(NH3)2]OH 
1
CaO, t 0
(6): (B) + NaOH → (B ) + (A );

3

1







3

(7): (A2) + (C)
(C2);
(8): (C1) + HCl
(C3) + NH4Cl;




(9): (C2) + …
(C3) + …
(10): (B1) + …
(C3)
Biết A1; B1; C; C2; C3 đều là các chất hữu cơ chứa C, H, O và đều đơn chức, mạch hở. Viết các pư xảy ra?
2. Từ propen và các chất vô cần thiết có thể điều chế axit 2,5-đimetyl hexanđioic theo sơ đồ sau:
(1)
(2)
(3)
(4)
(5)
(6)
C H → A → B → C H Br → D → C H O Mg Br → 2,5-đimetyl hexanđioic
3

6

6

12

2

Biết A, B, D là chất hữu cơ khác nhau. Viết phản ứng xảy ra.
3. Viết phản ứng theo sơ đồ:

8

12

4

2

2


+HCHO
(2)

Etyl bromua

+Mg/ete
(1)

A

+CH3COCH3
(4)
+CO2
(6)

X1
Y1
Z1

+H2O
(3)
+H2O
(5)
+H2O
(7)

X2
Y2
Z2

Câu IV(3,0 điểm ):
1. Cho m gam hh X gồm Ba, BaO, Al vào nước dư, sau phản ứng thu được 3,024 lít hiđro (đktc), dd Y và 0,54
gam chất rắn không tan. Cho từ từ 110 ml dung dịch HCl 1M vào phần dung dịch Y thu được 5,46 gam kết tủa.
Viết phản ứng và tính m?
2. Nung hỗn hợp X gồm m gam Al và một oxit sắt ở nhiệt độ cao (không có oxi) đến phản ứng hoàn toàn, thu
được 9,93 gam hỗn hợp Y. Chia Y làm hai phần. Phần 1 tác dụng với dung dịch NaOH dư, thu được 0,4032 lít
hiđro (đktc), phần 2 tác dụng vừa đủ với 306 ml dd HCl 1M thu được 1,8144 lít hiđro. Tìm công thức của oxit
sắt và tính m?
Câu V(4,0 điểm ):
1. Axit polilactic (PLA) là một polime tương hợp sinh học quan trong. Một đặc điểm hấp dẫn của PLA là khả
năng phân rã sinh học. PLA được dùng trong y học để ghép cấy và kiểm soát sự phân bố thuốc trong cơ thể. Có
thể thu được PLA cao phân tử từ axit lactic hoặc đilacton vòng của nó (A).
a) Viết phản ứng tạo thành tetrame của PLA từ axit lactic.
b) Viết phản ứng tạo thành tetrame của PLA từ lactron vòng (A).
2. Hỗn hợp X gồm hai chất A, B là đồng phân của nhau chứa C, H, O; mỗi chất chỉ chứa một nhóm chức, đều có
pư với dung dịch NaOH. Khi cho 25,8 gam hh X pư vừa đủ với 300 ml dd NaOH 1M thu được hh Y.
a) Tìm CTPT của A, B.
b) Chia hh Y thành hai phần bằng nhau. Phần một cho pư hết với lượng dư AgNO 3/NH3 đun nóng thu được 43,2
gam Ag. Phần hai đem cô cạn thu được 13,1 gam hh muối khan. Xác định công thức cấu tạo phù hợp của A, B và
tính khối lượng mỗi chất trong 25,8 gam X.
Câu VI(2,0 điểm ): Hỗn hợp X gòm Fe, Fe 2O3, Fe3O4, Cu, CuO và kim loại M (M có hóa trị không đổi). Trong X
có số nguyên tử oxi gấp hai lần số nguyên tử kim loại M; tổng số các nguyên tử kim loại bằng 11/6 số nguyên tử
oxi. Hòa tan hoàn toàn 23,13 gam X trong dd HNO 3 loãng dư thấy có 0,9 mol HNO3 phản ứng. Sau pư thu được
dd Y chứa 71,01 gam hỗn hợp muối và sinh ra 1,344 lít khí NO duy nhất ở đktc. Tìm M và tính khối lượng mỗi
muối có trong Y.
ĐÁP ÁN HSG HÀ NỘI 2017 – 2018
Câu I. 1. a) + Lớp L là lớp thứ 2, theo giả thiết ⇒ X có cấu hình e là: 1s22s22p4 ⇒ X là oxi (ô số 8, chu kì 2,
nhóm VIA)
+ Y có cấu hình e: 1s22s22p63s23p5 ⇒ Y là clo(ô số 17, chu kì 3, nhóm VIIA).
b) Các hợp chất: HClO; HClO2; HClO3; HClO4. So sánh tính axit: HClO < HClO2 < HClO3 < HClO4.
2. a) Khả năng hoạt động của photpho đỏ kém photpho trắng vì photpho đỏ có cấu trúc polime bền vững còn
photpho trắng có cấu trúc phân tử kém bền.
+ Mô tả thí nghiệm chứng minh photpho đỏ hoạt động kém photpho trắng.
 Cho một mẩu photpho trắng và đỏ lên hai đầu của một thanh sắt.
 Dùng đèn cồn đốt nóng đầu chứa photpho đỏ
+ Hiện tượng: photpho trắng cháy trước photpho đỏ.
+ Giải thích: Mặc dù photpho trắng tiếp xúc với nhiệt độ thấp hơn nhưng lại bị cháy trước là do photpho trắng
hoạt động mạnh hơn photpho đỏ.
b) Nguyên tố M là silic. Phản ứng điều chế
t0

