Tải bản đầy đủ

Đề thi thử THPTQG năm 2018 môn hóa học đề số 25 hóa gv tòng văn sinh file word có lời giải chi tiết

Truy cập Tailieugiangday.com hoặc liên hệ hotline: 096.991.2851 để tải bản word
bộ đề thi thử Hóa THPT QG 2018 và 2019 được cập nhật sắp tới.
ĐỀ SỐ 25
Câu 1: Dãy gồm các chất không thể cùng tồn tại trong 1 dung dịch là:
A. H2SO4, Na2CO3, BaCl2, Na2SO4.

B. H2SO4, HCl, NH4Cl, NaNO3.

C. Ba(OH)2, NaNO3, NaAlO2, BaCl2.

D.

NaOH,

NaAlO2,

NaNO3,

Na2CO3.
Câu 2: Sản phẩm của phản ứng nhiệt phân hoàn toàn AgNO3 là
A. Ag, NO2, O2.


B. Ag2O, NO2, O2.

C. Ag2O, NO, O2.

D. Ag, NO, O2.

Câu 3: Khi cho dư khí CO2 vào dung dịch chứa kết tủa canxi cacbonat, thì kết tủa sẽ tan. Tổng các hệ số
tỉ lượng trong phương trình hóa học của phản ứng là:
A. 4.

B. 5.

C. 6.

D. 7

Câu 4: Cho dung dịch các chất: Ca(HCO3)2, NaOH, (NH4)2CO3, KHSO4, BaCl2. Số phản ứng xảy ra khi
trộn dung dịch các chất với nhau từng đôi một là
A. 6.

B. 7.

C. 8.

D. 9.

Câu 5: Các ankan không tham gia loại phản ứng nào?
A. phản ứng thế.

B. phản ứng cộng.

C. phản ứng tách.

D. phản ứng cháy.

Câu 6: Nhóm vinyl có công thức là
A. -CH= CH-.

B. CH2= CH2.



C. CH2= CH-.

D. CH2= CH-CH2-.

Câu 7: Độ bền của liên kết ba, liên kết đôi, liên kết đơn tăng theo thứ tự:
A. ba, đơn, đôi. B. đơn, đôi, bA. C. đôi, đơn, bA. D. ba, đôi, đơn.
Câu 8: Dãy gồm các chất đều phản ứng với phenol là:
A. dung dịch NaCl, dung dịch NaOH, kim loại NA. B. nước brom, axit axetic, dung dịch NaOH.
C. nước brom, anhiđrit axetic, dung dịch NaOH.

D. nước brom, anđehit axetic, dung dịch NaOH.

Câu 9: Hợp chất X có công thức phân tử C4H8O. X tác dụng với dung dịch AgNO3/NH3 sinh ra Ag kết tủA.
Khi X tác dụng với hiđro tạo thành Y. Đun Y với H2SO4 sinh ra anken mạch không nhánh. Tên của X là:
A. butanal.

B. anđehit isobutyriC.

C. 2-metylpropanal.

D. butan-2-on.

Câu 10: Cho este có CTCT CH2=C(CH3)COOCH3. Tên gọi của este đó là
A. metyl metacryliC.

B. metyl acrylat.

C. metyl acryliC.

D. metyl metacrylat.

Câu 11: Khi đun nóng chất béo với dung dịch H2SO4 loãng, thu được:
Page 1


Truy cập Tailieugiangday.com hoặc liên hệ hotline: 096.991.2851 để tải bản word
bộ đề thi thử Hóa THPT QG 2018 và 2019 được cập nhật sắp tới.
A. glixerol và axit béo.

B. glixerol và muối natri của axit béo.

C. glixerol và axit cacboxyliC.

D. glixerol và muối natri của axit cacboxyliC.

Câu 12: Saccarozơ có thể tác dụng với các chất nào sau đây?
A. H2O/H+,to; Cu(OH)2, to thường.

B. Cu(OH)2, to thường; dung dịch AgNO3/NH3.

C. Cu(OH)2 đun nóng; dung dịch AgNO3/NH3.

D. Lên men, Cu(OH)2 đun nóng.

Câu 13: Chất nào sau đây thuộc loại amin bậc I?
A. (CH3)3N.

