Tải bản đầy đủ

Rèn kĩ năng cơ bản giải bài tập Hóa học THCS

Vững vàng nền tảng, Khai sáng tương lai

SỞ GD&ĐT QUẢNG TRỊ
PHÒNG GIÁO DỤC TRUNG HỌC

-----  -----

RÈN KỸ NĂNG CƠ BẢN
GIẢI BÀI TẬP HÓA HỌC THCS

Nguyễn Đức Tửu

Quảng Trị, th|ng 11 năm 2015

W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 1



Vững vàng nền tảng, Khai sáng tương lai

TẬP 1: MỘT SỐ DẠNG BÀI TẬP HÓA HỌC LỚP 8
CHƯƠNG 1: CÔNG THỨC HÓA HỌC
I. HÓA TRỊ VÀ NGUYÊN TỬ KHỐI
BÀI CA HÓA TRỊ
Kali (K), iốt (I), hiđro (H)
Natri (Na), bạc (Ag) với clo (Cl) một lo{i
L{ ho| trị (I) em ơi
Nhớ ghi cho kỹ kẽo rồi ph}n v}n
Magiê (Mg), kẽm (Zn) với thuỷ ng}n (Hg)
Oxi (O), đồng (Cu), thiếc (Sn) củng gần bari (Ba)
Cuối cùng thêm chú canxi (Ca)
Ho| trị II đó có gì khó khăn
Anh nhôm (Al) ho| trị III lần
Học đi cho kỹ khi cần có ngay
Cacbon (C), silic(Si) n{y đ}y
Có ho| trị IV không ng{y n{o quên
Sắt (Fe) kia cũng dễ quên tên
II, III lên xuống ph|t phiền lắm thôi
Nitơ (N) rắc rối nhất đời
I, II, III, IV lúc trồi lên V
Lưu huỳnh ( S) lắm lúc chơi khăm
Xuống II lên VI khi nằm thứ IV
Phốt pho (P) nói đến không dư
Có ai hỏi đến thì ừ III, V
Em ơi cố gắng học chăm
B{i ca ho| trị suốt năm cần dùng
HÓA TRỊ MỘT SỐ GỐC
1. HỌC SINH NẮM MỘT SỐ AXIT, H2O
2. HÓA TRỊ CỦA GỐC=SỐ NGUYÊN TỬ H TƯƠNG ỨNG BỊ MẤT ĐI
HNO3  NO3 có hóa trị I
H3PO4  H2PO4 có hóa trị I, HPO4 có hóa trị II, PO4 có hóa trị III
H2SO4  SO4 có hóa trị II
H2O  OH có hóa trị I
H2CO3  HCO3 có hóa trị I, CO3 có hóa trị II
W: www.hoc247.net


F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 2


Vững vàng nền tảng, Khai sáng tương lai

BÀI CA NGUYÊN TỬ KHỐI
Hai ba Natri (Na=23)

Mangan vừa vặn

Nhớ ghi cho rõ

Con số năm lăm (Mn=55)

Kali chẳng khó

Ba lăm phẩy năm

Ba chín dễ d{ng (K=39)

Clo chất khí (Cl=35.5)

Khi nhắc đến V{ng

Phải nhớ cho kỹ

Một trăm chín bảy (Au=197)

Kẽm l{ s|u lăm (Zn=65)

Oxi gây cháy

Lưu huỳnh chơi khăm

Chỉ mười s|u thôi (O=16)

Ba hai đ~ rõ (S=32)

Còn Bạc dễ rồi

Chẳng có gì khó

Một trăm lẻ t|m (Ag =108)

Cacbon mười hai (C=12)

Sắt m{u trắng x|m

Bari hơi d{i

Năm s|u có gì (Fe=56)

Một trăm ba bảy (Ba=137)

Nghĩ tới Beri

Ph|t nổ khi ch|y

Nhớ ngay l{ chín (Be=9)

Cẩn thận vẫn hơn

Gấp ba lần chín

Khối lượng giản đơn

L{ của anh Nhôm (Al=27)

Hiđrô l{ một (H=1)

Còn của Crôm

Còn cậu Iốt

L{ năm hai đó (Cr=52)

Ai hỏi nói ngay

Của Đồng đ~ rõ

Một trăm hai bảy (I=127)

L{ s|u mươi tư (Cu =64)

Nếu hai lẻ bảy

Photpho không dư

Lại của anh Chì (Pb =207)

L{ ba mươi mốt (P=31)

Brôm nhớ ghi

Hai trăm lẻ một

T|m mươi đ~ tỏ (Br = 80)

L{ của Thủy Ng}n (Hg=201)

Nhưng vẫn còn đó

Chẳng phải ngại ngần

Magiê hai tư (Mg=24)

Nitơ mười bốn (N=14)

Chẳng phải chần trừ

Hai lần mười bốn

Flo mười chín (F=19)

Silic phi kim (Si=28)

………. HẾT ………

Can xi dễ tìm
Bốn mươi vừa chẵn (Ca=40)

W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 3


Vững vàng nền tảng, Khai sáng tương lai

II. QUY TẮC HÓA TRỊ
a b
A x By

Trong đó: A, B l{ KHHH của nguyên tố
a, b là hóa trị tương ứng của A, B
x, y l{ chỉ số
Quy tắc hóa trị : a.x = b.y
Nội dung: Trong hợp chất hai nguyên tố tích giữa hóa trị v{ chỉ số nguyên tử của
nguyên tố n{y bằng tích của hóa trị v{ chỉ số nguyên tử của nguyên tố kia.
III. VẬN DỤNG QUY TẮC HÓA TRỊ
1. Tính ho| trị của 1 nguyên tố
a

b

- Gọi ho| trị của nguyên tố cần tìm l{ a ( A x B y )
- \p dụng QTHT: a.x = b.y  a = b.y/x
- Trả lời
2. Lập CTHH của hợp chất
Bước 1: Gọi công thức tổng qu|t.
Bước 2: Lập đẳng thức hóa trị: a.x = b.y
Bước 3: Rút tỉ lệ: x:y
Bước 4: Chọn x; y khi tỉ lệ x, y tối giản
Bước 5: Viết công thức tìm được
Ví dụ: Lập công thức hóa học của nhôm oxit.
III

II

Gọi công thức nhôm oxit l{ A l x O y
Theo qui tắc hóa trị: III.x=II.y
Tỉ lệ:

x II 2


y III 3

Chọn x=2  y=3
Vậy công thức Al2O3
Chú ý: Đ}y chỉ l{ trường hợp đơn giản, sau khi có tỉ lệ tối giản ta có công thức đơn giản nhất.
Để lập công thức hóa học nhanh trong PTHH ta có thể vận dụng
a) Hóa trị như nhau: KHÔNG CHI CHỈ SỐ.
b) Hóa trị kh|c nhau tối giản: HÓA TRỊ ANH N[Y L[ CHỈ SỐ ANH KIA
c) Hóa trị kh|c nhau, chưa tối giản: L[M TỐI GIẢN RỒI L[M NHƯ b
3. B{i tập vận dụng
Dạng: Lập CTHH
Ví dụ 1: Lập CTHH của c|c chất có th{nh phần như sau:
1. Al(III) và O;
2. Ca(II) và O
3. K(I) và O
4. Ca(II) và NO3(I) 5. Ba(II) và PO4(III)
6. Al(III) và SO4(II)
Dạng: Tính hóa trị của một nguyên tố
Ví dụ 2: Tìm hóa trị của nguyên tố Fe trong hợp chất Fe2O3.
Giải: Gọi hóa trị của Fe trong hợp chất Fe2O3 là x: Fe2O3
|p dụng quy tắc hóa trị ta có: x.2 = II.3
Ta có:

II.3
 III 
2

Hóa trị của nguyên tố Fe trong hợp chất Fe2O3 là III.

B{i tập: Tính hóa trị của c|c nguyên tố sau trong hợp chất với oxi sau:
a) NO; N2O3; NO2; N2O; N2O5.
b) CO2; CO; P2O5; P2O3; Ag2O.
W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 4