+ Trong phòng thí nghiệm: SiO + 2Mg 
2MgO + Si (không dùng Mg dư vì 2Mg + Si → Mg Si)
2

2

t0


+ Trong công nghiệp: SiO2 + C 
Si + CO
c) Lí do do làm cho etilen và proppilen chiếm vị trí cao là vì từ hai chất trên điều chế nhiều polime quan trọng.
Cụ thể là:
 Polietilen (PE): Polietilen được dùng làm áo đi mưa, khăn trải bàn, túi đựng….


n CH2

CH2

t0, xt, p

CH2 CH2

n

Etilen
Polietilen = PE
 Poli(vinyl clorua) (PVC): PVC được dùng làm ống dẫn nước, vỏ dây điện, da giả (cặp da, giày da, áo da….)
+ Cl

0

500
2
CH 2 = CH 2 
→ CH 2Cl − CH 2Cl 
→ CH 2 = CH − Cl

n CH2

CH

t0, xt, p

Cl

CH2 CH
Cl

n

Vinyl clorua
Poli(vinyl clorua) = PVC
 Polipropilen (PP): PP được sử dụng làm bao bì (bao tải) đựng phân bón, lúa gạo, thức ăn chăn nuôi…

n CH2

CH
CH3

Propilen

t0, xt, p

CH2 CH
CH3 n

Polipropilen

3. + Tìm Y:
Y
= 0,35323
 TH1: Y thuộc nhóm IA ⇒ Y1 là YOH ⇒ Y + 17
⇒ Y = 9,28 ⇒ loại
Y
= 0,35323
 TH2: Y thuộc nhóm VIA ⇒ Y1 là HYO4 ⇒ Y + 65
⇒ Y = 35,5 (clo)
+ Tìm tiếp được X là Kali.
b) Hình vẽ lập phương tâm khối dạng rỗng và đặc:

+ Gọi R là bán kính của nguyên tử kim loại; a là cạnh của hình lập phương.
+ Số quả cầu(số nguyên tử kim loại) trong một lập phương(ô cơ sở) = 1 + 8. 1/8 = 2.
+ Dựa vào hình vẽ ta có: 4R = a 3 (1)
4 3
πR
+ Thể tích 1 nguyên tử = 3
+ Thể tích hình lập phương = a3.
+ Vì một hình lập phương có 2 nguyên tử nên
4
2. πR 3
V2 nguyªn tö
= 33
V
a
Độ đặc khít = %Vkim loại = h ×nh lËp ph ¬ng
(2)
+ Từ (1, 2) ⇒ độ đặc khít ≈ 68%.
Câu II. 1. Chọn thể tích nhôm clorua = 1dm3 = 1 lít; áp suất khí quyển = 1,0 atm.
+ Công thức phân tử của nhôm clorua có dạng (AlCl3)n.
1.1
6,884
= 0, 02578 ⇒ M =
= 267
0
0,
082.(273
+
200)
0,
02578
 Ở 200 C: số mol nhôm clorua =
⇒ (AlCl3)n = 267 ⇒ n = 2 ⇒ nhôm clorua có công thức phân tử là (AlCl3)2 (dạng đime) hay Al2Cl6.
1.1
1,517
= 0, 011365 ⇒ M =
= 133,5
0
0,
082.(273
+
800)
0,
011365
 Ở 800 C: số mol nhôm clorua =