B. CH3NHCH3. C. CH3NH2.

D. CH3CH2NHCH3.

Câu 14: Cho các chất sau: (1) NH2CH2COOH; (2) NH2CH2CH2COOH; (3) C6H5CH2CH(NH2)COOH;
(4) HOOCCH2CH(NH2)CH2COOH; (5) NH2[CH2]4CH(NH2)COOH. Những chất thuộc loại α-amino
axit là:
A. (1); (3); (4); (5).

B. (1); (2); (3).

C. (1); (3); (5).

D. (1); (2); (3); (4).

Câu 15: Thủy phân hoàn 1 mol hợp chất:
NH2-CH(CH3)-CO-NH-CH2-CO-NH-CH2-CH2-CO-NH-CH(C6H5)-CO-NH-CH(CH3)-COOH thì thu
được nhiều nhất bao nhiêu mol α-amino axit?
A. 2.

B. 3.

C. 4.

D. 5.

Câu 16: Polime nào sau đây có tên gọi “tơ nitron” hay “tơ olon” được dùng dệt may quần áo ấm?
A. Polimetacrylat.

B. Poliacrilonitrin.

C. Poli(vinyl clorua).

D. Poli(phenol-fomanđehit).

+ H2 O
+ H2
+ O2
+Y
 Z 
 Y 
 X 
Câu 17: Trong dãy chuyển hóa: C2H2 
T. Chất T là

A. CH3COOH.

B. CH3COOC2H5.

C. CH3COOC2H3.

D.

C2H5COOCH3.
Câu 18: Thực hiện các thí nghiệm sau: nhúng một thanh Fe vào dung dịch CuCl2; nhúng một thanh Zn
vào dung dịch FeCl3; nhúng một thanh Fe vào dung dịch AgNO3; nhúng một thanh Zn vào dung dịch
HCl có lẫn CuCl2. Số trường hợp xuất hiện ăn mòn điện hóa là:
A. 3.

B. 4.

C. 1.

D. 2.

Câu 19: Dung dịch NaOH có thể tác dụng với tất cả các chất trong dãy:
A. CuSO4, HCl, SO2, Al2O3.
C. BaCl2, HCl, SO2, K.

B. CuSO4, HNO3, SO2, CuO.
D. K2CO3, HNO3, CO2, CuO.

Câu 20: Cho các chất: Ca, Ca(OH)2, CaCO3, CaO. Dựa vào mối liên hệ giữa các chất vô cơ, hãy chọn
dãy biến đổi nào sau đây có thể thực hiện được:
A. Ca 
 CaCO3 
 Ca(OH)2 
 CaO.
B. Ca 
 CaO 
 Ca(OH)2 
 CaCO3.
C. CaCO3 
 Ca(OH)2 
 Ca 
 CaO.

Page 2


Truy cập Tailieugiangday.com hoặc liên hệ hotline: 096.991.2851 để tải bản word
bộ đề thi thử Hóa THPT QG 2018 và 2019 được cập nhật sắp tới.
D. CaCO3 
 Ca 
 CaO 
 Ca(OH)2.
Câu 21: Hiện tượng quan sát được khi cho từ từ dung dịch NaOH vào dung dịch Al2(SO4)3 cho tới dư là
A. xuất hiện kết tủa màu trắng, lượng kết tủa tan ngay.
B. xuất hiện kết tủa màu trắng, lượng kết tủa tăng dần đến cực đại và sau đó kết tủa tan ra cho đến hết,
dung dịch trở nên trong suốt.
C. xuất hiện kết tủa màu trắng, lượng kết tủa tăng dần đến cực đại.
D. xuất hiện kết tủa keo màu trắng, kết tủa tan ra cho đến hết sau đó lại xuất hiện kết tủA.
Câu 22: Từ FeS2 để điều chế sắt người ta nung FeS2 với oxi để thu được Fe2O3 sau đó
A. cho Fe2O3 tác dụng với CO ở nhiệt độ cao.

B. điện phân nóng chảy Fe2O3.

C. cho Fe2O3 tác dụng với dung dịch ZnCl2. D. cho Fe2O3 tác dụng với FeCl2.
Câu 23: Câu nào đúng trong các câu sau?
A. Gang là hợp kim của sắt với cacbon trong đó cacbon chiếm 5-10% khối lượng.
B. Thép là hợp kim của sắt với cacbon trong đó cacbon chiếm 2-5% khối lượng.
C. Nguyên tắc sản xuất gang là khử quặng sắt bằng các chất khử như CO, H2, Al,…
D. Nguyên tắc sản xuất thép là oxi hóa các tạp chất (C, Si, P, S, Mn,…) thành oxit nhằm giảm hàm
lượng của chúng.
Câu 24: Các hợp chất trong dãy chất nào sau đây đều có tính lưỡng tính?
A. Cr(OH)3, Fe(OH)2, Mg(OH)2

.