Vững vàng nền tảng, Khai sáng tương lai

IV. MỞ RỘNG MỘT SỐ TRƯỜNG HỢP KHÁC
Hóa trị bằng chữ: MxOy, M(NO3)n; Đặc biệt: Fe3O4
CHƯƠNG 2: ĐỊNH LUẬT BẢO TOÀN KHỐI LƯỢNG
I. NỘI DUNG ĐỊNH LUẬT BẢO TOÀN KHỐI LƯỢNG
1. Trong một phản ứng tổng khối lượng của c|c chất phản ứng bằng tổng khối lượng
của c|c chất sản phẩm.
TQ: aA + bB → cC + dD  mA + mB = mC + nD
2. Mở rộng
Tổng khối lượng c|c chất trước phản ứng =Tổng khối lượng c|c chất sau phản ứng
TQ: Trộn FeO v{ Al (hỗn hợp A), nung nóng thu được hỗn hợp chất rắn B.
 mA=mB
Lưu ý: Trường hợp đơn giản
Cho khối lượng của n - 1 chất trong một phương trình có n chất thì tính được khối
lượng của chất còn lại.
II. BÀI TẬP ĐƠN GIẢN
Ví dụ 1: Ph}n huỷ 10 gam canxi cacbonat (CaCO3) ở nhiệt độ cao thu được 5,6 gam
vôi sống (CaO), ngo{i ra còn một lượng khí cacbonic (CO 2)tho|t ra. Tính khối lượng khí
cacbonic đó.
Giải:
t0  CaO + CO2
Sơ đồ phản ứng: CaCO3 
\p dụng ĐLBTKL: mCaCO3 = mCaO + mCO2
 mCO2=mCaCO3 - mCaO =10-5,6 =4,4 gam
Ví dụ 2: Nhiệt ph}n ho{n to{n m gam nhôm nitrat [Al(NO3)3] thu được 20,4 gam
nhôm oxit (Al2O3), 55,2 gam nitơ đioxit (NO2) và 9,6 gam oxi (O2).
Lập sơ đồ phản ứng v{ tính khối lượng nhôm nitrat phản ứng.
t0  Al2O3 + NO2 + O2
Sơ đồ phản ứng: Al(NO3)3 
\p dụng ĐLBTKL ta có: mAl(NO3)3 = mAl2O3 + mNO2 + mO2
 mAl(NO3)3 = 20,4 + 55,2 + 9,6 = 85,2 gam
III. BÀI TẬP VẬN DỤNG
Câu 1: Tính khối lượng muối nhôm clorua sinh ra khi cho 5,4 gam nhôm t|c dụng hết với
dung dịch chứa 21,9 gam HCl, biết sau phản ứng còn có 0,6 gam khí hiđro sinh ra.
Câu 2: Cho đồng(II)sunfat t|c dụng với 8 gam natri hiđroxit thu được 9,8 gam đồng (II)
hiđroxit v{ 14,2 gam natri sunfat.
Viết sơ đồ phản ứng v{ tính khối lượng đồng(II) sunfat đ~ phản ứng.
Câu 3: Cho 5,4 gam nhôm t|c dụng với dung dịch chứa 29,4 gam axit sunfuric thu được
nhôm sunfat v{ 0,6 gam khí hiđro.
Viết sơ đồ phản ứng v{ tính khối lượng nhôm sunfat thu được.
Câu 4: Nhiệt ph}n ho{n to{n 31,6g kali pemanganat (KMnO4) thu được c|c chất l{ kali
manganat (K2MnO4), mangan đioxit (MnO2) và khí oxi (O2)có khối lượng lần lượt tỉ lệ với
197:87:32. Tính khối lượng mỗi chất sản phẩm.
Câu 5: Đốt ch|y a gam photpho trong không khí thu được 2,84 gam một chất rắn m{u trắng
l{ điphotphopentaoxit.
a) Ghi sơ đồ phản ứng v{ viết công thức khối lượng của phản ứng.
b) Nếu a = 1,24 gam, tính khối lượng oxi tham gia phản ứng.
c) Nếu a = 2,48 gam, lượng oxi tham gia phản ứng l{ 3,2 gam thì khối lượng chất rắn
thu được có thay đổi không? Tăng hay giảm bao nhiêu lần.
W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 5


Vững vàng nền tảng, Khai sáng tương lai

Câu 6: Khi cho hỗn hợp 2 kim loại A, B t|c dụng hết với oxi, thu được 6,05 g hỗn hợp 2 oxit
(Hợp chất của kim loại với oxi).
a) Ghi sơ đồ phản ứng.
b) Tính khối lượng oxi cần dùng.
Câu 7: Hòa tan ho{n to{n 5,6 g kim loại M v{o dung dịch HCl dư, phản ứng xảy ra theo sơ đồ
sau: M + axitclohidric  Muối clorua + Khí hiđro
Thu lấy to{n bộ lượng hiđro tho|t ra. Dung dịch sau phản ứng nặng hơn dung dịch ban đầu 5,4 gam.
a) Tính số g khí hiđro thu được.
b) Tính số g axit clohidric phản ứng.
Câu 8: Đốt ch|y ho{n to{n 1,5 kg than (th{nh phần chính l{ C) thì dùng hết 3,2 kg oxi v{
sinh ra 4,4 kg khí cacbonic.
a) H~y lập PTHH của phản ứng.
b) Mẫu than trên chứa bao nhiêu % C.
Nếu đốt ch|y hết 3 kg than cùng loại thì lượng oxi, khí cacbonic sinh ra l{ bao nhiêu gam.
Câu 9: Nung 1 tấn đ| vôi chứa 80% l{ CaCO3 thì được bao nhiêu tạ vôi. Biết lượng khí
cacbonic sinh ra l{ 3,52 tạ. Lập PTHH của phản ứng.
Câu 10: Đốt ch|y hết 4,4 gam hỗn hợp gồm C v{ S người ta dùng hết 4,48 lít khí oxi (đtkc).
Tính khối lượng c|c chất khí sinh ra.
CHƯƠNG 3: ĐẠI LƯỢNG MOL
I.KHÁI NIỆM
1. Định nghĩa
Mol l{ lượng chất chứa 6.1023 nguyên tử chất hoặc ph}n tử chất (Hạt vi mô)
2. Một số công thức cần lưu ý
a) Số hạt vi mô
S=Số pt chất (nguyên tử chất) (hạt vi mô) = n . 6.1023
 n = Số pt chất : 6.1023
b) khối lượng v{ số mol
m=n.M
 n=m:M
Trong đó: m l{ khối lượng chất (thay đổi theo n)
M l{ khối lượng mol (không đổi)
n l{ số mol chất
c) Số mol v{ thể tích
V khí đkc = n . 22,4
 n = V khí đkc : 22,4
Chú ý:Cho hợp chất C6H12O6. Cho biết chất trên tạo nên từ bao nhiêu nguyên tố,
nguyên tử, số lượng nguyên tử c|c nguyên tố?
Ta có hợp chất C6H12O6 tạo nên từ 3 nguyên tố: C, H, O v{ 24 nguyên tử gồm: có 6
nguyên tử C; 12 nguyên tử H v{ 6 nguyên tử O.
II. CÁC DẠNG BÀI TẬP
1. Dạng 1: Tính số nguyên tử mỗi nguyên tố
Ví dụ: Tính số nguyên tử mỗi nguyên tố có trong:
a) 0,6 mol Fe.
b) 0,8 mol P2O5.
c) 0,1 mol NH4NO3.
W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 6


Vững vàng nền tảng, Khai sáng tương lai

Giải:
a) Số nguyên tử Fe = nFe . 6.1023 = 0,6.6.1023 = 3,6.1023 nguyên tử
b) Số ph}n tử P2O5 = nP2O5 . 6.1023 = 0,8 . 6.1023 = 4,8.1023 ph}n tử
Số nguyên tử P = 2 số ph}n tử P2O5 = 2.4,8.1023 = 9,6.1023 nguyên tử
Số nguyên tử O = 5 số ph}n tử P2O5 = 5.4,8.1023 = 24.1023 nguyên tử
B{i tập vận dụng: Tính số nguyên tử của mỗi nguyên tố có trong.
a) 0,3 mol Cu
; 1,2 mol Al; 1,6 mol P; 3,3 mol S; 1,28 mol Zn.
b) 0,6 mol Al2O3; 0,8 mol Fe3O4; 0,86 mol C6H12O6; 0,36 mol Al2(SO4)3.18H2O
2. Dạng 2: Tính số mol của c|c chất
Ví dụ: Tính số mol của c|c chất có trong:
a) 9,3 . 1023 nguyên tử Mg
b) 1,218.1024 ph}n tử Ca(AlO2)2
c) 13,44 lít khí O2 (đktc)
d) 4,9g H3PO4
Giải:
a)nMg = số nguyên tử Mg : 6.1023 = 9,3.1023 : 6.1023 = 1,55 mol
b) nCa(AlO2)2 = số ph}n tử Ca(AlO2)2 : 6.1023 = 1,218.1024 : 6.1023 = 2,03 mol
c) nO2 =V(O2) : 22,4 = 13,44 : 22,4 = 0,6 mol
d) nH3PO4 = mH3PO4 : M(H3PO4) = 4,9 : 98 = 0,05 mol
B{i tập vận dụng: Tính số mol của c|c chất có trong:
a) 3,06. 1023 nguyên tử K, 12,9 .1022 nguyên tử Ag; 6,3.1023 ph}n tử H2SO4.
b) 2,24 lít khí O2; 33,6 lít khí SO2; 17,92 lít khí CO2 (đktc).
c) 16,32 gam Al2O3; 28,8 gam Fe2O3; 3,2 gam CuSO4; 35,28 gam H2SO4.

W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 7


Vững vàng nền tảng, Khai sáng tương lai

3. Dạng 3: Tính khối lượng mỗi nguyên tố
Ví dụ: Tính khối lượng mỗi chất v{ mỗi nguyên tố có trong.
a) 0,5 mol Cu.
b) 0,8 mol C6H12O6.
c) 7,392 lít khí C4H10 (đktc).
d) 0,129. 1025 pt Ca(NO3)2.
Giải:
a) mCu = nCu.MCu = 0,5 . 64 = 32 g
b) Cho nC6H12O6 = 0,8 mol
mC6H12O6 = nC6H12O6 . M(C6H12O6)= 0,8 . 180 =144 g
nC = 6.nC6H12O6 = 6.0,8 = 4,8 mol
mC = nC . MC = 4,8.12 = 57,6 g
nH = 12.nC6H12O6 = 12.0,8 = 9,6 mol
mH = nH . MH = 9,6.1 = 9,6 g mO = 144 - 57,6 - 9,6 = 76,8 g
c) nC4H10 = V(C4H10) : 22,4 = 7,392 : 22,4 = 0,33 mol
mC4H10 = nC4H10 . M(C4H10) = 0,33.58 = 19,14 g
nC = 4nC4H10 = 4.0,33 = 1.32 mol
mC = nC.MC = 1,32.12 =15,84 g
d) nCa(NO3)2 = số pt Ca(NO3)2 : 6.1023 = 0,129.1025 : 6.1023 = 2,15 mol
mCa(NO3)2 = nCa(NO3)2 . M[Ca(NO3)2]= 2,15 . 164 =352,6 g
nCa = nCa(NO3)2 = 2,15 mol
mCa = nCa . MCa = 2,15.40 = 86 g
nN = 2nCa(NO3)2 = 2.2,15 = 4,3 mol
mN = nN.MN = 4,3.14 = 60,2 g
mO = 352,6 - 86 - 60,2 = 206,4 g
B{i tập vận dụng: Tính khối lượng mỗi nguyên tố có trong:
a) 0,16 mol Fe3O4; 0,83 mol C12H22O11; 0,68 mol Cu(NO3)2; 1,5 mol Ca3(PO4)2.
b) 36,512 lít khí SO3; 8,832 lít khí NH3; 8,592 lít khí C3H8 (đktc)
c) 0,9.1023 ph}n tử Mg(ClO4)2; 933,612.1021 ph}n tử Fe(ClO3)3.
Một số b{i tập kh|c
Câu 1: Có 3 mol hỗn hợp gồm H2O và CO2. Tính số ph}n tử, số nguyên tử mỗi nguyên tố có
trong hỗn hợp biết rằng.
a) Số pt H2O = 2 số pt CO2.
b) Số pt H2O - số pt CO2 = 1,8.1023.
c) Số nguyên tử C = 4,8.1023.
d) Số nguyên tử H = 15,6.1023.
Câu 2: Một hỗn hợp gồm Al2(SO4)3 và Ca3(PO4)2 có tổng số nguyên tử oxi l{ 43,2.1023
nguyên tử v{ số nguyên tử P = 2 số nguyên tử S.
a) Tính khối lượng mỗi chất có trong hỗn hợp.
b) Tính khối lượng của mỗi nguyên tố có trong hỗn hợp đó.
Câu 3: Một hỗn hợp gồm 8,4.1023 ph}n tử Ca3(PO4)2 và Al2(SO4)3 trong đó khối lượng
nguyên tố oxi l{ 230,4 gam. Tính khối lượng mỗi nguyên tố có trong hỗn hợp đó.
Câu 4: Có 145,2 gam hỗn hợp Ca(NO3)2 và CuSO4 với tổng số ph}n tử l{ 5,4.1023 ph}n tử.
Tính khối lượng mỗi chất v{ khối lượng mỗi nguyên tố có trong hỗn hợp đó.