⇒ (AlCl3)n = 133,5 ⇒ n = 1⇒ nhôm clorua có công thức phân tử là AlCl3
b) + CTCT Al2Cl6:
Cl

Cl

Cl

Al

Al
Cl

Cl

Cl

+ CTCT AlCl3:
Cl

Cl
Al

Cl

2. Các pư xảy ra:
xt, t 0


¬ 

(1): N2 + 3H2
2NH3
Pt, 8000 C
→ 4NO + 6H O
(2): 4NH + 5O 
3

2

2


(3): NO + ½ O2 
NO2
→ HNO
(4): 4NO2 + O2 + 2H2O 
3

(5): 5Mg + 12HNO3 
5Mg(NO3)2 + N2 + 6H2O
0
xt, t


¬


(6): N2 + O2
2NO
Lµm l¹nh


¬

(7): NO2 + NO
N2O3 (N2O3 là chất rắn, màu xanh, chỉ bền ở nhiệt độ thấp)

(8): 3N O + H O 
2HNO + 4NO
2

3

2

3

Câu III. 1. Phản ứng xảy ra:
0

t
→ HCOONa (A) + HO-CH -COONa (B) + CH CHO (C);
(1): HCOO-CH2-COO-CH=CH2 + NaOH 
2
3

(2): 2HCOONa (A) + H2SO4 
2HCOOH (A1) + Na2SO4;
t0

→ 2Ag + (NH ) CO + 2NH + H O
(3): HCOOH (A ) + 2[Ag(NH ) ]OH

1

3 2

4 2

3

3

2

t0

→ CH COONH (C ) + 2Ag + 3NH + H O
(4): CH3CHO (C) + 2[Ag(NH3)2]OH 
3
4
1
3
2
CaO, t 0
(5): HCOONa (A) + NaOH → H (A ) + Na CO (A );
2

2

2

3

3

CaO, t 0

(6): HO-CH2-COONa (B) + NaOH → CH3OH (B1) + Na2CO3 (A3);
Ni, t0
→ CH CH OH (C )
(7): H (A ) + CH CHO (C) 
2

2

3

3

2

2

→ CH COOH (C ) + NH Cl;
(8): CH3COONH4 (C1) + HCl 
3
3
4
men giÊm
→ CH COOH (C ) + H O
(9): CH CH OH (C ) + O 
3

2

2

2

3

3

2

xt, t0


(10): CH3OH + CO 
CH3COOH (C3).
+ Cl2
+ HBr
+ Na



2. CH3-CH=CH2 4500 C CH2=CH-CH2-Cl 
CH2=CH-CH2-CH2-CH=CH2 →
+ Mg/ete
+ CO2
CH -CHBr-CH -CH -CHBr-CH → CH -CHMgBr-CH -CH -CHMgBr-CH →
3

2

2

3

3

+ H2O

2

2

3

CH3-CH(COOMgBr)-CH2-CH2-CH(COOMgBr)-CH3 → CH3-CH(COOH)-CH2-CH2-CH(COOH)-CH3
ete
3. (1): C H Br + Mg → C H MgBr
2

5

2

(2): C2H5MgBr + HCHO

5




C2H5CH2OMgBr
→ C H CH OH + Mg(OH)Br
(3): C H CH OMgBr + H O 
2

5

2

2

2

5

2


(4): C2H5MgBr + CH3COCH3 
C2H5C(CH3)2OMgBr



(5): C2H5C(CH3)2OMgBr + H2O 
C2H5C(CH3)2OH + Mg(OH)Br
→ C H COOMgBr
(6): C H MgBr + CO 
2

5

2

2

5

→ C H COOH + Mg(OH)Br.
(7): C2H5COOMgBr + H2O 
2 5
Câu IV. 1. Số mol Al(OH)3 = 0,07 mol. Số mol H+ = 0,11 mol ⇒ AlO2- = 0,08 mol ⇒ Al ban đầu = 0,1 mol; Ba
BT e
→ O = 0,025 mol ⇒ m = 8,58 gam.
= 0,04 mol 

2. Vì phần 1 pư với dd NaOH dư tạo ra H2 ⇒ Y chứa Al dư. Qui đổi X hoặc Y thành: Al, Fe, O.
Al : a mol
0,4032

BT electron
→ 3a − 2c =
.2 = 0,036 (I)
Fe: b mol 
22,4
O : c mol
+ Phần 1: 
Al : ka mol
BT e: 3ka +2kb - 2kc =0,081.2 (II)