B. Cr(OH)3, Zn(OH)2, Pb(OH)2.

C. Cr(OH)2, Zn(OH)2, Mg(OH)2

.

D. Cr(OH)3, Pb(OH)2, Mg(OH)2

.

Câu 25: Dung dịch X có chứa: 0,07 mol Na+; 0,02 mol SO42- và x mol OH-. Dung dịch Y có chứa ClO4-,
NO3- và y mol H+; tổng số mol ClO4- và NO3- là 0,04. Trộn X và Y được 100ml dung dịch Z. Dung dịch Z
có pH (bỏ qua sự điện li của H2O) là
A. 2.

B. 13.

C. 1.

D. 12.

Câu 26: Cho 29g hỗn hợp gồm Al, Cu và Ag tác dụng vừa đủ với 950 ml dung dịch HNO3 1,5M thu
được dung dịch chứa m gam muối và 5,6 lít hỗn hợp khí X (đktc) gồm NO và N2O. Tỉ khối của X so với
H2 là 16,4. Giá trị của m là:
A. 91.

B. 97,2.

C. 98,2.

D. 98,75.

Câu 27: Dẫn V lít CO2 (đktc) qua 100ml dung dịch Ca(OH)2 1M thu được 6g kết tủA. Lọc bỏ kết tủa,
lấy dung dịch nước lọc đun nóng lại thu được kết tủa nữA. Giá trị của V là:
A. 1,344.

B. 1,344 hoặc 3,136.

C. 3,136.

D. 1,12 hoặc 3,36.

Câu 28: Đốt cháy V lít (đktc) một ankin ở thể khí thu được CO2 và H2O có tổng khối lượng bằng 50,4g.
Nếu cho sản phẩm cháy qua bình đựng nước vôi trong dư thì thu được 90g kết tủA. V có giá trị là:
A. 6,72.

B. 4,48.

C. 3,36.

D. 13,44.

Page 3


Truy cập Tailieugiangday.com hoặc liên hệ hotline: 096.991.2851 để tải bản word
bộ đề thi thử Hóa THPT QG 2018 và 2019 được cập nhật sắp tới.
Câu 29: Cho 2,9 gam một anđehit phản ứng hoàn toàn với lượng dư AgNO3 trong dung dịch NH3 thu
được 21,6 gam Ag. Công thức cấu tạo thu gọn của anđehit là
A. CH3CHO

.

B. HCHO.

C. CH2=CH-CHO.

D. OHC-CHO.

Câu 30: Cho dung dịch chứa m gam hỗn hợp gồm phenol (C6H5OH) và axit axetic tác dụng vừa đủ với
nước brom, thu được dung dịch X và 33,1 gam kết tủa 2,4,6-tribromphenol. Trung hòa hoàn toàn X cần
vừa đủ 500 ml dung dịch NaOH 1M. Giá trị của m là:
A. 33,4.

B. 21,4.

C. 24,8.

D. 39,4.

Câu 31: Este X có CTPT C2H4O2. Đun nóng 9g X trong dung dịch NaOH vừa đủ đến khi phản ứng xảy
ra hoàn toàn thu được m gam muối. Giá trị của m là
A. 12,3.

B. 8,2.

C. 15.

D. 10,2.

Câu 32: Đốt cháy hoàn toàn 2 amin no, đơn chức, đồng đẳng kế tiếp cần 2,24 lít O2 thu được 1,12 lít
CO2 (đktc). Công thức của 2 amin là
A. C2H5NH2, C3H7NH2.

B. C3H7NH2, C4H9NH2.

C. C4H9NH2, C5H11NH2.

D. CH3NH2, C2H5NH2.

Câu 33: Khi cho 7,5g một amino axit X có 1 nhóm amino trong phân tử tác dụng với dung dịch HCl vừa
đủ thu được 11,15g muối. Công thức phân tử của X là:
A. C2H5NO2.

B. C4H7NO2.

C. C3H7NO2.

D. C2H7NO2.

Câu 34: Để trung hòa 20 ml dung dịch HCl 0,1M cần 20 ml dung dịch NaOH xM. Giá trị của x là
A. 0,4.