W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 8


Vững vàng nền tảng, Khai sáng tương lai

CHƯƠNG 4: TỈ KHỐI CỦA CHẤT KHÍ
I. KIẾN THỨC CƠ BẢN
1. Khối lượng mol trung bình
M

M a  M 2a 2  .....
M1n1  M 2 n 2  .....
M V  M 2 V2  .....
, M 1 1
, M 1 1
V1  V2  .....
100%
n1  n 2  .....

Với: M1, M2 ...: lần lượt l{ khối lượng ph}n tử của chất 1, 2...
n1, n2 ....: lần lượt l{ số mol của c|c chất 1, 2...
a1, a2... lần lượt l{ th{nh phần phần trăm theo khối lượng của c|c chất 1, 2....
Với chất khí: lần lượt l{ th{nh phần phần trăm theo thể tích của c|c chất khí 1, 2....
Tổng qu|t:

M

mhçn hî p
nhçn hî p

2. Biểu thức tỉ khối hơi của chất khí A so với khí B
M
MA
dA/B  A  M A  dA/B.M B , M B 
MB
dA/B

3. Biểu thức tỉ khối hơi của hỗn hợp chất khí A so với hỗn hợp khí B
M
M
A , M
dA/B  A  M  dA/B .M , M 
B
B d
KK
A
M
A/B
B

29

Chú ý: Khối lượng mol của khí He=4, Khối lượng mol của khí nitơ (N2)=14.2=28
II. BÀI TẬP
1. Dạng 1: Tính tỉ khối của c|c chất
Ví dụ 1: Tính tỉ khối của khí oxi đối với khí hiđro v{ cho biết khí oxi nặng hơn khí
hiđro bao nhiêu lần?
Giải:
MO
2  16.2  16
Ta có: dO /H 
1.2
2 2 MH
2

Vậy khí oxi nặng hơn khí hiđro16 lần.
Ví dụ 2: Tính tỉ khối của hỗn hợp A gồm 2,24 mol CH4 và 8,96 lít C2H4 (đktc) với hỗn
hợp B gồm 8,8g CO2 và 19,2g SO2.
Giải:
Ta có: nCH4=2,24 : 22,4 = 0,1 mol, nC2H4=8,96 : 22,4 = 0,4 mol,
nCO2 = 8,8 : 44 = 0,2 mol, nSO2 = 19,2 : 64 = 0,3 mol.
0,1.16  0,4.28
8,8  19,2
 25,6gam / mol , M 
 56 gam/mol
A
0,1  0,4
0,2  0,3
25,6
 0,4571
Vậy: dA/B 
56
MA 

Dạng 2: Tìm c|c đại lượng kh|c khi biết tỉ khối hơi
Ví dụ: Một hỗn hợp gồm CH4 và O2 có tỉ khối so với H2 là 12,8. Tính % khối lượng v{
% về thể tích của mỗi khí có trong hỗn hợp ban đầu.
Giải:
M

hh

 12, 8.2  25, 6 gam / mol

Cách 1: Gọi x, y lần lượt l{ số mol của CH4 và O2.
Ta có: M A 

x.16  y.28
x 2
 25,6  
xy
y 3

Vậy: %(V) CH4 = 40% và %(V)O2 = 60%
W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 9


Vững vàng nền tảng, Khai sáng tương lai

2.16
.100%  27,59% và %(m)O2=72,41%.
2.16  3.28
Cách 2: Chọn 1 mol hỗn hợp  x=0,4 mol và y= 0,6 mol

%(m) CH4 =

Dạng 3: Biết tỉ khối hơi ta x|c định được khối lượng mol
Biết tỉ khối hơi của hợp chất hữu cơ A so với không khí gần bằng 3,1724. Tính khối
lượng mol của A.
Giải:
Ta có: M  dA/B.M B  M  dA/kk .M  3,17241.29  92gam / mol
A

A

kk

B{i tập vận dụng
Câu 1: Tính tỉ khối của c|c chất khí sau: CO2; N2O5; C4H10; SO3; SO2; CH4; N2; NO2.
a) So với khí O2.
b) So với khí H2.
c) So với không khí.
Câu 2: Một hỗn hợp khí gồm 3,2g khí oxi v{ 8,8g khí CO2. X|c định khối lượng trung bình
của một mol hỗn hợp khí trên.
Câu 3: Tính tỉ khối hỗn hợp khí sau đối với khí CO:
a) 7,04 g CO2 và 11,52 g SO2
b) 0,6 mol N2 và 0,8 mol CH4.
Câu 4: Một hỗn hợp gồm có 0,1mol O2; 0,25 mol N2 và 0,15 mol CO.
a) Tính khối lượng trung bình của một mol hỗn hợp khí trên.
b) X|c định tỉ khối của hỗn hợp khí đó đối với không khí v{ đối với H2.
Câu 5: Hỗn hợp B gồm 0,2 mol N2; 6,72 lít SO2 ; 4,4g CO2. Tính khối lượng riêng của hỗn
hợp khí B ở đktc.
Câu 6: Một hỗn hợp gồm C2H6 và NO2 có tỉ khối so với O2 l{ 1,1225. Tính % khối lượng v{
% về thể tích của mỗi khí có trong hỗn hợp ban đầu.

W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 10


Vững vàng nền tảng, Khai sáng tương lai

CHƯƠNG 5: TÍNH THEO CÔNG THỨC HÓA HỌC
I. Dạng b{i tập tính % khối lượng mỗi nguyên tố trong một hợp chất
1. Phương ph|p
-Tính khối lượng mol của hợp chất đó
- X|c định khối lượng mỗi nguyên tố trong một mol hợp chất đó
- Tính % khối lượng mỗi nguyên tố đó trong hợp chất
2. Ví dụ
Tính % khối lượng mỗi nguyên tố trong hợp chất Al2(SO4)3.
Giải:
M[Al2(SO4)3] = 2.27+32.3+16.12=342 gam
Trong 342 gam Al2(SO4)3 có 54 gam Al; 96 gam S; 192 gam O
Vậy: %(m)Al=(54:342).100%= 15,79%
%(m)S =(96:342).100% = 28,07%
%(m)O =100% -15,79%-28,07%=54,14%
3. B{i tập vận dụng
Tính % khối lượng mỗi nguyên tố có trong c|c hợp chất có công thức hóa học sau:
K2O, BaO, CuSO4.5H2O, KCl.MnCl2.6H2O, Na2O.K2O.6SiO2.
II. Dạng b{i tập tính khối lượng mỗi nguyên tố trong một lượng hợp chất
1. Phương ph|p
Cách 1:
- Tính số mol hợp chất
- Tính số mol mỗi nguyên tố
- Tính khối lượng mỗi nguyên tố
Cách 2:
Lấy % khối lượng của mỗi nguyên tố nh}n với khối lượng hợp chất
2. Ví dụ
Tính khối lượng mỗi nguyên tố có trong 62,5g CaCO3.
Giải:
nCaCO3 = 62,5:100 = 0,625(mol)
n Ca = nCaCO3= 0,625(mol)  mCa = 0,625.40= 25gam
nC = nCaCO3= 0,625 (mol)  mC = 0,625.12 =7,5gam
mO = 62,5-25-7,5 =30gam
3. B{i tập vận dụng
Tính khối lượng mỗi nguyên tố có trong:
a) 1,2 mol Al2O3, 1,6 mol Fe3O4, 0,36 mol Al2(SO4)3.18H2O
b) 11,7g H2O, 14,7g H2SO4, 77,5g Ca3(PO4)2, 243,1g Na2CO3.10H2O
III. Tính khối lượng của hợp chất khi biết khối lượng của nguyên tố trong hợp chất đó
1. Phương ph|p
Cách 1
- Tính số mol của nguyên tử nguyên tố đó
- Tính số mol của hợp chất
- Tính khối lượng của hợp chất
Cách 2
Lấy khối lượng của nguyên tố đó chia cho % khối lượng của nguyên tố đó trong hợp
chất
2. Ví dụ
Tính khối lượng của hợp chất Mg(ClO4)2 biết sau khi ph}n tích ho{n to{n người ta thu
được 76,8 gam oxi.
W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 11