Fe: kb mol ⇒ 
BT hidro: 2kc + 0,081.2 = 0,306 (III)
O : kc mol

+ Phần 2:
+ Mặt khác ta có: phần 1 + phần 2 = 9,93 gam ⇒ (k + 1)(27a + 56b + 16c) = 9,93 (IV)
a = 0,044 mol
 b = 0,036 mol


c = 0,048 mol

+ Giải (I, II, III, IV) được nghiệm là  k =1,5
⇒ Oxit sắt là Fe3O4
Câu V. 1. a) Phản ứng tạo PLA từ axit lactic:
xt, t0


4CH -CH(OH)-COOH
HO-CH(CH )-COO-CH(CH )-COO-CH(CH )-COO-CH(CH )-COOH + 3H O
3

3

3

3

3

2

b) Phản ứng tạo PLA từ axit đilacton vòng:
→ HO-CH(CH )-COO-CH(CH )-COO-CH(CH )-COO-CH(CH )-COOH
2CH -CH(COO) CH-CH + H O 
3

2

3

2

3

3

3

3

2. a) vì A, B đơn chức tác dụng với NaOH nên A, B là axit, este hoặc phenol.
 Nếu X phản ứng với NaOH theo tỉ lệ 1 : 1 ⇒ MX = 25,8/0,3 = 86 ⇒ C4H6O2 là công thức phù hợp.
 Nếu X phản ứng với NaOH theo tỉ lệ 1 : 2 ⇒ MX = 28,5/0,15 = 190 ⇒ không có công thức phù hợp.
b) ½ X có số mol = 0,15 mol; số mol Ag = 0,4 mol ⇒ có este HCOO-CH=CH-CH3 (tạo 4Ag).
+ Gọi HCOOCH=CH-CH3 là este 1. Este còn lại là este 2.
 TH1: Cả hai este đều tạo sản phẩm tráng gương. Do tạo hỗn hợp muối khan nên este còn lại là
CH3COOCH=CH2.
HCOOCH=CH-CH3: a mol a+ b = 0,15
a = 0,05 mol
⇒
⇒

4a + 2b = 0,4 b =0,10 mol ⇒ KL muối = 0,05.68 + 0,1.82 = 11,6 gam ⇒
CH3COOCH=CH2: b mol
loại.
 TH2: Este còn lại không tráng gương. Do tạo hỗn hợp muối khan nên este còn lại là C 2H3COOCH3 hoặc este
vòng (CH2)3COO
HCOOCH=CH-CH3: a mol a+ b = 0,15 a = 0,10 mol
⇒
⇒

4a = 0,4
b =0,05 mol
este 2: b mol
⇒ KL muối = 0,1.68 + 0,05.Mmuối = 13,1 ⇒ Mmuối = 126 ⇒ muối là HO-(CH2)3-COONa ⇒ este còn lại là este
vòng (CH3)3COO.
Câu VI: + Gọi x là số mol Oxi, y là số mol NH4NO3 ⇒ HNO3 = 2x + 10y + 0,06.4 = 0,9 (I)
+ KL kim loại = (23,13 – 16x) gam
+ Số mol NO3- tạo muối với kim loại = 0,9 – 2y – 0,06 = (0,84 – 2y) mol
⇒ KL muối = (23,13 – 16x) + 80y + 62(0,84 – 2y) = 71,01 (II)
+ Giải (I, II) được: x = 0,18 mol; y = 0,03 mol.
+ Từ kết quả trên ta có:


11

 Fe : a mol
a+ b + 0,09 = .0,18

6
Cu : b mol


⇒ 56a+ 64b + 0,09.M + 16.0,18 = 23,13

M : 0,09 mol 3a+ 2b + 0,09n − 0,18.2 = 0,03.8+ 0,06.3 (BT e)
O : 0,18 mol


 Với n = 1 ⇒ a = 0,21 mol; b = 0,03 mol; M = 73
 Với n = 2 ⇒ a = 0,12 mol; b = 0,12 mol; M = 65 (Zn)
 Với n = 3 ⇒ a = 0,03 mol; b = 0,21 mol; M = 57
+ Vậy M là Z, muối trong Y gồm: Fe(NO 3)3 = 0,12 mol (29,04 gam); Cu(NO3)2 = 0,12 mol (22,56 gam);
Zn(NO3)2 = 0,09 mol (17,01 gam); NH4NO3 = 0,03 mol (2,4 gam).



Tài liệu bạn tìm kiếm đã sẵn sàng tải về

Tải bản đầy đủ ngay

×