B. 0,2.

C. 0,3.

D. 0,1.

Câu 35: Hòa tan hoàn toàn 11,2g một kim loại R vào dung dịch H2SO4 loãng dư. Sau phản ứng thu được
30,4g muối khan. Tên gọi của R là
A. sắt.

B. canxi.

D. kẽm.

C. magie.

Câu 36: Cho m gam hỗn hợp X gồm Na, Ca tan hết vào dung dịch Y chứa 0,08 mol NaHCO3 và 0,04
mol CaCl2, sau phản ứng thu được 7g kết tủa và thấy thoát ra 0,896 lít khí (đktc). Giá trị của m là
A. 1,2.

B. 1,56.

C. 1,66.

D. 1,72.

Câu 37: Hòa tan hết m gam kim loại M cần dùng 136g dung dịch HNO3 31,5%. Sau khi kết thúc phản
ứng thu được dung dịch X và 0,12 mol khí NO duy nhất. Cô cạn dung dịch X thu được (2,5m + 8,49)
gam muối khan. Kim loại M là
A. CA.

B. Mg.

C. Zn.

D. Cu.

Câu 38: Tripeptit M và tetrapeptit Q đều được tạo ra từ một amino axit X mạch hở, phân tử có một
nhóm NH2. Phần trăm khối lượng của N trong X là 18,667%. Thủy phân không hoàn toàn m gam hỗn
hợp M, Q (tỉ lệ mol 1 : 1) trong môi trường axit thu được 0,945 gam M; 4,62 gam đipeptit và 3,75 gam
X. Giá trị của m là:
A. 9,315 gam.

B. 58,725 gam. C.8,389 gam.

D.5,580 gam.

Page 4


Truy cập Tailieugiangday.com hoặc liên hệ hotline: 096.991.2851 để tải bản word
bộ đề thi thử Hóa THPT QG 2018 và 2019 được cập nhật sắp tới.
Câu 39: Hỗn hợp X gồm OHC-C≡C-CHO, HOOC-C≡C-COOH, OHC-C≡C-COOH. Cho m gam X tác
dụngvới dung dịch AgNO3 trong NH3 dư (đun nóng) thu được 43,2g Ag. Mặt khác, m gam X tác dụng
với NaHCO3 dư thu được 11,648 lít CO2 (đktc). Thêm m’ gam glucozơ vào m gam X sau đó đem đốt
cần 60,032 lít O2 (đktc), sản phẩm sinh ra được hấp thụ vào dung dịch Ba(OH)2 dư thu được 614,64g kết
tủA. Giá trị của (m + m’) là
A. 94,28.

B. 88,24.

C. 96,14.

D. 86,42.

Câu 40: Cho 86g hỗn hợp X gồm Fe3O4, FeO, Fe(NO3)2 và Mg tan hết trong 1540 ml dung dịch H2SO4
1M. Sau phản ứng thu được dung dịch Y (chỉ chứa các muối trung hòa) và 0,04 mol N2. Cho KOH dư
vào dung dịch Y rồi đun nóng nhẹ thấy số mol KOH phản ứng tối đa là 3,15 mol và có m gam kết tủa
xuất hiện. Mặt khác, nhúng thanh Al vào Y, sau khi các phản ứng xảy ra hoàn toàn nhấc thanh Al ra cân
lại thấy khối lượng tăng 28g (kim loại Fe sinh ra bám hết vào thanh Al). Biết rằng tổng số mol O có
trong hai oxit ở hỗn hợp X là 1,05 mol. Nếu lấy toàn bộ lượng kết tủa trên nung nóng ngoài không khí
thì thu được tối đa bao nhiêu gam oxit?
A. 82.

B. 88.

C. 81.

D. 84.

Page 5


Truy cập Tailieugiangday.com hoặc liên hệ hotline: 096.991.2851 để tải bản word
bộ đề thi thử Hóa THPT QG 2018 và 2019 được cập nhật sắp tới.