Vững vàng nền tảng, Khai sáng tương lai

Giải:

Ta có: nO =76,8:16 =4,8 (mol)  mMg(ClO4)2 = 4,8/8. 233= 0,6.223=133,8 gam
3. B{i tập vận dụng
a) Tính khối lượng của hợp chất C6H12O6 biết khối lượng cacbon l{ 7,2 gam.
b) Tính khối lượng của hợp chất C12H22O11 biết khối lượng hiđro l{ 26,4 gam.
c) Tính khối lượng của hợp chất Al2(SO4)3 biết khối lượng lưu huỳnh l{ 4,8 gam.
IV. Tính khối lượng của hợp chất khi biết quan hệ khối lượng giữa c|c nguyên tố
trong hợp chất đó
1. Phương ph|p
Cách 1
- C|c nguyên tố trong một hợp chất đều có một tỉ lệ về số mol nhất định.
- Tính được sự chênh lệch về khối lượng của c|c nguyên tố trong một mol hợp chất
đó.
- Từ sự chênh lệch khối lượng giữa c|c nguyên tố trong hợp chất b{i ra sẽ tính
được khối lượng hợp chất.
Cách 2
- Gọi số mol hợp chất.
- Tính số mol mỗi nguyên tố.
- Lập biểu thức liên quan.
- Tìm số mol v{ khối lượng chất.
2. Ví dụ
Tính khối lượng hợp chất Al2(SO4)3 biết rằng trong hợp chất mO - mAl =27,6 gam.
Giải:
Cách 1
1 mol Al2(SO4)3 có khối lượng 342 gam thì mO - mAl =12.16- 2.27= 138 gam
Nếu: mO - mAl =27,6 gam  mAl2(SO4)3 = 27,6.342 : 138= 68,4 gam.
Cách 2
Gọi nAl2(SO4)3= x (mol)
nO =12x mol
nAl = 2x mol mO=12x.16 = 192x g
 mAl = 2x. 27 = 54x gam. Ta có 192x - 54x = 27,6
x = 0,2 mol
 m Al2(SO4)3 = 0,2.342 = 68,4 gam
3. B{i tập vận dụng
Câu 1: Tính khối lượng hợp chất Ba3(PO4)2 biết rằng trong hợp chất
mBa - mP=209,4
gam. Câu 2: Tính khối lượng hợp chất Na2CO3.10H2O biết rằng trong hợp chất trung bình
cộng khối lượng của 3 nguyên tố Na, C, H l{ 4,16 gam.

W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 12


Vững vàng nền tảng, Khai sáng tương lai

CHƯƠNG 6: XÁC ĐỊNH CÔNG THỨC HÓA HỌC CỦA MỘT CHẤT
I. DẠNG 1: Tìm CTHH của một hợp chất khi biết M v{ % khối lượng của mỗi nguyên tố
1. Phương ph|p
Cách 1
- Tính khối lượng mỗi nguyên tố có trong một mol hợp chất
- Tính số mol mỗi nguyên tố có trong một mol hợp chất
- Suy ra số nguyên tử mỗi nguyên tố có trong một ph}n tử chất
- Viết CTHH
Cách 2
Ta có hợp chất AxByCz có khối lượng mol l{ M
Ax By Cz
M
M %A
M %B
M %C



x
.
,y 
.
,z 
.
%A %B %C 100
100 A
100 B
100 C

2.Ví dụ
Tìm CTHH của hợp chất biết M=342 gam và %Al=15,79%; %S=28,07% ;%O= 56,14%.
Giải:
Cách 1
-Trong một mol hợp chất có:
mAl =15,79.342/100 = 54 g
nAl = 54 : 27 = 2 mol
mS = 28,07.342/100 = 96 g
nS = 96 : 32 = 3 mol
mO = 342 - 54 - 96 = 192 g
nO = 192 : 16 = 12 mol
-Vậy trong một mol chất có 2 mol Al; 3 mol S; 12 mol O
-Suy ra trong 1 ph}n tử chất có 2 nguyên tử Al; 3 nguyên tử S v{ 12 nguyên tử O.
-Vậy CTHH của hợp chất cần tìm l{ Al2S3O12 hay Al2(SO4)3
Cách 2
Gọi CTHH của hợp chất cần tìm có dạng: AlxSyOz
Ta có:

27x 32y 16z 342
15,79
28,07
56,14



 x  3,42.
 2,y  3,42.
 3,z  3,42.
 12
%A %B %C 100
27
32
16

-Vậy CTHH của hợp chất cần tìm l{ Al2S3O12 hay Al2(SO4)3
3. B{i tập vận dụng
Tìm CTHH của c|c hợp chất có th{nh phần khối lượng c|c nguyên tố sau:
M=213gam, %Al=12,68%; %N =19,72%; %O = 67,6%.
II. DẠNG 2: Tìm CTHH của một hợp chất khi biết M v{ khối lượng của mỗi nguyên tố
1. Phương ph|p
- Tính khối lượng hợp chất
- Tính số mol hợp chất, tính số mol mỗi nguyên tố có trong lượng mol chất đó.
- Suy ra số mol mỗi nguyên tố có trong 1 mol hợp chất
- Viết CTHH
2. Ví dụ
Tìm CTHH của hợp chất biết M=213 gam v{ khối lượng c|c nguyên tố trong hợp chất
là: mAl=13,5 gam, mN=21 gam, mO=72 gam.
Giải
mhc = 13,5 + 21 + 72 = 106,5 gam
nhc = 106,5 : 213 = 0,5 mol  Trong 0,5 mol hợp chất có:
nAl = 13,5 : 27 = 0,5 (mol)
nN = 21 : 14 = 1,5 (mol)
nO = 72 : 16 = 4,5 (mol)
Vậy trong 1 mol hợp chất có 1 mol Al; 3 mol N; 9 mol O
Suy ra 1 ph}n tử chất có 1 nguyên tử Al; 3 nguyên tử N; 9 nguyên tử O
W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 13


Vững vàng nền tảng, Khai sáng tương lai

Công thức ho| học của hợp chất cần tìm l{ AlN3O9 = Al(NO3)3
3. B{i tập vận dụng
Tìm CTHH của c|c hợp chất có th{nh phần khối lượng c|c nguyên tố sau:
M=82 gam, mH=0,4gam, mS=6,4gam, mO=9,6gam.
III. DẠNG 3: Tìm CTHH của hợp chất khi không biết M chỉ biết % (m) của mỗi nguyên tố 1.
Phương ph|p
Cách 1
- Coi khối lượng hợp chất l{ 100 gam, tính khối lượng mỗi nguyên tố còn lại
- Tính số mol mỗi nguyên tố
- Lập tỉ lệ số mol mỗi nguyên tố vừa tính được
- Chọn tỉ lệ tối giản l{m số nguyên tử của mỗi nguyên tố
Cách 2
Gọi CTHH của hợp chất cần tìm có dạng: AlxSyOz
Ta có: x : y : z 

%A %B %C


A
B
C

Tỉ lệ x : y : z tối giản nhất được chọn l{m số nguyên tử mỗi nguyên tố trong hợp chất đó
Lưu ý: Việc tìm công thức ph}n tử dạng to|n n{y chỉ |p dụng có giới hạn.
2. Ví dụ
Tìm CTHH của hợp chất biết %Al =15,8% ; %S =28,1% ; %O = 56,1%.
Giải:
Cách 1
Chọn khối lượng hợp chất l{ 100gam
Suy ra mAl = 15,8g; mS = 28,1g; mO = 51,6g
Ta có: nAl: nS : nO =1:1,5 :6 = 2 : 3 : 12
Chọn số nguyên tử Al = 2; số nguyên tử S = 3; số nguyên tử O = 12
Vậy CTHH hợp chất cần tìm l{ Al2S3O12 hoặc Al2(SO4)3
Cách 2
Gọi CTHH của hợp chất cần tìm có dạng AlxSyOz
Ta có: x : y : z 

%Al %S %O


 2 : 3:12
27
32
16

Chọn x =2 ; y = 3 ; z = 12
Vậy CTHH hợp chất cần tìm l{ Al2S3O12 hoặc Al2(SO4)3
3. B{i tập vận dụng
Tìm CTHH của c|c hợp chất có th{nh phần khối lượng c|c nguyên tố sau:
1. %H = 2,04% ; %S = 32,65% ; %O = 65,31%
2. %Fe = 23,14% ; %N =17,36% ; %O = 59,5%
3. Một loại thủy tinh có th{nh phần: 18,43% K2O, 10,98% CaO, 70,59%SiO2. Tìm
CTHH của loại thủy tinh n{y.
4. Một loại silicat có th{nh phần gồm 32,06% Si; 48,85% O còn lại l{ Na v{ Al. Tìm
Công thức của silicat đó biết công thức của silicat đó có dạng xNa 2O.yAl2O3.zSiO2
IV. Dạng 4: X|c định chất dựa v{o M
1. Phương ph|p
- Tính số mol v{ c|c đại lượng kh|c
- Phương trình phản ứng
- Theo phương trình phản ứng v{ b{i ra ta lập phương trình to|n học
- Giải tìm M  Chất
2. Ví dụ
W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 14


Vững vàng nền tảng, Khai sáng tương lai

Ví dụ 1: Hòa tan hết 1,4 gam kim loại X v{o 200 gam nước, sau phản ứng thu được
0,784 lít khí (đktc). X|c định kim loại X v{ tính nồng độ % của chất tan trong dung dịch sau
phản ứng.
Giải:
1, 4
0,784
nX 
mol
 0,035mol
X
22, 4
2X + 2nH2O 
 2X(OH)n + nH2 (1)
1, 4 n
Theo (1) :
  0, 035  X  20n Vậy n=2 v{ X=40 (Ca)
X 2
mdd  200  1, 4  mH2  201, 4  0,035.2  201,33gam

Ta có : n H2 

C%Ca (OH)2 

0, 035.74
100%  1, 286%
201,33

Ví dụ 2: Một oxit kim loại MxOy, trong đó M chiếm 72,41% khối lượng. Khử ho{n to{n oxit
n{y bằng khí CO dư thu được 16,8 gam kim loại M. Hòa tan hết M bằng dung dịch HNO3 đặc nóng
thì thu được dung dịch chỉ chứa muối của kim loại M hóa trị III v{ 0,9 mol khí NO2.
a) Sử dụng hết c|c dữ kiện, x|c định oxit kim loại.
b) Nếu chỉ biết trong MxOy, M chiếm 72,41% theo khối lượng, h~y x|c định oxit kim loại.
Giải:
t0

a) Phản ứng: MxOy + yCO  xM + yCO2
M + 6HNO3 → M(NO3)3 + 3NO2↑ + 3H2O
nM=1/3nNO2=0,3mol
72,41 100  72,41
:
=3:4  Fe3O4
56
16
Mx
16y
2y
 M= =21
b) Ta có:
=
72,41 100  72,41
x
8
Biện luận: 2y
1
2
3
x
3

M=16,8.0,3=56  M à Fe  x:y=

M 21 (loại) 42 (loại) 63 (loại) 56 (Fe)
Ví dụ 3: Chia 22,59 gam hỗn hợp E1 gồm Fe v{ kim loại M (có ho| trị không đổi) l{m
3 phần bằng nhau. Ho{ tan hết phần 1 bằng dung dịch HCl thì thu được 3,696 lít khí H 2.
Phần 2 t|c dụng với ho{n to{n với dung dịch H2SO4 đặc nóng dư thì thu được 5,04 lít SO2
(sản phẩm khử duy nhất). Viết c|c phương trình phản ứng xảy ra v{ x|c định kim loại M. Biết c|c
khí đo ở đktc.
Giải:
Gọi x, y lần lượt l{ số mol của Fe v{ M
T|c dụng với dung dịch HCl
Fe + 2HCl  FeCl2 + H2 (1)
x

x
2M + 2nHCl 2MCln + nH2 (2)
y

0,5ny
T|c dụng với dung dịch H2SO4 đặc nóng
t
 Fe2(SO4)3 + 3SO2 + 6H2O (3)
2Fe + 6H2SO4 đặc 
x

1,5x
t
 M2(SO4)n + nSO2 + 2nH2O (4)
2M + 2nH2SO4 đặc 
y

0,5ny
Theo (1 4) v{ b{i ra ta có hệ:
o

o

W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 15


Vững vàng nền tảng, Khai sáng tương lai

3, 696

x

0,5ny

=0,165

22, 4

1,5x  0,5ny  5, 04 = 0, 225

22, 4

 x  0,12

ny  0, 09

Mặt kh|c: 56.0,12+ My=22,59:3=7,53  My=0,81
Ta có: M=9n
n
1
2
3
M 9 (loại) 18 (loại) 27 (Al)
Vậy M l{ Al
3. B{i tập vận dụng
Câu 1: Cho m gam hỗn hợp X gồm: cacbonat, hiđrocacbonat v{ clorua của một kim loại kiềm
(ho| trị I) v{o dung dịch HCl lấy dư, được dung dịch Y v{ khí CO 2. Chia dung dịch Y th{nh hai
phần bằng nhau. Đem phần 1 tác dụng với dung dịch AgNO3 dư, thu được 68,88 gam kết tủa.
Phần 2 đem phản ứng vừa đủ với 125 ml dung dịch KOH 0,8M, rồi cô cạn dung dịch sau phản
ứng thì thu được 29,68 gam hỗn hợp muối khan. X|c định kim loại kiềm, biết c|c phản ứng xảy
ra hoàn toàn.
Câu 2: Chia 26,88 gam MX2 th{nh 2 phần bằng nhau. Cho phần 1 v{o 500 ml dung dịch NaOH
dư thu được 5,88 gam M(OH)2 kết tủa v{ dung dịch D. Cho phần 2 v{o 360 ml dung dịch AgNO3
1M được dung dịch B v{ 22,56 gam AgX kết tủa. Viết c|c phương trình phản ứng xảy ra và xác
định MX2.
V. MỘT SỐ BÀI TÂP
Câu 1: Một hợp chất X gồm 3 nguyên tố C, H, O có th{nh phần % theo khối lượng lần lượt l{:
37,5%; 12,5%; 50%. Biết tỉ khối của X so với H2 bằng 16. Tìm CTHH của X.
Câu 2: Cho biết hợp chất của nguyên tố R (hóa trị x) với nhóm SO4 có 20% khối lượng thuộc
nguyên tố R.
1. Thiết lập biểu thức tính nguyên tử khối của R theo hóa trị x.
2. H~y tính % khối lượng của nguyên tố R đó trong hợp chất của nguyên tố R với oxi
(không cần x|c định nguyên tố R).
Câu 3: Hợp chất A được cấu tạo bởi nguyên tố X hóa trị V với nguyên tố oxi. Biết ph}n tử
khối của hợp chất A bằng 142đvC. Hợp chất B được tạo bởi nguyên tố Y (hóa trị y , 1≤ y ≤ 3)
và nhóm SO4, biết rằng ph}n tử khối của hợp chất A chỉ nặng bằng 0,355 lần ph}n tử hợp
chất B. Tìm nguyên tử khối của c|c nguyên tố X v{ Y. Viết CTHH của hợp chất A v{ B.
Câu 4: Tìm CTHH của hợp chất giữa oxi v{ sắt, biết trong đó Fe chiếm 70 % về khối lượng.
Câu 5: Cho biết tỉ lệ khối lượng của c|c nguyên tử trong hợp chất cacbon đisunfua l{ 3/16.
H~y tính tỉ lệ số nguyên tử C v{ S trong hợp chất cacbon đisunfua, tỉ lệ n{y có phù hợp với
công thức hóa học của hợp chất CS2 không?
Câu 6: Một hợp chất giữa sắt v{ clorua có chứa 44% Fe còn lại l{ Cl. Tính hóa trị của nguyên
tố Fe trong hợp chất.
Câu 7: A l{ một oxit của ni tơ có ph}n tử khối l{ 92 v{ tỉ lệ số nguyên tử N v{ O l{ 1:2. B l{
một oxit kh|c của nitơ, ở đktc 1 lít khí B nặng bằng 1 lít khí CO2. Tìm CTHH của A, B.
Câu 8 : Một hợp chất tạo bởi C v{ H có tỉ lệ khối lượng mC:mH =4: 1. Biết ph}n tử khối của
hợp chất l{ 30 đvC. H~y tìm công thức ph}n tử của hợp chất.
Câu 9: Nung hỗn hợp gồm bột Fe v{ S thu được hợp chất sắt sunfua. Biết 2 nguyên tố n{y
kết hợp với nhau theo tỉ lệ khối lượng l{ 7 phần Fe v{ 4 phần S. Tìm CTHH của hợp chất.
Câu 10: X|c định CTHH của A v{ B biết rằng:
1. Đem nung 30,3 gam muối vô cơ A thì thu được 3360 ml khí O 2 (đktc) v{ một chất
rắn có th{nh phần khối lượng gồm: 45,88% K, 16,48% N, 37,64 % O.
W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 16


Vững vàng nền tảng, Khai sáng tương lai

2. B l{ một oxit của kim loại R chưa rõ hóa trị, biết tỉ lệ khối lượng của ô xi bằng 1/8% R.
Câu 11: Tìm CTHH của một oxit sắt biết ph}n tử khối l{ 160, tỉ lệ khối lượng của săt v{ oxi l{ 7/3.
Câu 12: H~y tìm công thưc đơn giản nhất của một loại lưu huỳnh oxi, biết rằng trong oxit
n{y có 2 gam S kết hợp với 3 gam oxi.
Câu 13: Cho biết khối lượng mol của một oxit kim loại l{ 160 gam. Th{nh phần về khối
lượng của kim loại trong oxit l{ 70%. Lập CTHH của oxit đó.
Câu 14: H~y tìm thể tích khí oxi đủ để đốt ch|y hết 11,2 lít khí A (đktc). Biết rằng:
- Khí A có tỉ khối so với không khí l{ 0,552.
- Th{nh phần theo khối lượng của khí A l{: 75% C, 25% H.
Câu 15: Một hỗn hợp khí của nitơ gồm NO, NO2, NxO biết th{nh phần phần trăm về thể tích
của c|c khí trong hỗn hợp l{: %VNO = 50%, VNO2 = 25%. Th{nh phần phần trăm về khối
lượng của NO trong hỗn hợp l{ 40%. X|c định CTHH của khí NxO.
Câu 16: Cho 2,1 gam kim loại A hóa trị I v{o nước dư thu được lượng H2 nhỏ hơn 1,12 lít khí
ở đktc. Nếu cho 8,2 gam kim loại A v{o nước dư thì lượng H2 tho|t ra vượt qu| 2,24 lít
(đktc). X|c định kim loại A.
Câu 17: Đốt ch|y ho{n to{n 23 gam hợp chất A cần 33,6 lít oxi (đktc) v{ thu được thể tích
CO2 bằng 2/3 thể tích hơi nước. X|c định CTHH của A. Biết rằng tỉ khối hơi của A so với khí
oxi là 1,4375.
Câu 18: Có 2 khí: A l{ hợp chất của nguyên tố X với oxi; B l{ hợp chất của nguyên tố Y với H.
Trong 1 ph}n tử A hoặc B chỉ có một nguyên tử X hoặc Y. Trong A oxi chiếm 50%, còn trong B
hiđro chiếm 25%. Tỉ khối của A đối với B l{ 4. X|c định CTHH của khí A v{ B.