HƯỚNG DẪN GIẢI

Câu 1:
Chọn A vì các chất tác dụng được với nhau.
Câu 2:
t
 2Ag + 2NO2 + O2  Chọn A.
2AgNO3 
o

Câu 3:
 Ca(HCO3)2  Chọn A.
CaCO3↓ + CO2 + H2O 

Câu 4:
Ca(HCO3)2 + 2NaOH 
 CaCO3↓ + Na2CO3 + 2H2O
Ca(HCO3)2 + (NH4)2CO3 
 CaCO3↓ + 2NH4HCO3
Ca(HCO3)2 + 2KHSO4 
 CaSO4 + K2SO4 + 2CO2↑ + 2H2O
2NaOH + (NH4)2CO3 
 Na2CO3 + 2NH3↑ + 2H2O
2NaOH + 2KHSO4 
 Na2SO4 + K2SO4 + 2H2O
(NH4)2CO3 + 2KHSO4 
 K2SO4 + (NH4)2SO4 + CO2↑ + H2O
(NH4)2CO3 + BaCl2 
 BaCO3↓ + 2NH4Cl
KHSO4 + BaCl2 
 BaSO4↓ + KCl + HCl hoặc 2KHSO4 + BaCl2 
 BaSO4↓ + K2SO4 + 2HCl
 Chọn C.

Câu 5:
Ankan tham gia phản ứng thế, phản ứng tách, phản ứng crackinh và phản ứng cháy, không tham gia
phản ứng cộng  Chọn B.

Page 6


Truy cập Tailieugiangday.com hoặc liên hệ hotline: 096.991.2851 để tải bản word
bộ đề thi thử Hóa THPT QG 2018 và 2019 được cập nhật sắp tới.
Câu 6:
Nhóm vinyl C2H3- có CTCT là CH2=CH-  Chọn C.
Câu 7:
Độ bền của liên kết đơn < đôi < ba  Chọn B.
Câu 8:
C6H5OH + 3Br2 
 C6H2Br3OH↓ + 3HBr
 CH3COOC6H5 + CH3COOH
C6H5OH + (CH3CO)2O 

C6H5OH + NaOH 
 C6H5ONa + H2O
 Choïn C.

Câu 9:
X tác dụng với dung dịch AgNO3/NH3 sinh ra Ag kết tủa  X có nhóm –CHO.
Đun Y với H2SO4 sinh ra anken mạch không nhánh  Y là ancol no, đơn chức, mạch hở có mạch
không nhánh.
 CTCT của X phải là CH3-CH2-CH2-CHO  Chọn A.

Câu 10:
Chọn D.
Câu 11:
H

 3RCOOH + C3H5(OH)3  Chọn A.
(RCOO)3C3H5 + 3H2O 

to
+

Câu 12:
Chọn A.
Loại B, C vì saccarozơ không tráng bạC.
Loại D vì saccarozơ không lên men.
Câu 13:
Amin bậc I có dạng RNH2  Chọn C: metylamin.
Câu 14:
(2), (4) là β-amino axit  Chọn C.
Câu 15:
Hợp chất có 4 gốc α-amino axit và 1 gốc β- amino axit  Chọn C.
Câu 16:
Chọn B: (-CH2-CH(CN)-)n.
Câu 17:
+ H2 O
+ H2
+ O2
+ C 2 H5OH
 CH3CHO 
 C2H5OH 
 CH3COOH 
 CH3COOC2H5  Chọn B.
C2H2 

Câu 18:
Page 7


Truy cập Tailieugiangday.com hoặc liên hệ hotline: 096.991.2851 để tải bản word
bộ đề thi thử Hóa THPT QG 2018 và 2019 được cập nhật sắp tới.
Chọn B.
Câu 19:
Loại B, C, D vì CuO, BaCl2 không phản ứng  Chọn A.
Câu 20:
Chọn B.
Câu 21:
Chọn B.
Al2(SO4)3 + 6NaOH 
 2Al(OH)3 + 3Na2SO4; Al(OH)3 + NaOH 
 NaAlO2 + 2H2O.
Câu 22:
Loại B, C, D vì không xảy ra phản ứng.
t
t
Chọn A: 4FeS2 + 11O2 
 2Fe2O3 + 8SO2; Fe2O3 + 3CO 
 2Fe + 3CO2.
o

o

Câu 23:
A sai vì cacbon chiếm 2-5%. B sai vì cacbon chiếm 0,01-2%. C sai vì khử quặng oxit sắt bằng than cốc
trong lò cao  Chọn D.
Câu 24:
Chọn B.
Câu 25:
Bảo toàn điện tích đối với dung dịch X, ta có: 0,07.1 = 0,02.2 + x.1  x = 0,03
Bảo toàn điện tích đối với dung dịch Y, ta có: y.1 = 0,04.1  y = 0,04
Khi trộn dung dịch X và Y thì H+
(0,04)

+ OH- 
 H2O

(0,03)

 nH+còn dư = 0,04 – 0,03 = 0,01 mol  [H+] còn dư = 0,01/0,1 = 0,1M  pH = – lg[H+] = 1  Chọn C.