W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 17


Vững vàng nền tảng, Khai sáng tương lai

CHƯƠNG 7: TÍNH THEO PHƯƠNG TRÌNH HÓA HỌC
I. PHƯƠNG PHÁP CHUNG
1. Tính số mol chất m{ b{i đ~ cho
2. Viết phương trình phản ứng
3. Theo phương trình phản ứng v{ b{i ra, x|c định yêu cầu đề ra
4. Trả lời
II. KIẾN THỨC CƠ BẢN
Xét phản ứng: aA + bB  cC + dD
n
nA  a. B (Số mol của TÔI= Hệ số của TÔI nhân Số mol của BẠN chia Hệ số của BẠN)
b

Chú ý: Có thể tính theo b{i ra v{ theo phương trình phản ứng
III. BÀI TẬP
1. Ví dụ 1: Hòa tan hoàn to{n 5,4 gam bột nhôm trong dung dịch axit clohiđric.
a) Viết PTPƯ xảy ra.
b) Tính thể tích khí hiđro sinh ra ở (đktc).
c) Tính khối lượng axit cần dùng.
d) Tính số khối lượng muối sinh ra.
Giải:
Ta có: nAl =5,4 : 27 =0,2 (mol)
Phương trình phản ứng:
2Al + 6HCl
2AlCl3 +3H2 (1)
3.n
Al = 3.0,2 = 0,3 mol  V(H2) (đktc) =0,3 .22,4 =6,72 lít.
2
2
nHCl =3. nAl =3.0,2 =0,6 mol  mHCl = 0,6.36,5 =21,9 gam
nAlCl3 = nAl =0,2 mol  mAlCl3 =0,2.133,5 = 26,7 gam

Theo(1): n(H2)=

2. Ví dụ 2: Tính khối lượng khí oxi cần dùng để đốt ch|y ho{n to{n hỗn hợp sau: 0,4
mol Al và 0,8 mol Zn.
Giải:
Phương trình phản ứng:
4Al + 3O2  2Al2O3 (1)
2Zn + O2  2ZnO (1)
Theo (1,2):nO2 =

3
1
3
1
n  nZn = .0,4  .0,8 =0,7 mol  mO2= 0,7. 32=22,4 gam.
Al
4
2
4
2

IV. BÀI TẬP VẬN DỤNG
Câu 1: Oxi hóa hoàn toàn 5,4 gam Al.
- Tính thể tích oxi cần dùng ở (đkc)
- Tính số gam KMnO4 cần dùng để điều chế lượng oxi trên
Câu 2: Đốt ch|y ho{n to{n 5 lít khí H2 trong không khí sinh ra hơi nước. Tính thể tích khí oxi
v{ thể tích không khí cần dùng biết rằng c|c thể tích cùng đo ở đk nhiệt độ v{ |p suất.
Câu 3: Cho 19,5 gan Zn v{o dung dịch H2SO4 lo~ng dư thu được bao nhiêu lít khí H2 (đktc). Nếu
muốn điều chế được một thể tích H2 như vậy nhưng thay Zn bằng Al thì cần bao nhiêu gam Al.
Câu 4: Cho cùng một lượng Mg v{ Al như nhau cho t|c dụng với dung dịch HCl dư thì
trường hợp n{o thu được nhiều H2 hơn.
Câu 5: Tính thể tích khí oxi (đktc) cần dùng để đốt ch|y ho{n to{n hỗn hợp sau:
a) 3,1 gam P; 6,4 gam S và 3,6 gam C.
b) 1,6 gam CH4; 2,8 gam CO và 0,58 gam C4H10.

W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 18


Vững vàng nền tảng, Khai sáng tương lai

Câu 6: Tính khối lượng KClO3 và KMnO4 cần thiết để điều chế được một lượng khí oxi vừa
đủ để đốt ch|y hết:
a) Hỗn hợp gồm 0,5 mol CH4 và 0,25 mol H2.
b) Hỗn hợp gồm 6,75 gam bột Al v{ 9,75 gam bột Zn.
V. MỘT SỐ BÀI TẬP TÍNH THEO PTHH VÀ ĐỊNH LUẬT BẢO TOÀN
Câu 1: Đặt cốc A đựng dung dịch HCl v{ cốc B đựng dung dịch H 2SO4 lo~ng v{o 2 đĩa c}n sao
cho c}n ở vị trí c}n bằng. Sau đó l{m thí nghiệm như sau: Cho 11,2 gam Fe v{o cốc đựng
dung dịch HCl. Cho m gam Al v{o cốc đựng dung dịch H2SO4. Khi cả Fe v{ Al đều tan hoàn
to{n thấy c}n ở vị trí thăng bằng. Tính m.
Câu 2: Cho luồng khí hiđro đi qua ống thuỷ tinh chứa 20 gam bột đồng (II) oxit ở 400 0C.
Sau phản ứng thu được 16,8 gam chất rắn.
1.Nêu hiện tượng phản ứng xảy ra.
2. Tính thể tích khí hiđro tham gia phản ứng trên ở đktc.
Câu 3: Thực hiện nung a gam KClO3 và b gam KMnO4 để thu khí ôxi. Sau khi phản ứng xảy ra
ho{n to{n thì thấy khối lượng c|c chất còn lại sau phản ứng bằng nhau.
1.Tính tỷ lệ

a
.
b

2. Tính tỷ lệ thể tích khí ôxi tạo th{nh của hai phản ứng.
Câu 4: T nh t le the t ch dung dich HCl 18,25% (D = 1,2 g/ml) va the t ch dung dich HCl
13% (D = 1,123 g/ml) đe pha thanh dung dich HCl 4,5 M.
Câu 5: Dùng khí CO để khử ho{n to{n 20 gam một hỗn hợp (hỗn hợp Y) gồm CuO v{ Fe 2O3 ở
nhiệt độ cao. Sau phản ứng, thu được chất rắn chỉ l{ c|c kim loại, lượng kim loại n{y được
cho phản ứng với dd H2SO4 lo~ng (lấy dư), thì thấy có 3,2 gam một kim loại m{u đỏ không
tan. Tính % khối lượng c|c chất có trong hỗn hợp Y?
Câu 6: Có V lít hỗn hợp khí gồm CO v{ H2. Chia hỗn hợp th{nh 2 phần bằng nhau. Đốt ch|y
ho{n to{n phần thứ nhất bằng oxi. Sau đó dẫn sản phẩm đi qua nước vôi trong dư, thu được
20 gam kết tủa trắng. Dẫn phần thứ 2 đi qua bột đồng oxit nóng dư. Phản ứng xong thu
được 19,2 gam kim loại đồng.
1.Viết phương trình phản ứng xảy ra.
2. Tính thể tích của V lít hỗn hợp khí ban đầu (ở đktc).
3. Tính th{nh phần % của hỗn hợp khí ban đầu theo khối lượng v{ theo thể tích.
Câu 7: Trên 2 đĩa c}n để hai cốc đựng dung dịch HCl dư v{ H2SO4 dư sao cho c}n ở vị trí
thăng bằng: Cho v{o cốc đựng dung dịch HCl 25 gam CaCO 3, cho v{o cốc đựng dung dịch
H2SO4 a gam Al c}n ở vị trí thăng bằng. Tính a.
Câu 8: Có hỗn hợp khí CO v{ CO2. Nếu cho hỗn hợp khí đi qua dung dịch Ca(OH)2 dư thì thu
được 1 g chất kết tủa m{u trắng. Nếu cho hỗn hợp khí n{y đi qua bột CuO nóng dư thì thu được
0,46 g Cu.
1.Viết phương trình phản ứng xảy ra.
2. Tính thể tích của hỗn hợp khí ở đktc v{ thể tích của mỗi khí có ở trong hỗn hợp.
W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 19


Vững vàng nền tảng, Khai sáng tương lai

CHƯƠNG 8: TOÁN HIỆU SUẤT PHẢN ỨNG
I. KIẾN THỨC CẦN NHỚ
1. Phản ứng ho{n to{n: l{ phản ứng hóa học xảy ra cho đến khi có ít nhất một chất
tham gia phản ứng hết
Hiệu suất đạt 100% Kết thúc phản ứng Kết thúc thí nghiệm
Chất A phản ứng ho{n to{n với B.
2. Phản ứng không ho{n to{n: Sau một thời gian Tính H% phản ứng Không
đề cập đến phản ứng ho{n to{n.
3. Công thức tính hiệu suất phản ứng:
a) Theo chaát tham gia : H%=
b) Theo san pham : H%=
Löu yù
:

Luong chat phan ung
.100%
Luong chat ban dau

Luong chat thuc te
.100%
Luong chat ly thuyet

H%
h
100

4. H% phải được x|c định dựa v{o chất hết nếu để phản ứng ho{n to{n. (NGHÈO)
aA + bB  cC + d D
Nếu: nA(ban đầu) : a < nB(ban đầu) : b  H% theo A.
5. Hiệu suất qu| trình gồm nhiều phản ứng nối tiếp:
H% = h1 h2  h3  … hn  100%
II. BÀI TẬP
Ví dụ 1: Hỗn hợp khí Y gồm N2 và H2 có tỉ khối so với He bằng 1,8. Đun nóng Y một thời
gian trong bình kín, Fe l{m xúc t|c, thu được hỗn hợp khí Z có tỉ khối so với He bằng 2. Tính
xt,t0 ,p


 2NH3).
hiệu suất của phản ứng tổng hợp NH3 (N2 + 3H2 

Giải:
Chọn số mol của hỗn hợp l{ 1
Gọi số mol của N2 là a, thì của H2 là 1 – a, số mol N2 phản ứng l{ x

xt,t0 ,p


 2NH3
N2 + 3H2 

Ban đầu:
a
1–a
Phản ứng: x
3x

Sau phản ứng:
a-x 1- a - 3x
2x
Hỗn hợp Y: 28a + 2(1 – a) = 1,8.4  a = 0,2
Hỗn hợp Z có số mol l{: a – x + 1 – a – 3x + 2x = 1 – 2x
mZ = (1 – 2x) 2.4. Ta có mX = mY  (1 – 2x)2 . 4 = 1,8.4  x = 0,05
Do:

0,2 0,8


1
3

Hiệu suất phản ứng theo N2  H%=

0,05
100  25%
0,2

Ví dụ 2: Hỗn hợp A gồm SO2 va khong kh co t le the t ch tương ưng la 1: 5. Nung
nong hon hơp A vơi xuc tac V2O5 sau phan ưng thu đươc hon hơp kh B. T khoi hơi của A so
với B l{ 0,93. Tính hiệu suất của phản ứng, biết không khí l{ hỗn hợp chứa 20% O 2 và 80%
N2 về thể tích.
Giải:
Trong A: a =nSO2  5a =n(không khí) (a mol O2 và 4a mol N2)  nA = 6a mol
Gọi x l{ số mol SO2 pư
W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 20


Vững vàng nền tảng, Khai sáng tương lai

xt,t

 2SO3
2SO2 + O2 

Trước pư: a
a
Pư:
x
0,5 x
x
Sau pư khí B gồm:
SO2(a-x) mol, O2(a-0,5x) mol, SO3(x) mol, N2(4a) mol
 nB = (6a – 0,5 x) mol
BTKL: mA = mB, do dA/B = 0,93  nB = 0,93nA
 (6.a – 0,5.x) = 0,93. 6.a  x = 0,84.a
o

Do

a a
  Hieä
u suaá
t theo SO2  Vậy: H% = x.100%/a = 84%.
2 1

Chú ý: Có thể chọn ban đầu 6 mol hỗn hợp khí
Ví dụ 3: Cho 19,5 gam Zn t|c dụng với 7 lít Cl2 thì thu được 36,72 gam ZnCl2. Tính
hiệu suất phản ứng.
Giải:
Zn
+
Cl2

ZnCl2
Bđ: 0,3mol
0,3125mol 0
Pư: 0,3
0,3
Sau: 0
0,125
0,3
mZnCl2 (lý thuyết)= 0,3  136 =40,8 gam
Vậy: H% 

36,75
.100%  90%
40,8

Ví dụ 4: Cho sơ đồ chuyển hóa: CH4 → C2H2 → C2H3Cl → PVC. Để tổng hợp 250 kg
PVC theo sơ đồ trên thì cần V m3 khí thiên nhiên (ở đktc). Tìm gi| trị của V (biết CH4 chiếm
80% thể tích khí thiên nhiên v{ hiệu suất của cả qu| trình l{ 50%).
Giải :
Sơ đồ :

2 CH4 → …. → C2H3Cl
8 kmol

Số mol CH4 cần dùng l{ n CH

← 4 kmol
4 cd



8.100
 16 kmol
50

Thể tích khí thiên nhiên cần dùng l{: 

16.100.22, 4
 448 lít
80

III. BÀI TẬP VẬN DỤNG
Câu 1: Cho hỗn hợp khí N2, H2 và NH3 có tỉ khối so với H2 là 8. Dẫn hỗn hợp đi qua dung dịch
H2SO4 đặc dư thì thể tích khí còn lai môt nữa. Tính th{nh phần trăm % theo thể tích của mỗi
khí trong hỗn hợp đầu.
Câu 2: Từ 1 tấn quặng Pirit chứa 90% FeS2. Điều chế được bao nhiêu kg dung dịch H2SO4
95%. Biết rằng hiệu suất chung của to{n bộ qu| trình l{ 85%.
Câu 3: Trong một bình kín dung tích 56 lít chứa N 2 và H2 theo tỷ lệ thể tích l{ 1:4, ở 00C, 200
atm v{ một ít xúc t|c. Nung nóng bình sau một thời gian, sau đó đưa nhiệt độ bình về 0 0C
thấy |p suất trong bình giảm 10% so với lúc đầu. (PV=nRT)
1. Tính hiệu suất của phản ứng điều chế NH3.
2. Nếu lấy 1/2 lượng NH3 tạo th{nh có thể điều chế được bao nhiêu lít dung dịch HNO3
67% (D=1,4 gam/ml). Biết hiệu suất điều chế HNO3 là 80%.
Câu 4: Ho{ tan ho{n to{n một ít FexOy bằng dung dịch H2SO4 đặc nóng ta thu được 2,24 lít
SO2 (đktc), phần dung dịch chứa 120 gam một loại muối sắt duy nhất.
W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 21


Vững vàng nền tảng, Khai sáng tương lai

1. X|c định công thức của oxit sắt.
2. Trộn 10,8 gam Al v{ 46,4 gam FexOy ở trên rồi tiến h{nh phản ứng nhiệt nhôm, giả
sử chỉ khử về sắt (FexOy + Al  Fe + Al2O3). Ho{ tan ho{n to{n hỗn hợp chất rắn sau phản
ứng bằng dung dịch H2SO4 20% (D=1,14 gam/ml) thì thu được 10,752 lít H2 (đktc).
a) Tính H% của phản ứng nhiệt nhôm.
b) Tính thể tích tối thiểu d d H2SO4 đ~ dùng.
Câu 5: Đề hiđro ho| hỗn hợp C2H6 và C3H8 theo tỷ lệ thể tích tương ứng l{:1:3 thì thu được
hỗn hợp khí (chỉ gồm ankan, olefin v{ H2 ) có tỷ khối so với H2 bằng 13,5.
Tính H% của phản ứng đề hiđro ho|, biết c|c ankan có hiệu suất phản ứng như nhau.
Câu 6: Hỗn hợp gồm SO2 v{ không khí có tỷ lệ số mol l{:1:5. Nung nóng hỗn hợp A với xúc
t|c thì thu được hỗn hợp khí B. Tỷ khối của A so với B l{ 0,93. Tính H% phản ứng. Cho biết
không khí chứa 20% O2 và 80% N2.
Câu 7: Khi nung 21,6 gam KMnO4, sau một thời gian thấy còn lại 20 gam hỗn hợp rắn A.
1. Viết c|c phương trình phản ứng xảy ra v{ tính hiệu suất phản ứng nhiệt ph}n.
2. H~y tính khối lượng, Số ph}n tử khí O2 tạo th{nh.
Câu 8: Trong một bình kín chứa SO2 và O2 theo tỷ lệ mol l{ 1:1 v{ một ít bột xúc t|c l{ V2O5.
Nung nóng bình một thời gian thu được hỗn hợp khí trong đó khí sản phẩm chiếm 35,3%
theo thể tích. Tính hiệu suất phản ứng tạo th{nh SO3.
Câu 9: Nung 40,1 gam hỗn hợp A gồm Al v{ FexOy trong điều kiện không có không khí. Giả sử
chỉ xảy ra phản ứng khử FexOy th{nh kim loại. Sau một thời gian thì thu được hỗn hợp chất
rắn B. Cho to{n bộ B t|c dụng ho{n to{n với dung dịch NaOH dư thì thu được 3,36 lít khí H2
(đktc) v{ chất rắn không tan C nặng 27,2 gam. Nếu cho to{n bộ B tan hết trong dung dịch HCl
2M (dư) (khối lượng riêng l{ 1,05 gam/ml) thì thu được 7,84 lít khí H2 (đktc)
1. Viết c|c phương trình phản ứng, x|c định công thức FexOy
2. Tính hiệu suất phản ứng nhiệt nhôm v{ % theo khối lượng c|c chất trong B.
3. Tính khối lượng dung dịch axit HCl đ~ dùng, biết dùng dư 10% so với lượng cần thiết.
Câu 10: Trong một bình kín chứa 3 mol SO2 và 2 mol O2 v{ một ít bột xúc t|c l{ V2O5.
Nung nóng bình một thời gian thu được hỗn hợp khí A.
1. Nếu hiệu suất phản ứng l{ 75% thì có bao nhiêu mol SO3 tạo th{nh.
2. Nếu tổng số mol c|c khí trong A l{ 4,25 mol thì H% phản ứng tạo SO3 là bao nhiêu.
Câu 11: Cho V lít CO (đktc) đi qua ống sứ đựng a gam CuO, nung nóng. Sau khi kết thúc thí
nghiệm, khí đi ra khỏi ống sứ hấp thụ v{o dung dịch NaOH dư. Sau đó thêm v{o lượng dư
dung dịch BaCl2 thấy tạo th{nh m gam kết tủa.
1. Viết c|c phương trình phản ứng xảy ra.
2. Tính hiệu suất của phản ứng khử CuO theo V, a, m.
Câu 12: Cho 11,2 lít H2 t|c dụng với 6,72 lít Cl2 (đktc) rồi lấy sản phẩm hòa tan v{o 385,4
gam H2O, ta được dung dịch D. Lấy 50 gam D t|c dụng với dung dịch AgNO3 dư thấy tạo
th{nh 7,175 gam kết tủa. Tính hiệu suất của phản ứng giữa H2 và Cl2.