Câu 26:
nHNO3 = 1,5.0,95 = 1,425
 x  y  0, 25
 x  0, 2

Gọi x = nNO, y = nN2O   30 x  44 y

 0, 25  16, 4.2  y  0, 05


Cách 1:
4H+ + NO3- + 3e 
 NO + 2H2O
0,8 ←

0,6 ←

0,2

10H+ + 2NO3- + 8e 
 N2O + 5H2O
0,5 ←

0,4 ←

0,05

Do nH+ = 0,8 + 0,5 = 1,3 < nHNO3  Phải có thêm sản phẩm khử NH4NO3
10H+ + NO3- + 8e 
 NH4+ + 3H2O
Page 8


Truy cập Tailieugiangday.com hoặc liên hệ hotline: 096.991.2851 để tải bản word
bộ đề thi thử Hóa THPT QG 2018 và 2019 được cập nhật sắp tới.
0,125

→ 0,1

→ 0,0125

 mmuối = mkim loại + 62.ne nhận + mNH4NO3 = 29 + 62.(0,6 + 0,4 + 0,1) + 0,0125.80 = 98,2g  Chọn C.

Cách 2:
Do (3nNO + 8nN2O) + nNO + 2nN2O = 1,3 < nHNO3  Phải có thêm sản phẩm khử NH4NO3
 8nNH4NO3 + 2nNH4NO3 = 1,425 – 1,3  nNH4NO3 = 0,0125
 mmuối = mkim loại + 62.(3nNO + 8nN2O + 8nNH4NO3) + 80.nNH4NO3

= 29 + 62(3.0.2 + 8.0,05 + 8.0,0125) + 80.0,0125 = 98,2g  Chọn C.
Câu 27:
nCa(OH)2 = 0,1; nCaCO3 = 0,06
Đun dung dịch nước lọc lại thu được kết tủa  Trong nước lọc có chứa muối axit
CO2 + Ca(OH)2 
 CaCO3↓ + H2O
0,06 ← 0,06 ←

0,06
o

t
 Ca(HCO3)2 
2CO2 + Ca(OH)2còn dư 
 CaCO3↓ + CO2 + H2O

0,08 ← 0,04
 nCO2 = 0,14  V = 3,136 lít  Chọn C.

Câu 28:
nCO2 = nCaCO3 = 0,9
Mà mCO2 + mH2O = 50,4  mH2O = 50,4 – 0,9.44 = 10,8g  nH2O = 0,6 mol

 nankin = nCO2 – nH2O = 0,3 mol  V = 6,72 lít  Chọn A.
Câu 29:
Ta có nAg = 0,2 mol
Tröôøng hôïp 1: Anđehit HCHO
AgNO3 /NH3

 4Ag
HCHO 

0,05 mol ←

0,2 mol

 mHCHO = 0,05.30 = 1,5g ≠ 2,9g  Loại

Tröôøng hôïp 2 : Anđehit không phải HCHO
AgNO3 /NH3

 2xAg
R(CHO)x 

0,1
mol ←
x



0,2 mol

0,1
(R + 29x) = 2,9  R = 0  Chọn D.
x

Câu 30:
Ta có: nC6H2Br3OH = 33,1/331 = 0,1 mol; nNaOH = 0,5 mol
Page 9


Truy cập Tailieugiangday.com hoặc liên hệ hotline: 096.991.2851 để tải bản word
bộ đề thi thử Hóa THPT QG 2018 và 2019 được cập nhật sắp tới.
C6H5OH + 3Br2 
 C6H2Br3OH ↓ + 3HBr
0,1 mol ←

0,1 mol

→ 0,3 mol

Dung dịch X chứa CH3COOH và HBr
HBr + NaOH 
 NaBr + H2O
0,3 → 0,3
CH3COOH + NaOH 
 CH3COONa + H2O
0,2 ←

(0,5 – 0,3)

 m = mC6H5OH + mCH3COOH = 94.0,1 + 60.0,2 = 21,4g  Chọn B.