W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 22


Vững vàng nền tảng, Khai sáng tương lai

CHƯƠNG 9: DUNG DỊCH
I. KIẾN THỨC CƠ BẢN
1. Công thức tính
Lượng chất tan

Nồng độ %
mctan (gam)

Nồng độ mol
nctan (mol)

Lượng dung dịch

mdd (gam)

Vdd (lít)

Công thức tính

C% 

mct
.100%
m
dd

Độ tan
mctan (gam)

n
CM  ct (mol/lít)
V
dd

S

mct
.100 gam
m
dm

Trong đó: mdd = mdm + mct =Vdd (ml) . D (g/ml)
2. Mối liên hệ giữa nồng độ % (C%), nồng độ mol/lit (CM), D vàM
C%
1
100
mol tương ứng
ml=
lít
M
10.D
D
n
m
C% 1
1
10.D.C%
Vậy: CM  ct (mol/lít) =
:
=
và C%  ct .100% =
.CM.M%
M 10.D
10.D
V
m
M
dd
dd

Nguyên tắc: Trong 100 gam dung dịch tương ứng

3. Muối ngậm nước
Tinh thể của muối mà ph}n tử có chứa một số ph}n tử nước kết tinh nhất định gọi
tinh thể ngậm muối nước.
Ví dụ: Na2CO3.10H2O trong đó: Na2CO3 là khan và 10H2O l{ nước kết tinh.
Cách tính: Na2CO3.10H2O=106+10.18=286
4. Để đơn giản khi tính nồng độ % ta nên sử dụng
C% mct

 C%
100 m
dd

5. Khi pha trộn c|c dung dịch để tạo th{nh dung dịch mới
mdd mới =  mdd pha trộn - mkhí - mkết tủa
Khi đề không cho khối lượng riêng của dung dịch mới: Vdd mới =  Vdd pha trộn
m
Khi đề cho khối lượng riêng của dung dịch mới: Vdd =  ddmôùi
D

ddmôù
i

II. DẠNG PHA TRỘN KHÔNG CÓ TƯƠNG TÁC HÓA HỌC
1. Phương ph|p
- mCT(chất tan)= mCHT (chất hòa tan)
- Vdd mới = V1 + V2 + V3...
- mdd mới = Tổng khối lượng c|c chất v{ dung dịch pha trộn
- Áp dụng công thức cơ bản về nồng độ % v{ nồng độ mol để tính
- Lưu ý b{i to|n muối ngậm nước
2. Ví dụ
Ví dụ 1: X|c định nồng độ phần trăm C% v{ nồng độ mol CM của dung dịch thu được
khi ho{ tan 12,5 gam tinh thể CuSO4.5H2O v{o 87,5 ml nước. Biết rằng thể tích của dung
dịch bằng thể tích của nước.
Giải:
Ta có: n(CuSO4)=n(CuSO4.5H2O)=12,5: 250 = 0,05 mol  mCuSO4 =0,05.160=8g
Chất ho{ tan Chất tan Khối lượng dd
V dd
Nồng độ %
Nồng độ mol/lít
m
n
CuSO4.5H2O CuSO4 87,5+12,5=100g 0,0875 lít
C%  ct .100% CM  ct (mol/lít)
8 gam
m
V
dd
dd


W: www.hoc247.net

F: www.facebook.com/hoc247.net

8
.100% =8%
100

T: 098 1821 807



0,05
=0,57M
0,0875

Trang | 23


Vững vàng nền tảng, Khai sáng tương lai

Ví dụ 2: Trình b{y phương ph|p thực nghiệm để x|c định nồng độ phần trăm của
một mẫu dung dịch CuSO4 có sẵn trong phòng thí nghiệm.
Giải:
-C}n một lượng dung dịch có sẵn l{ m gam
-Cô cạn dung dịch, rồi c}n lượng muối khan thu được l{ a gam
a
m

-Tính C%= 100%
Ví dụ 3: Có 2 lọ đựng dung dịch H2SO4. Lọ thứ nhất có nồng độ 1M, lọ thứ hai có nồng
độ 3M. H~y tính to|n v{ trình b{y c|ch pha chế 50 ml dung dịch H2SO4 có nồng độ 1,5M từ 2
dung dịch axit đ~ cho.
Giải:
-Ta có nH2SO4 (trong 50 ml dung dịch 1,5M)=1,5.0,05=0,075 mol
-Gọi x (ml) v{ y(ml) lần lượt l{ thể tích của dd axit 1M v{ 3M
0, 001x  0, 003y  0, 075 x  37,5

 x  y  50
 y  12,5

Hệ: 

-C|ch pha: Đong lấy 37,5 ml dd H2SO4 1M và 12,5 ml dd H2SO4 3M cho v{o bình lắc
đều ta được dd cần pha.
3. B{i tập vận dụng
Câu 1: Lập biểu thức liên hệ giữa độ tan v{ nồng độ phần trăm (khối lượng) của chất tan
trong dung dịch b~o ho{.
Câu 2: A l{ dung dịch CuSO4 . Để l{m kết tủa hết ion sunfat có trong 20 gam dung dịch A cần
25 ml dung dịch BaCl2 0,02M.
a) Tính nồng độ phần trăm khối lượng của dung dịch A.
b) Cần lấy bao nhiêu gam dung dịch A v{ bao nhiêu gam CuSO 4 để điều chế 480 gam
dung dịch CuSO4 1% (dung dịch B).
c) Cần lấy bao nhiêu gam dung dịch A v{ bao nhiêu gam CuSO4.5H2O để điều chế 480
gam dung dịch CuSO4 1% (dung dịch B).
III. DẠNG PHA TRỘN CÓ TƯƠNG TÁC HÓA HỌC
1. Phương ph|p
- X|c định chất tan v{ chất hóa tan
- Tính lượng khí bay ra v{ kết tủa nếu có
- Tính khối lượng dung dịch hay thể tích dung dịch
- Trả lời yêu cầu của b{i ra
2. Ví dụ
Ví dụ 1: Tính khối lượng N2O5 cần ho{ tan v{o 120 gam nước để thu được dung dịch HNO3 10%.
Giải:
Phương trình phản ứng: N2O5 + H2O  2HNO3
Chất ho{ tan
N2O5

Chất tan
HNO3

Khối lượng dung dịch

x (gam)

63.2.x
108

(x + 120) (gam)

Nồng độ
10
126.x

100 108.(x  120)

 x=11,25 gam

W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 24


Vững vàng nền tảng, Khai sáng tương lai

Ví dụ 2: Cho 27,4 gam Ba v{o 400 gam dung dịch CuSO4 3,2% thu được khí X, kết tủa
Y v{ dung dịch Z. Nung Y đến khối lượng không đổi thì thu được x gam chất rắn. Viết c|c
phương trình phản ứng, tính x v{ nồng độ phần trăm của chất tan trong dung dịch Z.
Giải:
Ta có n Ba  27,4:137=0,2 mol, nCuSO = (400x3,2):(160x100)=0,08 mol
4

Phản ứng: Ba + 2H2O  Ba(OH)2 + H2 (1)
0,2
0,2
0,2

Ba(OH)2 + CuSO4  BaSO4 + Cu(OH)2
(2)
0,08  0,08  0,08  0,08
t
Cu(OH)2 
(3)
 CuO + H2O
0,08
0,08

Suy ra: x = 0,08 . 233 + 0,08 . 80 = 25,04 gam, Trong Z chỉ còn Ba(OH)2
mdd = 400 + 27,4  0,2 . 2  0,08 . 233  0,08 .98 = 400,52gam
o

C%Ba OH  =
2

(0,2  0,08)171
.100  5,12% .
400,52

3. B{i tập vận dụng
Câu 1: Cho 20 ml dung dịch AgNO3 1M (D=1,1 g/ml) v{o 150 ml dung dịch HCl 0,5M
(D=1,05 g/ml). Tính C% và CM của dung dịch sau phản ứng.
Câu 2: Đốt ch|y 0,78 gam kali trong bình kín đựng khí oxi (dư) (giả sử tạo kali oxit). Phản
ứng xong, người ta đổ ít nước v{o bình lắc nhẹ cho chất rắn tan hết, rồi thêm nước cho đủ
200 ml ta được dung dịch A.
a) Viết phương trình phản ứng đ~ xảy ra.
b) X|c định nồng độ mol/lít của chất trong dung dịch A.
c) Thêm v{i giọt quì tím v{o dung dịch A, sau đó dẫn 672 ml khí hiđro clorua (đktc)
v{o dung dịch A. Trình b{y hiện tượng v{ viết phương trình phản ứng giải thích.
Câu 3: Đốt ch|y ho{n to{n 1,55 gam P thu được chất A. Ho{ tan chất A v{o 200 gam nước
được dung dịch B. Tính C% của dung dịch B.
Câu 4: Cho m gam kim loại Na v{o 200 gam dung dịch Al2(SO4)3 nồng độ 1,71%. Sau khi
phản ứng xong thu được 0,78 gam kết tủa. Tính m ?
Câu 5: Hai dung dịch H2SO4 A và B.
1. H~y tính nồng độ phần trăm của A v{ B biết rằng nồng độ của B lớn hơn của A 2,5 lần
v{ khi trộn A với B theo tỉ lệ khối lượng 7 : 3 thì thu được dung dịch C có nồng độ 29%.
2. Lấy 50 ml dung dịch C ( có D = 1,27 g/ml) t|c dụng với 200 ml dung dịch BaCl 2 1M.
Lọc v{ t|ch kết tủa.
a) H~y tính nồng độ mol (mol/l) của axit HCl có trong dung dịch nước lọc, giả sử thể
tích dung dịch thay đổi không đ|ng kể.
b) Nếu cho 21,2 gam Na2CO3 t|c dụng với dung dịch nước lọc có kết tủa tạo ra hay
không? Nếu có khối lượng l{ bao nhiêu?
c) Nếu thay Na2CO3 bằng khí CO2 có kết tủa tạo ra hay không? Giải thích nguyên nh}n.
Câu 6: Cho 9,03.1022 ph}n tử hiđro tham gia phản ứng với 3,01.1022 ph}n tử nitơ. Ho{ tan
amoniac thu được trong 0,4 lít nước.
a) Tính số ph}n tử, số mol v{ số gam amoniac tạo th{nh.
b) Tính C% và CM của dung dịch thu được (coi thể tích dung dịch bằng thể tích của
nước ho{ tan). C|c phản ứng xảy ra ho{n to{n.

W: www.hoc247.net

F: www.facebook.com/hoc247.net

T: 098 1821 807

Trang | 25


Tài liệu bạn tìm kiếm đã sẵn sàng tải về

Tải bản đầy đủ ngay

×