Câu 31:
nHCOOCH3 = 9/60 = 0,15  mHCOONa = 0,15.68 = 10,2g  Chọn D.
Câu 32:
CnH2n+3N + (1,5n + 0,75)O2 
 nCO2 + (n + 1,5)H2O + 0,5N2
2,24 lít

1,12 lít

 n = 1,5  Chọn D.

Câu 33:
nX = nHCl =

11,15  7,5
 0,1  MX = 75  Chọn A.
36,5

Câu 34:
nNaOH = nHCl = 0,002  x = 0,002/0,02 = 0,1  Chọn D.
Câu 35:
R 
 RSO4
mSO4 = 30,4 – 11,2 = 19,2  nR = nSO4 = 19,2/96 = 0,2  R = 11,2/0,2 = 56  Chọn A.
Câu 36:
Ca2+ + CO32- 
 CaCO3↓
0,07 ← 0,07 ←

0,07

Mà nCaCl2 = 0,04  nCa ban đầu = 0,03
Ta có nNa + 2nCa = 2nH2  nNa = 2.0,04 – 2.0,03 = 0,02  m = 0,02.23 + 0,03.40 = 1,66  Chọn C.
Câu 37:
nHNO3 = 0,68; nNO = 0,12
nHNO3 = 4nNO+ 10nNH4NO3  nNH4NO3 = 0,02  ne = 3nNO + 8nNH4NO3 = 0,52
mmuối = mkim loại + 62ne + mNH4NO3  2,5m + 8,49 = m + 62.0,52 + 80.0,02  m = 16,9
Bảo toàn ne 

n = 2
16,9
.n  0,52  M = 32,5n  
 Chọn C.
M
M = 65

Câu 38:

Page 10


Truy cập Tailieugiangday.com hoặc liên hệ hotline: 096.991.2851 để tải bản word
bộ đề thi thử Hóa THPT QG 2018 và 2019 được cập nhật sắp tới.
Ta thấy 14/75 = 0,18667  X là Gly

 3, 75
G : 75  0, 05

4, 62

 0, 035
  nGly  0,135
G-G :
75.2

18

0,945

G-G-G : 75.3  18.2  0, 005


G-G-G: x
27
27
 7x  0,135  x 
m
(75.7  18.5)  8,389  Chọn C.
Gọi 
1400
1400
G-G-G-G: x
Câu 39:
Cắt các chất trong X thành C, CHO, COOH
nAg = 0,4  nCHO = 0,2
nCOOH = nCO2 = 0,52
Nhận thấy nC = nCHO + nCOOH = 0,72  m = 0,72.12 + 0,2.29 + 0,52.45 = 37,84
C + O2 
 CO2; CHO + 0,75O2 
 CO2 + ½ H2O; COOH + 0,25O2 
 CO2 + ½ H2O
nO2 để đốt cháy m gam X = 0,72 + 0,2.0,75 + 0,52.0,25 = 1
 nO2 dùng đốt cháy glucozơ là 2,68 – 1 = 1,68

C6H12O6 + 6O2 
 6CO2 + 6H2O
 nC6H12O6 = 1,68/6 = 0,28  m’ = 0,28.180 = 50,4  m + m’ = 88,24  Chọn B.

Câu 40:
nH+ = 12nN2 + 10nNH4+ + 2nO (oxit)  nNH4+ = 0,05
Trong dung dịch Y có a mol Mg2+; b mol Fe3+; c mol Fe2+
 nKOH = 2a + 3b + 2c + nNH4+ = 3,15  2a + 3b + 2c = 3,1 (1)

Sau khi tác dụng với KOH thì phần dung dịch chứa 3,15 mol K+; 1,54 mol SO42- và nNO3- = 0,07
Bảo toàn N  nNO3- ban đầu = 2nN2 + nNH4+ + nNO3- (trong Y) = 0,2
 mX = 24a + 56(b + c) + 62.0,2 + 1,05.16 = 86 (2)

Bảo toàn ne  3nAl phản ứng = 3nFe3+ + 2nFe2+  nAl phản ứng = b + 2c/3
 mtăng = 56(b + c) – 27(b + 2c/3) = 28 (3)

(1), (2), (3)  a = 0,15; b = 0,9; c = 0,05
Oxit thu được gồm MgO (0,15 mol) và Fe2O3 (0,95/2 = 0,475)  m = 0,15.40 + 0,475.160 = 82
 Chọn A.

Page 11



Tài liệu bạn tìm kiếm đã sẵn sàng tải về

Tải bản đầy đủ ngay

×